From 5467fb025537eb92313fd3a557b2051cb41ba5e8 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Fri, 6 Oct 2006 15:36:29 +0100 Subject: =?UTF-8?q?[MTD=20NAND]=20Initial=20import=20of=20CAF=C3=89=20NAND?= =?UTF-8?q?=20driver.?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Signed-off-by: David Woodhouse --- drivers/mtd/nand/Kconfig | 7 + drivers/mtd/nand/Makefile | 1 + drivers/mtd/nand/cafe_nand.c | 635 +++++++++++++++++++++++++++++++++++++++++++ 3 files changed, 643 insertions(+) create mode 100644 drivers/mtd/nand/cafe_nand.c (limited to 'drivers/mtd') diff --git a/drivers/mtd/nand/Kconfig b/drivers/mtd/nand/Kconfig index c99302ed382..5e97e63e127 100644 --- a/drivers/mtd/nand/Kconfig +++ b/drivers/mtd/nand/Kconfig @@ -232,6 +232,13 @@ config MTD_NAND_CS553X If you say "m", the module will be called "cs553x_nand.ko". +config MTD_NAND_CAFE + tristate "NAND support for OLPC CAFÉ chip" + depends on PCI + help + Use NAND flash attached to the CAFÉ chip designed for the $100 + laptop. + config MTD_NAND_NANDSIM tristate "Support for NAND Flash Simulator" depends on MTD_NAND && MTD_PARTITIONS diff --git a/drivers/mtd/nand/Makefile b/drivers/mtd/nand/Makefile index f74759351c9..9346b831bc3 100644 --- a/drivers/mtd/nand/Makefile +++ b/drivers/mtd/nand/Makefile @@ -6,6 +6,7 @@ obj-$(CONFIG_MTD_NAND) += nand.o nand_ecc.o obj-$(CONFIG_MTD_NAND_IDS) += nand_ids.o +obj-$(CONFIG_MTD_NAND_CAFE) += cafe_nand.o obj-$(CONFIG_MTD_NAND_SPIA) += spia.o obj-$(CONFIG_MTD_NAND_AMS_DELTA) += ams-delta.o obj-$(CONFIG_MTD_NAND_TOTO) += toto.o diff --git a/drivers/mtd/nand/cafe_nand.c b/drivers/mtd/nand/cafe_nand.c new file mode 100644 index 00000000000..8d7a795a947 --- /dev/null +++ b/drivers/mtd/nand/cafe_nand.c @@ -0,0 +1,635 @@ +/* + * cafe_nand.c + * + * Copyright © 2006 Red Hat, Inc. + * Copyright © 2006 David Woodhouse + */ + +//#define DEBUG + +#include +#undef DEBUG +#include +#include +#include +#include +#include +#include + +#define CAFE_NAND_CTRL1 0x00 +#define CAFE_NAND_CTRL2 0x04 +#define CAFE_NAND_CTRL3 0x08 +#define CAFE_NAND_STATUS 0x0c +#define CAFE_NAND_IRQ 0x10 +#define CAFE_NAND_IRQ_MASK 0x14 +#define CAFE_NAND_DATA_LEN 0x18 +#define CAFE_NAND_ADDR1 0x1c +#define CAFE_NAND_ADDR2 0x20 +#define CAFE_NAND_TIMING1 0x24 +#define CAFE_NAND_TIMING2 0x28 +#define CAFE_NAND_TIMING3 0x2c +#define CAFE_NAND_NONMEM 0x30 +#define CAFE_NAND_DMA_CTRL 0x40 +#define CAFE_NAND_DMA_ADDR0 0x44 +#define CAFE_NAND_DMA_ADDR1 0x48 +#define CAFE_NAND_READ_DATA 0x1000 +#define CAFE_NAND_WRITE_DATA 0x2000 + +struct cafe_priv { + struct nand_chip nand; + struct pci_dev *pdev; + void __iomem *mmio; + uint32_t ctl1; + uint32_t ctl2; + int datalen; + int nr_data; + int data_pos; + int page_addr; + dma_addr_t dmaaddr; + unsigned char *dmabuf; + +}; + +static int usedma = 1; +module_param(usedma, int, 0644); + +static int cafe_device_ready(struct mtd_info *mtd) +{ + struct cafe_priv *cafe = mtd->priv; + int result = !!(readl(cafe->mmio + CAFE_NAND_STATUS) | 0x40000000); + + uint32_t irqs = readl(cafe->mmio + 0x10); + writel(irqs, cafe->mmio+0x10); + dev_dbg(&cafe->pdev->dev, "NAND device is%s ready, IRQ %x (%x) (%x,%x)\n", + result?"":" not", irqs, readl(cafe->mmio + 0x10), + readl(cafe->mmio + 0x3008), readl(cafe->mmio + 0x300c)); + return result; +} + + +static void cafe_write_buf(struct mtd_info *mtd, const uint8_t *buf, int len) +{ + struct cafe_priv *cafe = mtd->priv; + + if (usedma) + memcpy(cafe->dmabuf + cafe->datalen, buf, len); + else + memcpy_toio(cafe->mmio + CAFE_NAND_WRITE_DATA + cafe->datalen, buf, len); + cafe->datalen += len; + + dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes to write buffer. datalen 0x%x\n", + len, cafe->datalen); +} + +static void cafe_read_buf(struct mtd_info *mtd, uint8_t *buf, int len) +{ + struct cafe_priv *cafe = mtd->priv; + + if (usedma) + memcpy(buf, cafe->dmabuf + cafe->datalen, len); + else + memcpy_fromio(buf, cafe->mmio + CAFE_NAND_READ_DATA + cafe->datalen, len); + + dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes from position 0x%x in read buffer.\n", + len, cafe->datalen); + cafe->datalen += len; +} + +static uint8_t cafe_read_byte(struct mtd_info *mtd) +{ + struct cafe_priv *cafe = mtd->priv; + uint8_t d; + + cafe_read_buf(mtd, &d, 1); + dev_dbg(&cafe->pdev->dev, "Read %02x\n", d); + + return d; +} + +static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, + int column, int page_addr) +{ + struct cafe_priv *cafe = mtd->priv; + int adrbytes = 0; + uint32_t ctl1; + uint32_t doneint = 0x80000000; + int i; + + dev_dbg(&cafe->pdev->dev, "cmdfunc %02x, 0x%x, 0x%x\n", + command, column, page_addr); + + if (command == NAND_CMD_ERASE2 || command == NAND_CMD_PAGEPROG) { + /* Second half of a command we already calculated */ + writel(cafe->ctl2 | 0x100 | command, cafe->mmio + 0x04); + ctl1 = cafe->ctl1; + dev_dbg(&cafe->pdev->dev, "Continue command, ctl1 %08x, #data %d\n", + cafe->ctl1, cafe->nr_data); + goto do_command; + } + /* Reset ECC engine */ + writel(0, cafe->mmio + CAFE_NAND_CTRL2); + + /* Emulate NAND_CMD_READOOB on large-page chips */ + if (mtd->writesize > 512 && + command == NAND_CMD_READOOB) { + column += mtd->writesize; + command = NAND_CMD_READ0; + } + + /* FIXME: Do we need to send read command before sending data + for small-page chips, to position the buffer correctly? */ + + if (column != -1) { + writel(column, cafe->mmio + 0x1c); + adrbytes = 2; + if (page_addr != -1) + goto write_adr2; + } else if (page_addr != -1) { + writel(page_addr & 0xffff, cafe->mmio + 0x1c); + page_addr >>= 16; + write_adr2: + writel(page_addr, cafe->mmio+0x20); + adrbytes += 2; + if (mtd->size > mtd->writesize << 16) + adrbytes++; + } + + cafe->data_pos = cafe->datalen = 0; + + /* Set command valid bit */ + ctl1 = 0x80000000 | command; + + /* Set RD or WR bits as appropriate */ + if (command == NAND_CMD_READID || command == NAND_CMD_STATUS) { + ctl1 |= (1<<26); /* rd */ + /* Always 5 bytes, for now */ + cafe->datalen = 5; + /* And one address cycle -- even for STATUS, since the controller doesn't work without */ + adrbytes = 1; + } else if (command == NAND_CMD_READ0 || command == NAND_CMD_READ1 || + command == NAND_CMD_READOOB || command == NAND_CMD_RNDOUT) { + ctl1 |= 1<<26; /* rd */ + /* For now, assume just read to end of page */ + cafe->datalen = mtd->writesize + mtd->oobsize - column; + } else if (command == NAND_CMD_SEQIN) + ctl1 |= 1<<25; /* wr */ + + /* Set number of address bytes */ + if (adrbytes) + ctl1 |= ((adrbytes-1)|8) << 27; + + if (command == NAND_CMD_SEQIN || command == NAND_CMD_ERASE1) { + /* Ignore the first command of a pair; the hardware + deals with them both at once, later */ + cafe->ctl1 = ctl1; + cafe->ctl2 = 0; + dev_dbg(&cafe->pdev->dev, "Setup for delayed command, ctl1 %08x, dlen %x\n", + cafe->ctl1, cafe->datalen); + return; + } + /* RNDOUT and READ0 commands need a following byte */ + if (command == NAND_CMD_RNDOUT) + writel(cafe->ctl2 | 0x100 | NAND_CMD_RNDOUTSTART, cafe->mmio + CAFE_NAND_CTRL2); + else if (command == NAND_CMD_READ0 && mtd->writesize > 512) + writel(cafe->ctl2 | 0x100 | NAND_CMD_READSTART, cafe->mmio + CAFE_NAND_CTRL2); + + do_command: + if (cafe->datalen == 2112) + cafe->datalen = 2062; + dev_dbg(&cafe->pdev->dev, "dlen %x, ctl1 %x, ctl2 %x\n", + cafe->datalen, ctl1, readl(cafe->mmio+CAFE_NAND_CTRL2)); + /* NB: The datasheet lies -- we really should be subtracting 1 here */ + writel(cafe->datalen, cafe->mmio + CAFE_NAND_DATA_LEN); + writel(0x90000000, cafe->mmio + 0x10); + if (usedma && (ctl1 & (3<<25))) { + uint32_t dmactl = 0xc0000000 + cafe->datalen; + /* If WR or RD bits set, set up DMA */ + if (ctl1 & (1<<26)) { + /* It's a read */ + dmactl |= (1<<29); + /* ... so it's done when the DMA is done, not just + the command. */ + doneint = 0x10000000; + } + writel(dmactl, cafe->mmio + 0x40); + } +#if 0 + printk("DMA setup is %x, status %x, ctl1 %x\n", readl(cafe->mmio + 0x40), readl(cafe->mmio + 0x0c), readl(cafe->mmio)); + printk("DMA setup is %x, status %x, ctl1 %x\n", readl(cafe->mmio + 0x40), readl(cafe->mmio + 0x0c), readl(cafe->mmio)); +#endif + cafe->datalen = 0; + +#if 0 + printk("About to write command %08x\n", ctl1); + for (i=0; i< 0x5c; i+=4) + printk("Register %x: %08x\n", i, readl(cafe->mmio + i)); +#endif + writel(ctl1, cafe->mmio + CAFE_NAND_CTRL1); + /* Apply this short delay always to ensure that we do wait tWB in + * any case on any machine. */ + ndelay(100); + + if (1) { + int c = 50000; + uint32_t irqs; + + while (c--) { + irqs = readl(cafe->mmio + 0x10); + if (irqs & doneint) + break; + udelay(1); + if (!(c & 1000)) + dev_dbg(&cafe->pdev->dev, "Wait for ready, IRQ %x\n", irqs); + cpu_relax(); + } + writel(doneint, cafe->mmio + 0x10); + dev_dbg(&cafe->pdev->dev, "Command %x completed after %d usec, irqs %x (%x)\n", command, 50000-c, irqs, readl(cafe->mmio + 0x10)); + } + + + cafe->ctl2 &= ~(1<<8); + cafe->ctl2 &= ~(1<<30); + + switch (command) { + + case NAND_CMD_CACHEDPROG: + case NAND_CMD_PAGEPROG: + case NAND_CMD_ERASE1: + case NAND_CMD_ERASE2: + case NAND_CMD_SEQIN: + case NAND_CMD_RNDIN: + case NAND_CMD_STATUS: + case NAND_CMD_DEPLETE1: + case NAND_CMD_RNDOUT: + case NAND_CMD_STATUS_ERROR: + case NAND_CMD_STATUS_ERROR0: + case NAND_CMD_STATUS_ERROR1: + case NAND_CMD_STATUS_ERROR2: + case NAND_CMD_STATUS_ERROR3: + writel(cafe->ctl2, cafe->mmio + CAFE_NAND_CTRL2); + return; + } + nand_wait_ready(mtd); + writel(cafe->ctl2, cafe->mmio + CAFE_NAND_CTRL2); +} + +static void cafe_select_chip(struct mtd_info *mtd, int chipnr) +{ + //struct cafe_priv *cafe = mtd->priv; + // dev_dbg(&cafe->pdev->dev, "select_chip %d\n", chipnr); +} +static int cafe_nand_interrupt(int irq, void *id, struct pt_regs *regs) +{ + struct mtd_info *mtd = id; + struct cafe_priv *cafe = mtd->priv; + uint32_t irqs = readl(cafe->mmio + 0x10); + writel(irqs & ~0x90000000, cafe->mmio + 0x10); + if (!irqs) + return IRQ_NONE; + + dev_dbg(&cafe->pdev->dev, "irq, bits %x (%x)\n", irqs, readl(cafe->mmio + 0x10)); + return IRQ_HANDLED; +} + +static void cafe_nand_bug(struct mtd_info *mtd) +{ + BUG(); +} + +static int cafe_nand_write_oob(struct mtd_info *mtd, + struct nand_chip *chip, int page) +{ + int status = 0; + + WARN_ON(chip->oob_poi != chip->buffers->oobwbuf); + + chip->cmdfunc(mtd, NAND_CMD_SEQIN, mtd->writesize, page); + chip->write_buf(mtd, chip->oob_poi, mtd->oobsize); + chip->cmdfunc(mtd, NAND_CMD_PAGEPROG, -1, -1); + status = chip->waitfunc(mtd, chip); + + return status & NAND_STATUS_FAIL ? -EIO : 0; +} + +/* Don't use -- use nand_read_oob_std for now */ +static int cafe_nand_read_oob(struct mtd_info *mtd, struct nand_chip *chip, + int page, int sndcmd) +{ + chip->cmdfunc(mtd, NAND_CMD_READOOB, 0, page); + chip->read_buf(mtd, chip->oob_poi, mtd->oobsize); + return 1; +} +/** + * cafe_nand_read_page_syndrome - {REPLACABLE] hardware ecc syndrom based page read + * @mtd: mtd info structure + * @chip: nand chip info structure + * @buf: buffer to store read data + * + * The hw generator calculates the error syndrome automatically. Therefor + * we need a special oob layout and handling. + */ +static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, + uint8_t *buf) +{ + struct cafe_priv *cafe = mtd->priv; + + WARN_ON(chip->oob_poi != chip->buffers->oobrbuf); + + dev_dbg(&cafe->pdev->dev, "ECC result %08x SYN1,2 %08x\n", readl(cafe->mmio + 0x3c), readl(cafe->mmio + 0x50)); + + chip->read_buf(mtd, buf, mtd->writesize); + chip->read_buf(mtd, chip->oob_poi, mtd->oobsize); + + return 0; +} + +static char foo[14]; +static void cafe_nand_write_page_lowlevel(struct mtd_info *mtd, + struct nand_chip *chip, const uint8_t *buf) +{ + struct cafe_priv *cafe = mtd->priv; + + WARN_ON(chip->oob_poi != chip->buffers->oobwbuf); + + chip->write_buf(mtd, buf, mtd->writesize); + chip->write_buf(mtd, foo, 14); + // chip->write_buf(mtd, chip->oob_poi, mtd->oobsize); + + /* Set up ECC autogeneration */ + cafe->ctl2 |= (1<<27) | (1<<30); + if (mtd->writesize == 2048) + cafe->ctl2 |= (1<<29); +} + +static int cafe_nand_write_page(struct mtd_info *mtd, struct nand_chip *chip, + const uint8_t *buf, int page, int cached, int raw) +{ + int status; + + WARN_ON(chip->oob_poi != chip->buffers->oobwbuf); + + chip->cmdfunc(mtd, NAND_CMD_SEQIN, 0x00, page); + + if (unlikely(raw)) + chip->ecc.write_page_raw(mtd, chip, buf); + else + chip->ecc.write_page(mtd, chip, buf); + + /* + * Cached progamming disabled for now, Not sure if its worth the + * trouble. The speed gain is not very impressive. (2.3->2.6Mib/s) + */ + cached = 0; + + if (!cached || !(chip->options & NAND_CACHEPRG)) { + + chip->cmdfunc(mtd, NAND_CMD_PAGEPROG, -1, -1); + status = chip->waitfunc(mtd, chip); + /* + * See if operation failed and additional status checks are + * available + */ + if ((status & NAND_STATUS_FAIL) && (chip->errstat)) + status = chip->errstat(mtd, chip, FL_WRITING, status, + page); + + if (status & NAND_STATUS_FAIL) + return -EIO; + } else { + chip->cmdfunc(mtd, NAND_CMD_CACHEDPROG, -1, -1); + status = chip->waitfunc(mtd, chip); + } + +#ifdef CONFIG_MTD_NAND_VERIFY_WRITE + /* Send command to read back the data */ + chip->cmdfunc(mtd, NAND_CMD_READ0, 0, page); + + if (chip->verify_buf(mtd, buf, mtd->writesize)) + return -EIO; +#endif + return 0; +} + + +static int __devinit cafe_nand_probe(struct pci_dev *pdev, + const struct pci_device_id *ent) +{ + struct mtd_info *mtd; + struct cafe_priv *cafe; + uint32_t ctrl; + int err = 0; + + err = pci_enable_device(pdev); + if (err) + return err; + + pci_set_master(pdev); + + mtd = kzalloc(sizeof(*mtd) + sizeof(struct cafe_priv), GFP_KERNEL); + if (!mtd) { + dev_warn(&pdev->dev, "failed to alloc mtd_info\n"); + return -ENOMEM; + } + cafe = (void *)(&mtd[1]); + + mtd->priv = cafe; + mtd->owner = THIS_MODULE; + + cafe->pdev = pdev; + cafe->mmio = pci_iomap(pdev, 0, 0); + if (!cafe->mmio) { + dev_warn(&pdev->dev, "failed to iomap\n"); + err = -ENOMEM; + goto out_free_mtd; + } + cafe->dmabuf = dma_alloc_coherent(&cafe->pdev->dev, 2112 + sizeof(struct nand_buffers), + &cafe->dmaaddr, GFP_KERNEL); + if (!cafe->dmabuf) { + err = -ENOMEM; + goto out_ior; + } + cafe->nand.buffers = (void *)cafe->dmabuf + 2112; + + cafe->nand.cmdfunc = cafe_nand_cmdfunc; + cafe->nand.dev_ready = cafe_device_ready; + cafe->nand.read_byte = cafe_read_byte; + cafe->nand.read_buf = cafe_read_buf; + cafe->nand.write_buf = cafe_write_buf; + cafe->nand.select_chip = cafe_select_chip; + + cafe->nand.chip_delay = 0; + + /* Enable the following for a flash based bad block table */ + cafe->nand.options = NAND_USE_FLASH_BBT | NAND_NO_AUTOINCR | NAND_OWN_BUFFERS; + + /* Timings from Marvell's test code (not verified or calculated by us) */ + writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); +#if 1 + writel(0x01010a0a, cafe->mmio + CAFE_NAND_TIMING1); + writel(0x24121212, cafe->mmio + CAFE_NAND_TIMING2); + writel(0x11000000, cafe->mmio + CAFE_NAND_TIMING3); +#else + writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING1); + writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING2); + writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING3); +#endif + writel(0xdfffffff, cafe->mmio + 0x14); + err = request_irq(pdev->irq, &cafe_nand_interrupt, SA_SHIRQ, "CAFE NAND", mtd); + if (err) { + dev_warn(&pdev->dev, "Could not register IRQ %d\n", pdev->irq); + + goto out_free_dma; + } +#if 1 + /* Disable master reset, enable NAND clock */ + ctrl = readl(cafe->mmio + 0x3004); + ctrl &= 0xffffeff0; + ctrl |= 0x00007000; + writel(ctrl | 0x05, cafe->mmio + 0x3004); + writel(ctrl | 0x0a, cafe->mmio + 0x3004); + writel(0, cafe->mmio + 0x40); + + writel(0x7006, cafe->mmio + 0x3004); + writel(0x700a, cafe->mmio + 0x3004); + + /* Set up DMA address */ + writel(cafe->dmaaddr & 0xffffffff, cafe->mmio + 0x44); + if (sizeof(cafe->dmaaddr) > 4) + writel((cafe->dmaaddr >> 16) >> 16, cafe->mmio + 0x48); + else + writel(0, cafe->mmio + 0x48); + dev_dbg(&cafe->pdev->dev, "Set DMA address to %x (virt %p)\n", + readl(cafe->mmio+0x44), cafe->dmabuf); + + /* Enable NAND IRQ in global IRQ mask register */ + writel(0x80000007, cafe->mmio + 0x300c); + dev_dbg(&cafe->pdev->dev, "Control %x, IRQ mask %x\n", + readl(cafe->mmio + 0x3004), readl(cafe->mmio + 0x300c)); +#endif +#if 1 + mtd->writesize=2048; + mtd->oobsize = 0x40; + memset(cafe->dmabuf, 0xa5, 2112); + cafe->nand.cmdfunc(mtd, NAND_CMD_READID, 0, -1); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); +#endif +#if 0 + cafe->nand.cmdfunc(mtd, NAND_CMD_READ0, 0, 0); + // nand_wait_ready(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); +#endif +#if 0 + writel(0x84600070, cafe->mmio); + udelay(10); + dev_dbg(&cafe->pdev->dev, "Status %x\n", readl(cafe->mmio + 0x30)); +#endif + /* Scan to find existance of the device */ + if (nand_scan_ident(mtd, 1)) { + err = -ENXIO; + goto out_irq; + } + + cafe->ctl2 = 1<<27; /* Reed-Solomon ECC */ + if (mtd->writesize == 2048) + cafe->ctl2 |= 1<<29; /* 2KiB page size */ + + /* Set up ECC according to the type of chip we found */ + if (mtd->writesize == 512 || mtd->writesize == 2048) { + cafe->nand.ecc.mode = NAND_ECC_HW_SYNDROME; + cafe->nand.ecc.size = mtd->writesize; + cafe->nand.ecc.bytes = 14; + cafe->nand.ecc.hwctl = (void *)cafe_nand_bug; + cafe->nand.ecc.calculate = (void *)cafe_nand_bug; + cafe->nand.ecc.correct = (void *)cafe_nand_bug; + cafe->nand.write_page = cafe_nand_write_page; + cafe->nand.ecc.write_page = cafe_nand_write_page_lowlevel; + cafe->nand.ecc.write_oob = cafe_nand_write_oob; + cafe->nand.ecc.read_page = cafe_nand_read_page; + cafe->nand.ecc.read_oob = cafe_nand_read_oob; + + } else { + printk(KERN_WARNING "Unexpected NAND flash writesize %d. Using software ECC\n", + mtd->writesize); + cafe->nand.ecc.mode = NAND_ECC_NONE; + } + + err = nand_scan_tail(mtd); + if (err) + goto out_irq; + + + pci_set_drvdata(pdev, mtd); + add_mtd_device(mtd); + goto out; + + out_irq: + /* Disable NAND IRQ in global IRQ mask register */ + writel(~1 & readl(cafe->mmio + 0x300c), cafe->mmio + 0x300c); + free_irq(pdev->irq, mtd); + out_free_dma: + dma_free_coherent(&cafe->pdev->dev, 2112, cafe->dmabuf, cafe->dmaaddr); + out_ior: + pci_iounmap(pdev, cafe->mmio); + out_free_mtd: + kfree(mtd); + out: + return err; +} + +static void __devexit cafe_nand_remove(struct pci_dev *pdev) +{ + struct mtd_info *mtd = pci_get_drvdata(pdev); + struct cafe_priv *cafe = mtd->priv; + + del_mtd_device(mtd); + /* Disable NAND IRQ in global IRQ mask register */ + writel(~1 & readl(cafe->mmio + 0x300c), cafe->mmio + 0x300c); + free_irq(pdev->irq, mtd); + nand_release(mtd); + pci_iounmap(pdev, cafe->mmio); + dma_free_coherent(&cafe->pdev->dev, 2112, cafe->dmabuf, cafe->dmaaddr); + kfree(mtd); +} + +static struct pci_device_id cafe_nand_tbl[] = { + { 0x11ab, 0x4100, PCI_ANY_ID, PCI_ANY_ID, PCI_CLASS_MEMORY_FLASH << 8, 0xFFFF0 } +}; + +MODULE_DEVICE_TABLE(pci, cafe_nand_tbl); + +static struct pci_driver cafe_nand_pci_driver = { + .name = "CAFÉ NAND", + .id_table = cafe_nand_tbl, + .probe = cafe_nand_probe, + .remove = __devexit_p(cafe_nand_remove), +#ifdef CONFIG_PMx + .suspend = cafe_nand_suspend, + .resume = cafe_nand_resume, +#endif +}; + +static int cafe_nand_init(void) +{ + return pci_register_driver(&cafe_nand_pci_driver); +} + +static void cafe_nand_exit(void) +{ + pci_unregister_driver(&cafe_nand_pci_driver); +} +module_init(cafe_nand_init); +module_exit(cafe_nand_exit); + +MODULE_LICENSE("GPL"); +MODULE_AUTHOR("David Woodhouse "); +MODULE_DESCRIPTION("NAND flash driver for OLPC CAFE chip"); + +/* Correct ECC for 2048 bytes of 0xff: + 41 a0 71 65 54 27 f3 93 ec a9 be ed 0b a1 */ -- cgit v1.2.3 From 8dd851de8184bb39c4ea86de20a0ed2496e6eb0d Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Fri, 20 Oct 2006 02:11:40 +0100 Subject: =?UTF-8?q?[MTD=20NAND]=20OLPC=20CAF=C3=89=20driver=20update?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit - Fix OOB handling, bad block table marker placement - Some cleanups, enable runtime-optional debugging - Allow BBT stuff to be skipped Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe_nand.c | 135 +++++++++++++++++++++++++++++++------------ 1 file changed, 99 insertions(+), 36 deletions(-) (limited to 'drivers/mtd') diff --git a/drivers/mtd/nand/cafe_nand.c b/drivers/mtd/nand/cafe_nand.c index 8d7a795a947..60cb019b140 100644 --- a/drivers/mtd/nand/cafe_nand.c +++ b/drivers/mtd/nand/cafe_nand.c @@ -5,7 +5,7 @@ * Copyright © 2006 David Woodhouse */ -//#define DEBUG +#define DEBUG #include #undef DEBUG @@ -53,15 +53,24 @@ struct cafe_priv { static int usedma = 1; module_param(usedma, int, 0644); +static int skipbbt = 0; +module_param(skipbbt, int, 0644); + +static int debug = 0; +module_param(debug, int, 0644); + +#define cafe_dev_dbg(dev, args...) do { if (debug) dev_dbg(dev, ##args); } while(0) + + static int cafe_device_ready(struct mtd_info *mtd) { struct cafe_priv *cafe = mtd->priv; int result = !!(readl(cafe->mmio + CAFE_NAND_STATUS) | 0x40000000); - uint32_t irqs = readl(cafe->mmio + 0x10); - writel(irqs, cafe->mmio+0x10); - dev_dbg(&cafe->pdev->dev, "NAND device is%s ready, IRQ %x (%x) (%x,%x)\n", - result?"":" not", irqs, readl(cafe->mmio + 0x10), + uint32_t irqs = readl(cafe->mmio + CAFE_NAND_IRQ); + writel(irqs, cafe->mmio+CAFE_NAND_IRQ); + cafe_dev_dbg(&cafe->pdev->dev, "NAND device is%s ready, IRQ %x (%x) (%x,%x)\n", + result?"":" not", irqs, readl(cafe->mmio + CAFE_NAND_IRQ), readl(cafe->mmio + 0x3008), readl(cafe->mmio + 0x300c)); return result; } @@ -77,7 +86,7 @@ static void cafe_write_buf(struct mtd_info *mtd, const uint8_t *buf, int len) memcpy_toio(cafe->mmio + CAFE_NAND_WRITE_DATA + cafe->datalen, buf, len); cafe->datalen += len; - dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes to write buffer. datalen 0x%x\n", + cafe_dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes to write buffer. datalen 0x%x\n", len, cafe->datalen); } @@ -90,7 +99,7 @@ static void cafe_read_buf(struct mtd_info *mtd, uint8_t *buf, int len) else memcpy_fromio(buf, cafe->mmio + CAFE_NAND_READ_DATA + cafe->datalen, len); - dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes from position 0x%x in read buffer.\n", + cafe_dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes from position 0x%x in read buffer.\n", len, cafe->datalen); cafe->datalen += len; } @@ -101,7 +110,7 @@ static uint8_t cafe_read_byte(struct mtd_info *mtd) uint8_t d; cafe_read_buf(mtd, &d, 1); - dev_dbg(&cafe->pdev->dev, "Read %02x\n", d); + cafe_dev_dbg(&cafe->pdev->dev, "Read %02x\n", d); return d; } @@ -115,14 +124,14 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, uint32_t doneint = 0x80000000; int i; - dev_dbg(&cafe->pdev->dev, "cmdfunc %02x, 0x%x, 0x%x\n", + cafe_dev_dbg(&cafe->pdev->dev, "cmdfunc %02x, 0x%x, 0x%x\n", command, column, page_addr); if (command == NAND_CMD_ERASE2 || command == NAND_CMD_PAGEPROG) { /* Second half of a command we already calculated */ writel(cafe->ctl2 | 0x100 | command, cafe->mmio + 0x04); ctl1 = cafe->ctl1; - dev_dbg(&cafe->pdev->dev, "Continue command, ctl1 %08x, #data %d\n", + cafe_dev_dbg(&cafe->pdev->dev, "Continue command, ctl1 %08x, #data %d\n", cafe->ctl1, cafe->nr_data); goto do_command; } @@ -163,7 +172,7 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, if (command == NAND_CMD_READID || command == NAND_CMD_STATUS) { ctl1 |= (1<<26); /* rd */ /* Always 5 bytes, for now */ - cafe->datalen = 5; + cafe->datalen = 4; /* And one address cycle -- even for STATUS, since the controller doesn't work without */ adrbytes = 1; } else if (command == NAND_CMD_READ0 || command == NAND_CMD_READ1 || @@ -183,7 +192,7 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, deals with them both at once, later */ cafe->ctl1 = ctl1; cafe->ctl2 = 0; - dev_dbg(&cafe->pdev->dev, "Setup for delayed command, ctl1 %08x, dlen %x\n", + cafe_dev_dbg(&cafe->pdev->dev, "Setup for delayed command, ctl1 %08x, dlen %x\n", cafe->ctl1, cafe->datalen); return; } @@ -194,13 +203,14 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, writel(cafe->ctl2 | 0x100 | NAND_CMD_READSTART, cafe->mmio + CAFE_NAND_CTRL2); do_command: - if (cafe->datalen == 2112) - cafe->datalen = 2062; - dev_dbg(&cafe->pdev->dev, "dlen %x, ctl1 %x, ctl2 %x\n", + // ECC on read only works if we ... + // if (cafe->datalen == 2112) + // cafe->datalen = 2062; + cafe_dev_dbg(&cafe->pdev->dev, "dlen %x, ctl1 %x, ctl2 %x\n", cafe->datalen, ctl1, readl(cafe->mmio+CAFE_NAND_CTRL2)); /* NB: The datasheet lies -- we really should be subtracting 1 here */ writel(cafe->datalen, cafe->mmio + CAFE_NAND_DATA_LEN); - writel(0x90000000, cafe->mmio + 0x10); + writel(0x90000000, cafe->mmio + CAFE_NAND_IRQ); if (usedma && (ctl1 & (3<<25))) { uint32_t dmactl = 0xc0000000 + cafe->datalen; /* If WR or RD bits set, set up DMA */ @@ -230,20 +240,20 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, ndelay(100); if (1) { - int c = 50000; + int c = 500000; uint32_t irqs; while (c--) { - irqs = readl(cafe->mmio + 0x10); + irqs = readl(cafe->mmio + CAFE_NAND_IRQ); if (irqs & doneint) break; udelay(1); - if (!(c & 1000)) - dev_dbg(&cafe->pdev->dev, "Wait for ready, IRQ %x\n", irqs); + if (!(c % 100000)) + cafe_dev_dbg(&cafe->pdev->dev, "Wait for ready, IRQ %x\n", irqs); cpu_relax(); } - writel(doneint, cafe->mmio + 0x10); - dev_dbg(&cafe->pdev->dev, "Command %x completed after %d usec, irqs %x (%x)\n", command, 50000-c, irqs, readl(cafe->mmio + 0x10)); + writel(doneint, cafe->mmio + CAFE_NAND_IRQ); + cafe_dev_dbg(&cafe->pdev->dev, "Command %x completed after %d usec, irqs %x (%x)\n", command, 50000-c, irqs, readl(cafe->mmio + CAFE_NAND_IRQ)); } @@ -276,18 +286,18 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, static void cafe_select_chip(struct mtd_info *mtd, int chipnr) { //struct cafe_priv *cafe = mtd->priv; - // dev_dbg(&cafe->pdev->dev, "select_chip %d\n", chipnr); + // cafe_dev_dbg(&cafe->pdev->dev, "select_chip %d\n", chipnr); } static int cafe_nand_interrupt(int irq, void *id, struct pt_regs *regs) { struct mtd_info *mtd = id; struct cafe_priv *cafe = mtd->priv; - uint32_t irqs = readl(cafe->mmio + 0x10); - writel(irqs & ~0x90000000, cafe->mmio + 0x10); + uint32_t irqs = readl(cafe->mmio + CAFE_NAND_IRQ); + writel(irqs & ~0x90000000, cafe->mmio + CAFE_NAND_IRQ); if (!irqs) return IRQ_NONE; - dev_dbg(&cafe->pdev->dev, "irq, bits %x (%x)\n", irqs, readl(cafe->mmio + 0x10)); + cafe_dev_dbg(&cafe->pdev->dev, "irq, bits %x (%x)\n", irqs, readl(cafe->mmio + CAFE_NAND_IRQ)); return IRQ_HANDLED; } @@ -335,7 +345,7 @@ static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, WARN_ON(chip->oob_poi != chip->buffers->oobrbuf); - dev_dbg(&cafe->pdev->dev, "ECC result %08x SYN1,2 %08x\n", readl(cafe->mmio + 0x3c), readl(cafe->mmio + 0x50)); + cafe_dev_dbg(&cafe->pdev->dev, "ECC result %08x SYN1,2 %08x\n", readl(cafe->mmio + 0x3c), readl(cafe->mmio + 0x50)); chip->read_buf(mtd, buf, mtd->writesize); chip->read_buf(mtd, chip->oob_poi, mtd->oobsize); @@ -343,7 +353,44 @@ static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, return 0; } -static char foo[14]; +static struct nand_ecclayout cafe_oobinfo_2048 = { + .eccbytes = 14, + .eccpos = { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13}, + .oobfree = {{14, 50}} +}; + +/* Ick. The BBT code really ought to be able to work this bit out + for itself from the above */ +static uint8_t cafe_bbt_pattern[] = {'B', 'b', 't', '0' }; +static uint8_t cafe_mirror_pattern[] = {'1', 't', 'b', 'B' }; + +static struct nand_bbt_descr cafe_bbt_main_descr_2048 = { + .options = NAND_BBT_LASTBLOCK | NAND_BBT_CREATE | NAND_BBT_WRITE + | NAND_BBT_2BIT | NAND_BBT_VERSION | NAND_BBT_PERCHIP, + .offs = 14, + .len = 4, + .veroffs = 18, + .maxblocks = 4, + .pattern = cafe_bbt_pattern +}; + +static struct nand_bbt_descr cafe_bbt_mirror_descr_2048 = { + .options = NAND_BBT_LASTBLOCK | NAND_BBT_CREATE | NAND_BBT_WRITE + | NAND_BBT_2BIT | NAND_BBT_VERSION | NAND_BBT_PERCHIP, + .offs = 14, + .len = 4, + .veroffs = 18, + .maxblocks = 4, + .pattern = cafe_mirror_pattern +}; + +static struct nand_ecclayout cafe_oobinfo_512 = { + .eccbytes = 14, + .eccpos = { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13}, + .oobfree = {{14, 2}} +}; + + static void cafe_nand_write_page_lowlevel(struct mtd_info *mtd, struct nand_chip *chip, const uint8_t *buf) { @@ -352,8 +399,7 @@ static void cafe_nand_write_page_lowlevel(struct mtd_info *mtd, WARN_ON(chip->oob_poi != chip->buffers->oobwbuf); chip->write_buf(mtd, buf, mtd->writesize); - chip->write_buf(mtd, foo, 14); - // chip->write_buf(mtd, chip->oob_poi, mtd->oobsize); + chip->write_buf(mtd, chip->oob_poi, mtd->oobsize); /* Set up ECC autogeneration */ cafe->ctl2 |= (1<<27) | (1<<30); @@ -410,6 +456,10 @@ static int cafe_nand_write_page(struct mtd_info *mtd, struct nand_chip *chip, return 0; } +static int cafe_nand_block_bad(struct mtd_info *mtd, loff_t ofs, int getchip) +{ + return 0; +} static int __devinit cafe_nand_probe(struct pci_dev *pdev, const struct pci_device_id *ent) @@ -461,6 +511,11 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, /* Enable the following for a flash based bad block table */ cafe->nand.options = NAND_USE_FLASH_BBT | NAND_NO_AUTOINCR | NAND_OWN_BUFFERS; + + if (skipbbt) { + cafe->nand.options |= NAND_SKIP_BBTSCAN; + cafe->nand.block_bad = cafe_nand_block_bad; + } /* Timings from Marvell's test code (not verified or calculated by us) */ writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); @@ -473,7 +528,7 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING2); writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING3); #endif - writel(0xdfffffff, cafe->mmio + 0x14); + writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); err = request_irq(pdev->irq, &cafe_nand_interrupt, SA_SHIRQ, "CAFE NAND", mtd); if (err) { dev_warn(&pdev->dev, "Could not register IRQ %d\n", pdev->irq); @@ -498,18 +553,18 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, writel((cafe->dmaaddr >> 16) >> 16, cafe->mmio + 0x48); else writel(0, cafe->mmio + 0x48); - dev_dbg(&cafe->pdev->dev, "Set DMA address to %x (virt %p)\n", + cafe_dev_dbg(&cafe->pdev->dev, "Set DMA address to %x (virt %p)\n", readl(cafe->mmio+0x44), cafe->dmabuf); /* Enable NAND IRQ in global IRQ mask register */ writel(0x80000007, cafe->mmio + 0x300c); - dev_dbg(&cafe->pdev->dev, "Control %x, IRQ mask %x\n", + cafe_dev_dbg(&cafe->pdev->dev, "Control %x, IRQ mask %x\n", readl(cafe->mmio + 0x3004), readl(cafe->mmio + 0x300c)); #endif #if 1 mtd->writesize=2048; mtd->oobsize = 0x40; - memset(cafe->dmabuf, 0xa5, 2112); + memset(cafe->dmabuf, 0x5a, 2112); cafe->nand.cmdfunc(mtd, NAND_CMD_READID, 0, -1); cafe->nand.read_byte(mtd); cafe->nand.read_byte(mtd); @@ -528,7 +583,7 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, #if 0 writel(0x84600070, cafe->mmio); udelay(10); - dev_dbg(&cafe->pdev->dev, "Status %x\n", readl(cafe->mmio + 0x30)); + cafe_dev_dbg(&cafe->pdev->dev, "Status %x\n", readl(cafe->mmio + 0x30)); #endif /* Scan to find existance of the device */ if (nand_scan_ident(mtd, 1)) { @@ -545,6 +600,9 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, cafe->nand.ecc.mode = NAND_ECC_HW_SYNDROME; cafe->nand.ecc.size = mtd->writesize; cafe->nand.ecc.bytes = 14; + cafe->nand.ecc.layout = &cafe_oobinfo_2048; + cafe->nand.bbt_td = &cafe_bbt_main_descr_2048; + cafe->nand.bbt_md = &cafe_bbt_mirror_descr_2048; cafe->nand.ecc.hwctl = (void *)cafe_nand_bug; cafe->nand.ecc.calculate = (void *)cafe_nand_bug; cafe->nand.ecc.correct = (void *)cafe_nand_bug; @@ -564,7 +622,6 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, if (err) goto out_irq; - pci_set_drvdata(pdev, mtd); add_mtd_device(mtd); goto out; @@ -633,3 +690,9 @@ MODULE_DESCRIPTION("NAND flash driver for OLPC CAFE chip"); /* Correct ECC for 2048 bytes of 0xff: 41 a0 71 65 54 27 f3 93 ec a9 be ed 0b a1 */ + +/* dwmw2's B-test board, in case of completely screwing it: +Bad eraseblock 2394 at 0x12b40000 +Bad eraseblock 2627 at 0x14860000 +Bad eraseblock 3349 at 0x1a2a0000 +*/ -- cgit v1.2.3 From 04459d7c6239193fa8de4a5107ee8fdb0f366e35 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Sun, 22 Oct 2006 02:18:48 +0100 Subject: =?UTF-8?q?[MTD]=20NAND:=20Add=20hardware=20ECC=20correction=20sup?= =?UTF-8?q?port=20to=20CAF=C3=89=20NAND=20driver?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe.c | 722 ++++++++++++++++++++++ drivers/mtd/nand/cafe_ecc.c | 1348 ++++++++++++++++++++++++++++++++++++++++++ drivers/mtd/nand/cafe_nand.c | 698 ---------------------- 3 files changed, 2070 insertions(+), 698 deletions(-) create mode 100644 drivers/mtd/nand/cafe.c create mode 100644 drivers/mtd/nand/cafe_ecc.c delete mode 100644 drivers/mtd/nand/cafe_nand.c (limited to 'drivers/mtd') diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c new file mode 100644 index 00000000000..1fe110836cc --- /dev/null +++ b/drivers/mtd/nand/cafe.c @@ -0,0 +1,722 @@ +/* + * cafe_nand.c + * + * Copyright © 2006 Red Hat, Inc. + * Copyright © 2006 David Woodhouse + */ + +#define DEBUG + +#include +#undef DEBUG +#include +#include +#include +#include +#include +#include + +#define CAFE_NAND_CTRL1 0x00 +#define CAFE_NAND_CTRL2 0x04 +#define CAFE_NAND_CTRL3 0x08 +#define CAFE_NAND_STATUS 0x0c +#define CAFE_NAND_IRQ 0x10 +#define CAFE_NAND_IRQ_MASK 0x14 +#define CAFE_NAND_DATA_LEN 0x18 +#define CAFE_NAND_ADDR1 0x1c +#define CAFE_NAND_ADDR2 0x20 +#define CAFE_NAND_TIMING1 0x24 +#define CAFE_NAND_TIMING2 0x28 +#define CAFE_NAND_TIMING3 0x2c +#define CAFE_NAND_NONMEM 0x30 +#define CAFE_NAND_ECC_RESULT 0x3C +#define CAFE_NAND_ECC_SYN01 0x50 +#define CAFE_NAND_ECC_SYN23 0x54 +#define CAFE_NAND_ECC_SYN45 0x58 +#define CAFE_NAND_ECC_SYN67 0x5c +#define CAFE_NAND_DMA_CTRL 0x40 +#define CAFE_NAND_DMA_ADDR0 0x44 +#define CAFE_NAND_DMA_ADDR1 0x48 +#define CAFE_NAND_READ_DATA 0x1000 +#define CAFE_NAND_WRITE_DATA 0x2000 + +int cafe_correct_ecc(unsigned char *buf, + unsigned short *chk_syndrome_list); + +struct cafe_priv { + struct nand_chip nand; + struct pci_dev *pdev; + void __iomem *mmio; + uint32_t ctl1; + uint32_t ctl2; + int datalen; + int nr_data; + int data_pos; + int page_addr; + dma_addr_t dmaaddr; + unsigned char *dmabuf; + +}; + +static int usedma = 0; +module_param(usedma, int, 0644); + +static int skipbbt = 0; +module_param(skipbbt, int, 0644); + +static int debug = 0; +module_param(debug, int, 0644); + +/* Hrm. Why isn't this already conditional on something in the struct device? */ +#define cafe_dev_dbg(dev, args...) do { if (debug) dev_dbg(dev, ##args); } while(0) + + +static int cafe_device_ready(struct mtd_info *mtd) +{ + struct cafe_priv *cafe = mtd->priv; + int result = !!(readl(cafe->mmio + CAFE_NAND_STATUS) | 0x40000000); + + uint32_t irqs = readl(cafe->mmio + CAFE_NAND_IRQ); + writel(irqs, cafe->mmio+CAFE_NAND_IRQ); + cafe_dev_dbg(&cafe->pdev->dev, "NAND device is%s ready, IRQ %x (%x) (%x,%x)\n", + result?"":" not", irqs, readl(cafe->mmio + CAFE_NAND_IRQ), + readl(cafe->mmio + 0x3008), readl(cafe->mmio + 0x300c)); + return result; +} + + +static void cafe_write_buf(struct mtd_info *mtd, const uint8_t *buf, int len) +{ + struct cafe_priv *cafe = mtd->priv; + + if (usedma) + memcpy(cafe->dmabuf + cafe->datalen, buf, len); + else + memcpy_toio(cafe->mmio + CAFE_NAND_WRITE_DATA + cafe->datalen, buf, len); + cafe->datalen += len; + + cafe_dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes to write buffer. datalen 0x%x\n", + len, cafe->datalen); +} + +static void cafe_read_buf(struct mtd_info *mtd, uint8_t *buf, int len) +{ + struct cafe_priv *cafe = mtd->priv; + + if (usedma) + memcpy(buf, cafe->dmabuf + cafe->datalen, len); + else + memcpy_fromio(buf, cafe->mmio + CAFE_NAND_READ_DATA + cafe->datalen, len); + + cafe_dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes from position 0x%x in read buffer.\n", + len, cafe->datalen); + cafe->datalen += len; +} + +static uint8_t cafe_read_byte(struct mtd_info *mtd) +{ + struct cafe_priv *cafe = mtd->priv; + uint8_t d; + + cafe_read_buf(mtd, &d, 1); + cafe_dev_dbg(&cafe->pdev->dev, "Read %02x\n", d); + + return d; +} + +static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, + int column, int page_addr) +{ + struct cafe_priv *cafe = mtd->priv; + int adrbytes = 0; + uint32_t ctl1; + uint32_t doneint = 0x80000000; + int i; + + cafe_dev_dbg(&cafe->pdev->dev, "cmdfunc %02x, 0x%x, 0x%x\n", + command, column, page_addr); + + if (command == NAND_CMD_ERASE2 || command == NAND_CMD_PAGEPROG) { + /* Second half of a command we already calculated */ + writel(cafe->ctl2 | 0x100 | command, cafe->mmio + 0x04); + ctl1 = cafe->ctl1; + cafe_dev_dbg(&cafe->pdev->dev, "Continue command, ctl1 %08x, #data %d\n", + cafe->ctl1, cafe->nr_data); + goto do_command; + } + /* Reset ECC engine */ + writel(0, cafe->mmio + CAFE_NAND_CTRL2); + + /* Emulate NAND_CMD_READOOB on large-page chips */ + if (mtd->writesize > 512 && + command == NAND_CMD_READOOB) { + column += mtd->writesize; + command = NAND_CMD_READ0; + } + + /* FIXME: Do we need to send read command before sending data + for small-page chips, to position the buffer correctly? */ + + if (column != -1) { + writel(column, cafe->mmio + 0x1c); + adrbytes = 2; + if (page_addr != -1) + goto write_adr2; + } else if (page_addr != -1) { + writel(page_addr & 0xffff, cafe->mmio + 0x1c); + page_addr >>= 16; + write_adr2: + writel(page_addr, cafe->mmio+0x20); + adrbytes += 2; + if (mtd->size > mtd->writesize << 16) + adrbytes++; + } + + cafe->data_pos = cafe->datalen = 0; + + /* Set command valid bit */ + ctl1 = 0x80000000 | command; + + /* Set RD or WR bits as appropriate */ + if (command == NAND_CMD_READID || command == NAND_CMD_STATUS) { + ctl1 |= (1<<26); /* rd */ + /* Always 5 bytes, for now */ + cafe->datalen = 4; + /* And one address cycle -- even for STATUS, since the controller doesn't work without */ + adrbytes = 1; + } else if (command == NAND_CMD_READ0 || command == NAND_CMD_READ1 || + command == NAND_CMD_READOOB || command == NAND_CMD_RNDOUT) { + ctl1 |= 1<<26; /* rd */ + /* For now, assume just read to end of page */ + cafe->datalen = mtd->writesize + mtd->oobsize - column; + } else if (command == NAND_CMD_SEQIN) + ctl1 |= 1<<25; /* wr */ + + /* Set number of address bytes */ + if (adrbytes) + ctl1 |= ((adrbytes-1)|8) << 27; + + if (command == NAND_CMD_SEQIN || command == NAND_CMD_ERASE1) { + /* Ignore the first command of a pair; the hardware + deals with them both at once, later */ + cafe->ctl1 = ctl1; + cafe->ctl2 = 0; + cafe_dev_dbg(&cafe->pdev->dev, "Setup for delayed command, ctl1 %08x, dlen %x\n", + cafe->ctl1, cafe->datalen); + return; + } + /* RNDOUT and READ0 commands need a following byte */ + if (command == NAND_CMD_RNDOUT) + writel(cafe->ctl2 | 0x100 | NAND_CMD_RNDOUTSTART, cafe->mmio + CAFE_NAND_CTRL2); + else if (command == NAND_CMD_READ0 && mtd->writesize > 512) + writel(cafe->ctl2 | 0x100 | NAND_CMD_READSTART, cafe->mmio + CAFE_NAND_CTRL2); + + do_command: +#if 0 + // ECC on read only works if we ... + if (cafe->datalen == 2112) + cafe->datalen = 2062; +#endif + cafe_dev_dbg(&cafe->pdev->dev, "dlen %x, ctl1 %x, ctl2 %x\n", + cafe->datalen, ctl1, readl(cafe->mmio+CAFE_NAND_CTRL2)); + /* NB: The datasheet lies -- we really should be subtracting 1 here */ + writel(cafe->datalen, cafe->mmio + CAFE_NAND_DATA_LEN); + writel(0x90000000, cafe->mmio + CAFE_NAND_IRQ); + if (usedma && (ctl1 & (3<<25))) { + uint32_t dmactl = 0xc0000000 + cafe->datalen; + /* If WR or RD bits set, set up DMA */ + if (ctl1 & (1<<26)) { + /* It's a read */ + dmactl |= (1<<29); + /* ... so it's done when the DMA is done, not just + the command. */ + doneint = 0x10000000; + } + writel(dmactl, cafe->mmio + 0x40); + } +#if 0 + printk("DMA setup is %x, status %x, ctl1 %x\n", readl(cafe->mmio + 0x40), readl(cafe->mmio + 0x0c), readl(cafe->mmio)); + printk("DMA setup is %x, status %x, ctl1 %x\n", readl(cafe->mmio + 0x40), readl(cafe->mmio + 0x0c), readl(cafe->mmio)); +#endif + cafe->datalen = 0; + +#if 0 + printk("About to write command %08x\n", ctl1); + for (i=0; i< 0x5c; i+=4) + printk("Register %x: %08x\n", i, readl(cafe->mmio + i)); +#endif + writel(ctl1, cafe->mmio + CAFE_NAND_CTRL1); + /* Apply this short delay always to ensure that we do wait tWB in + * any case on any machine. */ + ndelay(100); + + if (1) { + int c = 500000; + uint32_t irqs; + + while (c--) { + irqs = readl(cafe->mmio + CAFE_NAND_IRQ); + if (irqs & doneint) + break; + udelay(1); + if (!(c % 100000)) + cafe_dev_dbg(&cafe->pdev->dev, "Wait for ready, IRQ %x\n", irqs); + cpu_relax(); + } + writel(doneint, cafe->mmio + CAFE_NAND_IRQ); + cafe_dev_dbg(&cafe->pdev->dev, "Command %x completed after %d usec, irqs %x (%x)\n", command, 50000-c, irqs, readl(cafe->mmio + CAFE_NAND_IRQ)); + } + + + cafe->ctl2 &= ~(1<<8); + cafe->ctl2 &= ~(1<<30); + + switch (command) { + + case NAND_CMD_CACHEDPROG: + case NAND_CMD_PAGEPROG: + case NAND_CMD_ERASE1: + case NAND_CMD_ERASE2: + case NAND_CMD_SEQIN: + case NAND_CMD_RNDIN: + case NAND_CMD_STATUS: + case NAND_CMD_DEPLETE1: + case NAND_CMD_RNDOUT: + case NAND_CMD_STATUS_ERROR: + case NAND_CMD_STATUS_ERROR0: + case NAND_CMD_STATUS_ERROR1: + case NAND_CMD_STATUS_ERROR2: + case NAND_CMD_STATUS_ERROR3: + writel(cafe->ctl2, cafe->mmio + CAFE_NAND_CTRL2); + return; + } + nand_wait_ready(mtd); + writel(cafe->ctl2, cafe->mmio + CAFE_NAND_CTRL2); +} + +static void cafe_select_chip(struct mtd_info *mtd, int chipnr) +{ + //struct cafe_priv *cafe = mtd->priv; + // cafe_dev_dbg(&cafe->pdev->dev, "select_chip %d\n", chipnr); +} +static int cafe_nand_interrupt(int irq, void *id, struct pt_regs *regs) +{ + struct mtd_info *mtd = id; + struct cafe_priv *cafe = mtd->priv; + uint32_t irqs = readl(cafe->mmio + CAFE_NAND_IRQ); + writel(irqs & ~0x90000000, cafe->mmio + CAFE_NAND_IRQ); + if (!irqs) + return IRQ_NONE; + + cafe_dev_dbg(&cafe->pdev->dev, "irq, bits %x (%x)\n", irqs, readl(cafe->mmio + CAFE_NAND_IRQ)); + return IRQ_HANDLED; +} + +static void cafe_nand_bug(struct mtd_info *mtd) +{ + BUG(); +} + +static int cafe_nand_write_oob(struct mtd_info *mtd, + struct nand_chip *chip, int page) +{ + int status = 0; + + chip->cmdfunc(mtd, NAND_CMD_SEQIN, mtd->writesize, page); + chip->write_buf(mtd, chip->oob_poi, mtd->oobsize); + chip->cmdfunc(mtd, NAND_CMD_PAGEPROG, -1, -1); + status = chip->waitfunc(mtd, chip); + + return status & NAND_STATUS_FAIL ? -EIO : 0; +} + +/* Don't use -- use nand_read_oob_std for now */ +static int cafe_nand_read_oob(struct mtd_info *mtd, struct nand_chip *chip, + int page, int sndcmd) +{ + chip->cmdfunc(mtd, NAND_CMD_READOOB, 0, page); + chip->read_buf(mtd, chip->oob_poi, mtd->oobsize); + return 1; +} +/** + * cafe_nand_read_page_syndrome - {REPLACABLE] hardware ecc syndrom based page read + * @mtd: mtd info structure + * @chip: nand chip info structure + * @buf: buffer to store read data + * + * The hw generator calculates the error syndrome automatically. Therefor + * we need a special oob layout and handling. + */ +static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, + uint8_t *buf) +{ + struct cafe_priv *cafe = mtd->priv; + + dev_dbg(&cafe->pdev->dev, "ECC result %08x SYN1,2 %08x\n", + readl(cafe->mmio + CAFE_NAND_ECC_RESULT), + readl(cafe->mmio + CAFE_NAND_ECC_SYN01)); + + chip->read_buf(mtd, buf, mtd->writesize); + chip->read_buf(mtd, chip->oob_poi, mtd->oobsize); + + if (readl(cafe->mmio + CAFE_NAND_ECC_RESULT) & (1<<18)) { + unsigned short syn[8]; + int i; + + for (i=0; i<8; i+=2) { + uint32_t tmp = readl(cafe->mmio + CAFE_NAND_ECC_SYN01 + (i*2)); + syn[i] = tmp & 0xfff; + syn[i+1] = (tmp >> 16) & 0xfff; + } + + if ((i = cafe_correct_ecc(buf, syn)) < 0) { + dev_dbg(&cafe->pdev->dev, "Failed to correct ECC\n"); + mtd->ecc_stats.failed++; + } else { + dev_dbg(&cafe->pdev->dev, "Corrected %d symbol errors\n", i); + mtd->ecc_stats.corrected += i; + } + } + + + return 0; +} + +static struct nand_ecclayout cafe_oobinfo_2048 = { + .eccbytes = 14, + .eccpos = { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13}, + .oobfree = {{14, 50}} +}; + +/* Ick. The BBT code really ought to be able to work this bit out + for itself from the above */ +static uint8_t cafe_bbt_pattern[] = {'B', 'b', 't', '0' }; +static uint8_t cafe_mirror_pattern[] = {'1', 't', 'b', 'B' }; + +static struct nand_bbt_descr cafe_bbt_main_descr_2048 = { + .options = NAND_BBT_LASTBLOCK | NAND_BBT_CREATE | NAND_BBT_WRITE + | NAND_BBT_2BIT | NAND_BBT_VERSION | NAND_BBT_PERCHIP, + .offs = 14, + .len = 4, + .veroffs = 18, + .maxblocks = 4, + .pattern = cafe_bbt_pattern +}; + +static struct nand_bbt_descr cafe_bbt_mirror_descr_2048 = { + .options = NAND_BBT_LASTBLOCK | NAND_BBT_CREATE | NAND_BBT_WRITE + | NAND_BBT_2BIT | NAND_BBT_VERSION | NAND_BBT_PERCHIP, + .offs = 14, + .len = 4, + .veroffs = 18, + .maxblocks = 4, + .pattern = cafe_mirror_pattern +}; + +static struct nand_ecclayout cafe_oobinfo_512 = { + .eccbytes = 14, + .eccpos = { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13}, + .oobfree = {{14, 2}} +}; + +static void cafe_nand_write_page_lowlevel(struct mtd_info *mtd, + struct nand_chip *chip, const uint8_t *buf) +{ + struct cafe_priv *cafe = mtd->priv; + + chip->write_buf(mtd, buf, mtd->writesize); + chip->write_buf(mtd, chip->oob_poi, mtd->oobsize); + + /* Set up ECC autogeneration */ + cafe->ctl2 |= (1<<27) | (1<<30); + if (mtd->writesize == 2048) + cafe->ctl2 |= (1<<29); +} + +static int cafe_nand_write_page(struct mtd_info *mtd, struct nand_chip *chip, + const uint8_t *buf, int page, int cached, int raw) +{ + int status; + + chip->cmdfunc(mtd, NAND_CMD_SEQIN, 0x00, page); + + if (unlikely(raw)) + chip->ecc.write_page_raw(mtd, chip, buf); + else + chip->ecc.write_page(mtd, chip, buf); + + /* + * Cached progamming disabled for now, Not sure if its worth the + * trouble. The speed gain is not very impressive. (2.3->2.6Mib/s) + */ + cached = 0; + + if (!cached || !(chip->options & NAND_CACHEPRG)) { + + chip->cmdfunc(mtd, NAND_CMD_PAGEPROG, -1, -1); + status = chip->waitfunc(mtd, chip); + /* + * See if operation failed and additional status checks are + * available + */ + if ((status & NAND_STATUS_FAIL) && (chip->errstat)) + status = chip->errstat(mtd, chip, FL_WRITING, status, + page); + + if (status & NAND_STATUS_FAIL) + return -EIO; + } else { + chip->cmdfunc(mtd, NAND_CMD_CACHEDPROG, -1, -1); + status = chip->waitfunc(mtd, chip); + } + +#ifdef CONFIG_MTD_NAND_VERIFY_WRITE + /* Send command to read back the data */ + chip->cmdfunc(mtd, NAND_CMD_READ0, 0, page); + + if (chip->verify_buf(mtd, buf, mtd->writesize)) + return -EIO; +#endif + return 0; +} + +static int cafe_nand_block_bad(struct mtd_info *mtd, loff_t ofs, int getchip) +{ + return 0; +} + +static int __devinit cafe_nand_probe(struct pci_dev *pdev, + const struct pci_device_id *ent) +{ + struct mtd_info *mtd; + struct cafe_priv *cafe; + uint32_t ctrl; + int err = 0; + + err = pci_enable_device(pdev); + if (err) + return err; + + pci_set_master(pdev); + + mtd = kzalloc(sizeof(*mtd) + sizeof(struct cafe_priv), GFP_KERNEL); + if (!mtd) { + dev_warn(&pdev->dev, "failed to alloc mtd_info\n"); + return -ENOMEM; + } + cafe = (void *)(&mtd[1]); + + mtd->priv = cafe; + mtd->owner = THIS_MODULE; + + cafe->pdev = pdev; + cafe->mmio = pci_iomap(pdev, 0, 0); + if (!cafe->mmio) { + dev_warn(&pdev->dev, "failed to iomap\n"); + err = -ENOMEM; + goto out_free_mtd; + } + cafe->dmabuf = dma_alloc_coherent(&cafe->pdev->dev, 2112 + sizeof(struct nand_buffers), + &cafe->dmaaddr, GFP_KERNEL); + if (!cafe->dmabuf) { + err = -ENOMEM; + goto out_ior; + } + cafe->nand.buffers = (void *)cafe->dmabuf + 2112; + + cafe->nand.cmdfunc = cafe_nand_cmdfunc; + cafe->nand.dev_ready = cafe_device_ready; + cafe->nand.read_byte = cafe_read_byte; + cafe->nand.read_buf = cafe_read_buf; + cafe->nand.write_buf = cafe_write_buf; + cafe->nand.select_chip = cafe_select_chip; + + cafe->nand.chip_delay = 0; + + /* Enable the following for a flash based bad block table */ + cafe->nand.options = NAND_USE_FLASH_BBT | NAND_NO_AUTOINCR | NAND_OWN_BUFFERS; + + if (skipbbt) { + cafe->nand.options |= NAND_SKIP_BBTSCAN; + cafe->nand.block_bad = cafe_nand_block_bad; + } + + /* Timings from Marvell's test code (not verified or calculated by us) */ + writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); +#if 1 + writel(0x01010a0a, cafe->mmio + CAFE_NAND_TIMING1); + writel(0x24121212, cafe->mmio + CAFE_NAND_TIMING2); + writel(0x11000000, cafe->mmio + CAFE_NAND_TIMING3); +#else + writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING1); + writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING2); + writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING3); +#endif + writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); + err = request_irq(pdev->irq, &cafe_nand_interrupt, SA_SHIRQ, "CAFE NAND", mtd); + if (err) { + dev_warn(&pdev->dev, "Could not register IRQ %d\n", pdev->irq); + + goto out_free_dma; + } +#if 1 + /* Disable master reset, enable NAND clock */ + ctrl = readl(cafe->mmio + 0x3004); + ctrl &= 0xffffeff0; + ctrl |= 0x00007000; + writel(ctrl | 0x05, cafe->mmio + 0x3004); + writel(ctrl | 0x0a, cafe->mmio + 0x3004); + writel(0, cafe->mmio + 0x40); + + writel(0x7006, cafe->mmio + 0x3004); + writel(0x700a, cafe->mmio + 0x3004); + + /* Set up DMA address */ + writel(cafe->dmaaddr & 0xffffffff, cafe->mmio + 0x44); + if (sizeof(cafe->dmaaddr) > 4) + writel((cafe->dmaaddr >> 16) >> 16, cafe->mmio + 0x48); + else + writel(0, cafe->mmio + 0x48); + cafe_dev_dbg(&cafe->pdev->dev, "Set DMA address to %x (virt %p)\n", + readl(cafe->mmio+0x44), cafe->dmabuf); + + /* Enable NAND IRQ in global IRQ mask register */ + writel(0x80000007, cafe->mmio + 0x300c); + cafe_dev_dbg(&cafe->pdev->dev, "Control %x, IRQ mask %x\n", + readl(cafe->mmio + 0x3004), readl(cafe->mmio + 0x300c)); +#endif +#if 1 + mtd->writesize=2048; + mtd->oobsize = 0x40; + memset(cafe->dmabuf, 0x5a, 2112); + cafe->nand.cmdfunc(mtd, NAND_CMD_READID, 0, -1); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); +#endif +#if 0 + cafe->nand.cmdfunc(mtd, NAND_CMD_READ0, 0, 0); + // nand_wait_ready(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); +#endif +#if 0 + writel(0x84600070, cafe->mmio); + udelay(10); + cafe_dev_dbg(&cafe->pdev->dev, "Status %x\n", readl(cafe->mmio + 0x30)); +#endif + /* Scan to find existance of the device */ + if (nand_scan_ident(mtd, 1)) { + err = -ENXIO; + goto out_irq; + } + + cafe->ctl2 = 1<<27; /* Reed-Solomon ECC */ + if (mtd->writesize == 2048) + cafe->ctl2 |= 1<<29; /* 2KiB page size */ + + /* Set up ECC according to the type of chip we found */ + if (mtd->writesize == 512 || mtd->writesize == 2048) { + cafe->nand.ecc.mode = NAND_ECC_HW_SYNDROME; + cafe->nand.ecc.size = mtd->writesize; + cafe->nand.ecc.bytes = 14; + cafe->nand.ecc.layout = &cafe_oobinfo_2048; + cafe->nand.bbt_td = &cafe_bbt_main_descr_2048; + cafe->nand.bbt_md = &cafe_bbt_mirror_descr_2048; + cafe->nand.ecc.hwctl = (void *)cafe_nand_bug; + cafe->nand.ecc.calculate = (void *)cafe_nand_bug; + cafe->nand.ecc.correct = (void *)cafe_nand_bug; + cafe->nand.write_page = cafe_nand_write_page; + cafe->nand.ecc.write_page = cafe_nand_write_page_lowlevel; + cafe->nand.ecc.write_oob = cafe_nand_write_oob; + cafe->nand.ecc.read_page = cafe_nand_read_page; + cafe->nand.ecc.read_oob = cafe_nand_read_oob; + + } else { + printk(KERN_WARNING "Unexpected NAND flash writesize %d. Using software ECC\n", + mtd->writesize); + cafe->nand.ecc.mode = NAND_ECC_NONE; + } + + err = nand_scan_tail(mtd); + if (err) + goto out_irq; + + pci_set_drvdata(pdev, mtd); + add_mtd_device(mtd); + goto out; + + out_irq: + /* Disable NAND IRQ in global IRQ mask register */ + writel(~1 & readl(cafe->mmio + 0x300c), cafe->mmio + 0x300c); + free_irq(pdev->irq, mtd); + out_free_dma: + dma_free_coherent(&cafe->pdev->dev, 2112, cafe->dmabuf, cafe->dmaaddr); + out_ior: + pci_iounmap(pdev, cafe->mmio); + out_free_mtd: + kfree(mtd); + out: + return err; +} + +static void __devexit cafe_nand_remove(struct pci_dev *pdev) +{ + struct mtd_info *mtd = pci_get_drvdata(pdev); + struct cafe_priv *cafe = mtd->priv; + + del_mtd_device(mtd); + /* Disable NAND IRQ in global IRQ mask register */ + writel(~1 & readl(cafe->mmio + 0x300c), cafe->mmio + 0x300c); + free_irq(pdev->irq, mtd); + nand_release(mtd); + pci_iounmap(pdev, cafe->mmio); + dma_free_coherent(&cafe->pdev->dev, 2112, cafe->dmabuf, cafe->dmaaddr); + kfree(mtd); +} + +static struct pci_device_id cafe_nand_tbl[] = { + { 0x11ab, 0x4100, PCI_ANY_ID, PCI_ANY_ID, PCI_CLASS_MEMORY_FLASH << 8, 0xFFFF0 } +}; + +MODULE_DEVICE_TABLE(pci, cafe_nand_tbl); + +static struct pci_driver cafe_nand_pci_driver = { + .name = "CAFÉ NAND", + .id_table = cafe_nand_tbl, + .probe = cafe_nand_probe, + .remove = __devexit_p(cafe_nand_remove), +#ifdef CONFIG_PMx + .suspend = cafe_nand_suspend, + .resume = cafe_nand_resume, +#endif +}; + +static int cafe_nand_init(void) +{ + return pci_register_driver(&cafe_nand_pci_driver); +} + +static void cafe_nand_exit(void) +{ + pci_unregister_driver(&cafe_nand_pci_driver); +} +module_init(cafe_nand_init); +module_exit(cafe_nand_exit); + +MODULE_LICENSE("GPL"); +MODULE_AUTHOR("David Woodhouse "); +MODULE_DESCRIPTION("NAND flash driver for OLPC CAFE chip"); + +/* Correct ECC for 2048 bytes of 0xff: + 41 a0 71 65 54 27 f3 93 ec a9 be ed 0b a1 */ + +/* dwmw2's B-test board, in case of completely screwing it: +Bad eraseblock 2394 at 0x12b40000 +Bad eraseblock 2627 at 0x14860000 +Bad eraseblock 3349 at 0x1a2a0000 +*/ diff --git a/drivers/mtd/nand/cafe_ecc.c b/drivers/mtd/nand/cafe_ecc.c new file mode 100644 index 00000000000..4df28a846fb --- /dev/null +++ b/drivers/mtd/nand/cafe_ecc.c @@ -0,0 +1,1348 @@ +/* Error correction for CAFÉ NAND controller + * + * © 2006 Marvell, Inc. + * Author: Tom Chiou + * + * This program is free software; you can redistribute it and/or modify it + * under the terms of the GNU General Public License as published by the Free + * Software Foundation; either version 2 of the License, or (at your option) + * any later version. + * + * This program is distributed in the hope that it will be useful, but WITHOUT + * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for + * more details. + * + * You should have received a copy of the GNU General Public License along with + * this program; if not, write to the Free Software Foundation, Inc., 59 + * Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +#include +#include + +static unsigned short gf4096_mul(unsigned short, unsigned short); +static unsigned short gf64_mul(unsigned short, unsigned short); +static unsigned short gf4096_inv(unsigned short); +static unsigned short err_pos(unsigned short); +static void find_4bit_err_coefs(unsigned short, unsigned short, unsigned short, + unsigned short, unsigned short, unsigned short, + unsigned short, unsigned short, unsigned short *); +static void zero_4x5_col3(unsigned short[4][5]); +static void zero_4x5_col2(unsigned short[4][5]); +static void zero_4x5_col1(unsigned short[4][5]); +static void swap_4x5_rows(unsigned short[4][5], int, int, int); +static void swap_2x3_rows(unsigned short m[2][3]); +static void solve_4x5(unsigned short m[4][5], unsigned short *, int *); +static void sort_coefs(int *, unsigned short *, int); +static void find_4bit_err_pats(unsigned short, unsigned short, unsigned short, + unsigned short, unsigned short, unsigned short, + unsigned short, unsigned short, unsigned short *); +static void find_3bit_err_coefs(unsigned short, unsigned short, unsigned short, + unsigned short, unsigned short, unsigned short, + unsigned short *); +static void zero_3x4_col2(unsigned short[3][4]); +static void zero_3x4_col1(unsigned short[3][4]); +static void swap_3x4_rows(unsigned short[3][4], int, int, int); +static void solve_3x4(unsigned short[3][4], unsigned short *, int *); +static void find_3bit_err_pats(unsigned short, unsigned short, unsigned short, + unsigned short, unsigned short, unsigned short, + unsigned short *); + +static void find_2bit_err_pats(unsigned short, unsigned short, unsigned short, + unsigned short, unsigned short *); +static void find_2x2_soln(unsigned short, unsigned short, unsigned short, + unsigned short, unsigned short, unsigned short, + unsigned short *); +static void solve_2x3(unsigned short[2][3], unsigned short *); +static int chk_no_err_only(unsigned short *, unsigned short *); +static int chk_1_err_only(unsigned short *, unsigned short *); +static int chk_2_err_only(unsigned short *, unsigned short *); +static int chk_3_err_only(unsigned short *, unsigned short *); +static int chk_4_err_only(unsigned short *, unsigned short *); + +static unsigned short gf64_mul(unsigned short a, unsigned short b) +{ + unsigned short tmp1, tmp2, tmp3, tmp4, tmp5; + unsigned short c_bit0, c_bit1, c_bit2, c_bit3, c_bit4, c_bit5, c; + + tmp1 = ((a) ^ (a >> 5)); + tmp2 = ((a >> 4) ^ (a >> 5)); + tmp3 = ((a >> 3) ^ (a >> 4)); + tmp4 = ((a >> 2) ^ (a >> 3)); + tmp5 = ((a >> 1) ^ (a >> 2)); + + c_bit0 = ((a & b) ^ ((a >> 5) & (b >> 1)) ^ ((a >> 4) & (b >> 2)) ^ + ((a >> 3) & (b >> 3)) ^ ((a >> 2) & (b >> 4)) ^ ((a >> 1) & (b >> 5))) & 0x1; + + c_bit1 = (((a >> 1) & b) ^ (tmp1 & (b >> 1)) ^ (tmp2 & (b >> 2)) ^ + (tmp3 & (b >> 3)) ^ (tmp4 & (b >> 4)) ^ (tmp5 & (b >> 5))) & 0x1; + + c_bit2 = (((a >> 2) & b) ^ ((a >> 1) & (b >> 1)) ^ (tmp1 & (b >> 2)) ^ + (tmp2 & (b >> 3)) ^ (tmp3 & (b >> 4)) ^ (tmp4 & (b >> 5))) & 0x1; + + c_bit3 = (((a >> 3) & b) ^ ((a >> 2) & (b >> 1)) ^ ((a >> 1) & (b >> 2)) ^ + (tmp1 & (b >> 3)) ^ (tmp2 & (b >> 4)) ^ (tmp3 & (b >> 5))) & 0x1; + + c_bit4 = (((a >> 4) & b) ^ ((a >> 3) & (b >> 1)) ^ ((a >> 2) & (b >> 2)) ^ + ((a >> 1) & (b >> 3)) ^ (tmp1 & (b >> 4)) ^ (tmp2 & (b >> 5))) & 0x1; + + c_bit5 = (((a >> 5) & b) ^ ((a >> 4) & (b >> 1)) ^ ((a >> 3) & (b >> 2)) ^ + ((a >> 2) & (b >> 3)) ^ ((a >> 1) & (b >> 4)) ^ (tmp1 & (b >> 5))) & 0x1; + + c = c_bit0 | (c_bit1 << 1) | (c_bit2 << 2) | (c_bit3 << 3) | (c_bit4 << 4) | (c_bit5 << 5); + + return c; +} + +static unsigned short gf4096_mul(unsigned short a, unsigned short b) +{ + unsigned short ah, al, bh, bl, alxah, blxbh, ablh, albl, ahbh, ahbhB, c; + + ah = (a >> 6) & 0x3f; + al = a & 0x3f; + bh = (b >> 6) & 0x3f; + bl = b & 0x3f; + alxah = al ^ ah; + blxbh = bl ^ bh; + + ablh = gf64_mul(alxah, blxbh); + albl = gf64_mul(al, bl); + ahbh = gf64_mul(ah, bh); + + ahbhB = ((ahbh & 0x1) << 5) | + ((ahbh & 0x20) >> 1) | + ((ahbh & 0x10) >> 1) | ((ahbh & 0x8) >> 1) | ((ahbh & 0x4) >> 1) | (((ahbh >> 1) ^ ahbh) & 0x1); + + c = ((ablh ^ albl) << 6) | (ahbhB ^ albl); + return c; +} + +static void find_2bit_err_pats(unsigned short s0, unsigned short s1, unsigned short r0, unsigned short r1, unsigned short *pats) +{ + find_2x2_soln(0x1, 0x1, r0, r1, s0, s1, pats); +} + +static void find_3bit_err_coefs(unsigned short s0, unsigned short s1, + unsigned short s2, unsigned short s3, unsigned short s4, unsigned short s5, unsigned short *coefs) +{ + unsigned short m[3][4]; + int row_order[3]; + + row_order[0] = 0; + row_order[1] = 1; + row_order[2] = 2; + m[0][0] = s2; + m[0][1] = s1; + m[0][2] = s0; + m[0][3] = s3; + m[1][0] = s3; + m[1][1] = s2; + m[1][2] = s1; + m[1][3] = s4; + m[2][0] = s4; + m[2][1] = s3; + m[2][2] = s2; + m[2][3] = s5; + + if (m[0][2] != 0x0) { + zero_3x4_col2(m); + } else if (m[1][2] != 0x0) { + swap_3x4_rows(m, 0, 1, 4); + zero_3x4_col2(m); + } else if (m[2][2] != 0x0) { + swap_3x4_rows(m, 0, 2, 4); + zero_3x4_col2(m); + } else { + printk(KERN_ERR "Error: find_3bit_err_coefs, s0,s1,s2 all zeros!\n"); + } + + if (m[1][1] != 0x0) { + zero_3x4_col1(m); + } else if (m[2][1] != 0x0) { + swap_3x4_rows(m, 1, 2, 4); + zero_3x4_col1(m); + } else { + printk(KERN_ERR "Error: find_3bit_err_coefs, cannot resolve col 1!\n"); + } + + /* solve coefs */ + solve_3x4(m, coefs, row_order); +} + +static void zero_3x4_col2(unsigned short m[3][4]) +{ + unsigned short minv1, minv2; + + minv1 = gf4096_mul(m[1][2], gf4096_inv(m[0][2])); + minv2 = gf4096_mul(m[2][2], gf4096_inv(m[0][2])); + m[1][0] = m[1][0] ^ gf4096_mul(m[0][0], minv1); + m[1][1] = m[1][1] ^ gf4096_mul(m[0][1], minv1); + m[1][3] = m[1][3] ^ gf4096_mul(m[0][3], minv1); + m[2][0] = m[2][0] ^ gf4096_mul(m[0][0], minv2); + m[2][1] = m[2][1] ^ gf4096_mul(m[0][1], minv2); + m[2][3] = m[2][3] ^ gf4096_mul(m[0][3], minv2); +} + +static void zero_3x4_col1(unsigned short m[3][4]) +{ + unsigned short minv; + minv = gf4096_mul(m[2][1], gf4096_inv(m[1][1])); + m[2][0] = m[2][0] ^ gf4096_mul(m[1][0], minv); + m[2][3] = m[2][3] ^ gf4096_mul(m[1][3], minv); +} + +static void swap_3x4_rows(unsigned short m[3][4], int i, int j, int col_width) +{ + unsigned short tmp0; + int cnt; + for (cnt = 0; cnt < col_width; cnt++) { + tmp0 = m[i][cnt]; + m[i][cnt] = m[j][cnt]; + m[j][cnt] = tmp0; + } +} + +static void solve_3x4(unsigned short m[3][4], unsigned short *coefs, int *row_order) +{ + unsigned short tmp[3]; + tmp[0] = gf4096_mul(m[2][3], gf4096_inv(m[2][0])); + tmp[1] = gf4096_mul((gf4096_mul(tmp[0], m[1][0]) ^ m[1][3]), gf4096_inv(m[1][1])); + tmp[2] = gf4096_mul((gf4096_mul(tmp[0], m[0][0]) ^ gf4096_mul(tmp[1], m[0][1]) ^ m[0][3]), gf4096_inv(m[0][2])); + sort_coefs(row_order, tmp, 3); + coefs[0] = tmp[0]; + coefs[1] = tmp[1]; + coefs[2] = tmp[2]; +} + +static void find_3bit_err_pats(unsigned short s0, unsigned short s1, + unsigned short s2, unsigned short r0, + unsigned short r1, unsigned short r2, + unsigned short *pats) +{ + find_2x2_soln(r0 ^ r2, r1 ^ r2, + gf4096_mul(r0, r0 ^ r2), gf4096_mul(r1, r1 ^ r2), + gf4096_mul(s0, r2) ^ s1, gf4096_mul(s1, r2) ^ s2, pats); + pats[2] = s0 ^ pats[0] ^ pats[1]; +} + +static void find_4bit_err_coefs(unsigned short s0, unsigned short s1, + unsigned short s2, unsigned short s3, + unsigned short s4, unsigned short s5, + unsigned short s6, unsigned short s7, + unsigned short *coefs) +{ + unsigned short m[4][5]; + int row_order[4]; + + row_order[0] = 0; + row_order[1] = 1; + row_order[2] = 2; + row_order[3] = 3; + + m[0][0] = s3; + m[0][1] = s2; + m[0][2] = s1; + m[0][3] = s0; + m[0][4] = s4; + m[1][0] = s4; + m[1][1] = s3; + m[1][2] = s2; + m[1][3] = s1; + m[1][4] = s5; + m[2][0] = s5; + m[2][1] = s4; + m[2][2] = s3; + m[2][3] = s2; + m[2][4] = s6; + m[3][0] = s6; + m[3][1] = s5; + m[3][2] = s4; + m[3][3] = s3; + m[3][4] = s7; + + if (m[0][3] != 0x0) { + zero_4x5_col3(m); + } else if (m[1][3] != 0x0) { + swap_4x5_rows(m, 0, 1, 5); + zero_4x5_col3(m); + } else if (m[2][3] != 0x0) { + swap_4x5_rows(m, 0, 2, 5); + zero_4x5_col3(m); + } else if (m[3][3] != 0x0) { + swap_4x5_rows(m, 0, 3, 5); + zero_4x5_col3(m); + } else { + printk(KERN_ERR "Error: find_4bit_err_coefs, s0,s1,s2,s3 all zeros!\n"); + } + + if (m[1][2] != 0x0) { + zero_4x5_col2(m); + } else if (m[2][2] != 0x0) { + swap_4x5_rows(m, 1, 2, 5); + zero_4x5_col2(m); + } else if (m[3][2] != 0x0) { + swap_4x5_rows(m, 1, 3, 5); + zero_4x5_col2(m); + } else { + printk(KERN_ERR "Error: find_4bit_err_coefs, cannot resolve col 2!\n"); + } + + if (m[2][1] != 0x0) { + zero_4x5_col1(m); + } else if (m[3][1] != 0x0) { + swap_4x5_rows(m, 2, 3, 5); + zero_4x5_col1(m); + } else { + printk(KERN_ERR "Error: find_4bit_err_coefs, cannot resolve col 1!\n"); + } + + solve_4x5(m, coefs, row_order); +} + +static void zero_4x5_col3(unsigned short m[4][5]) +{ + unsigned short minv1, minv2, minv3; + + minv1 = gf4096_mul(m[1][3], gf4096_inv(m[0][3])); + minv2 = gf4096_mul(m[2][3], gf4096_inv(m[0][3])); + minv3 = gf4096_mul(m[3][3], gf4096_inv(m[0][3])); + + m[1][0] = m[1][0] ^ gf4096_mul(m[0][0], minv1); + m[1][1] = m[1][1] ^ gf4096_mul(m[0][1], minv1); + m[1][2] = m[1][2] ^ gf4096_mul(m[0][2], minv1); + m[1][4] = m[1][4] ^ gf4096_mul(m[0][4], minv1); + m[2][0] = m[2][0] ^ gf4096_mul(m[0][0], minv2); + m[2][1] = m[2][1] ^ gf4096_mul(m[0][1], minv2); + m[2][2] = m[2][2] ^ gf4096_mul(m[0][2], minv2); + m[2][4] = m[2][4] ^ gf4096_mul(m[0][4], minv2); + m[3][0] = m[3][0] ^ gf4096_mul(m[0][0], minv3); + m[3][1] = m[3][1] ^ gf4096_mul(m[0][1], minv3); + m[3][2] = m[3][2] ^ gf4096_mul(m[0][2], minv3); + m[3][4] = m[3][4] ^ gf4096_mul(m[0][4], minv3); +} + +static void zero_4x5_col2(unsigned short m[4][5]) +{ + unsigned short minv2, minv3; + + minv2 = gf4096_mul(m[2][2], gf4096_inv(m[1][2])); + minv3 = gf4096_mul(m[3][2], gf4096_inv(m[1][2])); + + m[2][0] = m[2][0] ^ gf4096_mul(m[1][0], minv2); + m[2][1] = m[2][1] ^ gf4096_mul(m[1][1], minv2); + m[2][4] = m[2][4] ^ gf4096_mul(m[1][4], minv2); + m[3][0] = m[3][0] ^ gf4096_mul(m[1][0], minv3); + m[3][1] = m[3][1] ^ gf4096_mul(m[1][1], minv3); + m[3][4] = m[3][4] ^ gf4096_mul(m[1][4], minv3); +} + +static void zero_4x5_col1(unsigned short m[4][5]) +{ + unsigned short minv; + + minv = gf4096_mul(m[3][1], gf4096_inv(m[2][1])); + + m[3][0] = m[3][0] ^ gf4096_mul(m[2][0], minv); + m[3][4] = m[3][4] ^ gf4096_mul(m[2][4], minv); +} + +static void swap_4x5_rows(unsigned short m[4][5], int i, int j, int col_width) +{ + unsigned short tmp0; + int cnt; + + for (cnt = 0; cnt < col_width; cnt++) { + tmp0 = m[i][cnt]; + m[i][cnt] = m[j][cnt]; + m[j][cnt] = tmp0; + } +} + +static void solve_4x5(unsigned short m[4][5], unsigned short *coefs, int *row_order) +{ + unsigned short tmp[4]; + + tmp[0] = gf4096_mul(m[3][4], gf4096_inv(m[3][0])); + tmp[1] = gf4096_mul((gf4096_mul(tmp[0], m[2][0]) ^ m[2][4]), gf4096_inv(m[2][1])); + tmp[2] = gf4096_mul((gf4096_mul(tmp[0], m[1][0]) ^ gf4096_mul(tmp[1], m[1][1]) ^ m[1][4]), gf4096_inv(m[1][2])); + tmp[3] = gf4096_mul((gf4096_mul(tmp[0], m[0][0]) ^ + gf4096_mul(tmp[1], m[0][1]) ^ gf4096_mul(tmp[2], m[0][2]) ^ m[0][4]), gf4096_inv(m[0][3])); + sort_coefs(row_order, tmp, 4); + coefs[0] = tmp[0]; + coefs[1] = tmp[1]; + coefs[2] = tmp[2]; + coefs[3] = tmp[3]; +} + +static void sort_coefs(int *order, unsigned short *soln, int len) +{ + int cnt, start_cnt, least_ord, least_cnt; + unsigned short tmp0; + for (start_cnt = 0; start_cnt < len; start_cnt++) { + for (cnt = start_cnt; cnt < len; cnt++) { + if (cnt == start_cnt) { + least_ord = order[cnt]; + least_cnt = start_cnt; + } else { + if (least_ord > order[cnt]) { + least_ord = order[cnt]; + least_cnt = cnt; + } + } + } + if (least_cnt != start_cnt) { + tmp0 = order[least_cnt]; + order[least_cnt] = order[start_cnt]; + order[start_cnt] = tmp0; + tmp0 = soln[least_cnt]; + soln[least_cnt] = soln[start_cnt]; + soln[start_cnt] = tmp0; + } + } +} + +static void find_4bit_err_pats(unsigned short s0, unsigned short s1, + unsigned short s2, unsigned short s3, + unsigned short z1, unsigned short z2, + unsigned short z3, unsigned short z4, + unsigned short *pats) +{ + unsigned short z4_z1, z3z4_z3z3, z4_z2, s0z4_s1, z1z4_z1z1, + z4_z3, z2z4_z2z2, s1z4_s2, z3z3z4_z3z3z3, z1z1z4_z1z1z1, z2z2z4_z2z2z2, s2z4_s3; + unsigned short tmp0, tmp1, tmp2, tmp3; + + z4_z1 = z4 ^ z1; + z3z4_z3z3 = gf4096_mul(z3, z4) ^ gf4096_mul(z3, z3); + z4_z2 = z4 ^ z2; + s0z4_s1 = gf4096_mul(s0, z4) ^ s1; + z1z4_z1z1 = gf4096_mul(z1, z4) ^ gf4096_mul(z1, z1); + z4_z3 = z4 ^ z3; + z2z4_z2z2 = gf4096_mul(z2, z4) ^ gf4096_mul(z2, z2); + s1z4_s2 = gf4096_mul(s1, z4) ^ s2; + z3z3z4_z3z3z3 = gf4096_mul(gf4096_mul(z3, z3), z4) ^ gf4096_mul(gf4096_mul(z3, z3), z3); + z1z1z4_z1z1z1 = gf4096_mul(gf4096_mul(z1, z1), z4) ^ gf4096_mul(gf4096_mul(z1, z1), z1); + z2z2z4_z2z2z2 = gf4096_mul(gf4096_mul(z2, z2), z4) ^ gf4096_mul(gf4096_mul(z2, z2), z2); + s2z4_s3 = gf4096_mul(s2, z4) ^ s3; + + //find err pat 0,1 + find_2x2_soln(gf4096_mul(z4_z1, z3z4_z3z3) ^ + gf4096_mul(z1z4_z1z1, z4_z3), gf4096_mul(z4_z2, + z3z4_z3z3) ^ + gf4096_mul(z2z4_z2z2, z4_z3), gf4096_mul(z1z4_z1z1, + z3z3z4_z3z3z3) ^ + gf4096_mul(z1z1z4_z1z1z1, z3z4_z3z3), + gf4096_mul(z2z4_z2z2, + z3z3z4_z3z3z3) ^ gf4096_mul(z2z2z4_z2z2z2, + z3z4_z3z3), + gf4096_mul(s0z4_s1, z3z4_z3z3) ^ gf4096_mul(s1z4_s2, + z4_z3), + gf4096_mul(s1z4_s2, z3z3z4_z3z3z3) ^ gf4096_mul(s2z4_s3, z3z4_z3z3), pats); + tmp0 = pats[0]; + tmp1 = pats[1]; + tmp2 = pats[0] ^ pats[1] ^ s0; + tmp3 = gf4096_mul(pats[0], z1) ^ gf4096_mul(pats[1], z2) ^ s1; + + //find err pat 2,3 + find_2x2_soln(0x1, 0x1, z3, z4, tmp2, tmp3, pats); + pats[2] = pats[0]; + pats[3] = pats[1]; + pats[0] = tmp0; + pats[1] = tmp1; +} + +static void find_2x2_soln(unsigned short c00, unsigned short c01, + unsigned short c10, unsigned short c11, + unsigned short lval0, unsigned short lval1, + unsigned short *soln) +{ + unsigned short m[2][3]; + m[0][0] = c00; + m[0][1] = c01; + m[0][2] = lval0; + m[1][0] = c10; + m[1][1] = c11; + m[1][2] = lval1; + + if (m[0][1] != 0x0) { + /* */ + } else if (m[1][1] != 0x0) { + swap_2x3_rows(m); + } else { + printk(KERN_ERR "Warning: find_2bit_err_coefs, s0,s1 all zeros!\n"); + } + + solve_2x3(m, soln); +} + +static void swap_2x3_rows(unsigned short m[2][3]) +{ + unsigned short tmp0; + int cnt; + + for (cnt = 0; cnt < 3; cnt++) { + tmp0 = m[0][cnt]; + m[0][cnt] = m[1][cnt]; + m[1][cnt] = tmp0; + } +} + +static void solve_2x3(unsigned short m[2][3], unsigned short *coefs) +{ + unsigned short minv; + + minv = gf4096_mul(m[1][1], gf4096_inv(m[0][1])); + m[1][0] = m[1][0] ^ gf4096_mul(m[0][0], minv); + m[1][2] = m[1][2] ^ gf4096_mul(m[0][2], minv); + coefs[0] = gf4096_mul(m[1][2], gf4096_inv(m[1][0])); + coefs[1] = gf4096_mul((gf4096_mul(coefs[0], m[0][0]) ^ m[0][2]), gf4096_inv(m[0][1])); +} + +static unsigned char gf64_inv[64] = { + 0, 1, 33, 62, 49, 43, 31, 44, 57, 37, 52, 28, 46, 40, 22, 25, + 61, 54, 51, 39, 26, 35, 14, 24, 23, 15, 20, 34, 11, 53, 45, 6, + 63, 2, 27, 21, 56, 9, 50, 19, 13, 47, 48, 5, 7, 30, 12, 41, + 42, 4, 38, 18, 10, 29, 17, 60, 36, 8, 59, 58, 55, 16, 3, 32}; + +static unsigned short gf4096_inv(unsigned short din) +{ + unsigned short alahxal, ah2B, deno, inv, bl, bh; + unsigned short ah, al, ahxal; + unsigned short dout; + + ah = (din >> 6) & 0x3f; + al = din & 0x3f; + ahxal = ah ^ al; + ah2B = (((ah ^ (ah >> 3)) & 0x1) << 5) | + ((ah >> 1) & 0x10) | + ((((ah >> 5) ^ (ah >> 2)) & 0x1) << 3) | + ((ah >> 2) & 0x4) | ((((ah >> 4) ^ (ah >> 1)) & 0x1) << 1) | (ah & 0x1); + alahxal = gf64_mul(ahxal, al); + deno = alahxal ^ ah2B; + inv = gf64_inv[deno]; + bl = gf64_mul(inv, ahxal); + bh = gf64_mul(inv, ah); + dout = ((bh & 0x3f) << 6) | (bl & 0x3f); + return (((bh & 0x3f) << 6) | (bl & 0x3f)); +} + +static unsigned short err_pos_lut[4096] = { + 0xfff, 0x000, 0x451, 0xfff, 0xfff, 0x3cf, 0xfff, 0x041, + 0xfff, 0xfff, 0xfff, 0xfff, 0x28a, 0xfff, 0x492, 0xfff, + 0x145, 0xfff, 0xfff, 0x514, 0xfff, 0x082, 0xfff, 0xfff, + 0xfff, 0x249, 0x38e, 0x410, 0xfff, 0x104, 0x208, 0x1c7, + 0xfff, 0xfff, 0xfff, 0xfff, 0x2cb, 0xfff, 0xfff, 0xfff, + 0x0c3, 0x34d, 0x4d3, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x186, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x30c, 0x555, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x166, 0xfff, 0xfff, 0xfff, 0xfff, + 0x385, 0x14e, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4e1, + 0xfff, 0xfff, 0xfff, 0xfff, 0x538, 0xfff, 0x16d, 0xfff, + 0xfff, 0xfff, 0x45b, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x29c, 0x2cc, 0x30b, 0x2b3, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x0b3, 0xfff, 0x2f7, + 0xfff, 0x32b, 0xfff, 0xfff, 0xfff, 0xfff, 0x0a7, 0xfff, + 0xfff, 0x2da, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x07e, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x11c, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x22f, 0xfff, 0x1f4, 0xfff, 0xfff, + 0x2b0, 0x504, 0xfff, 0x114, 0xfff, 0xfff, 0xfff, 0x21d, + 0xfff, 0xfff, 0xfff, 0xfff, 0x00d, 0x3c4, 0x340, 0x10f, + 0xfff, 0xfff, 0x266, 0x02e, 0xfff, 0xfff, 0xfff, 0x4f8, + 0x337, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x07b, 0x168, 0xfff, 0xfff, 0x0fe, + 0xfff, 0xfff, 0x51a, 0xfff, 0x458, 0xfff, 0x36d, 0xfff, + 0xfff, 0xfff, 0xfff, 0x073, 0x37d, 0x415, 0x550, 0xfff, + 0xfff, 0xfff, 0x23b, 0x4b4, 0xfff, 0xfff, 0xfff, 0x1a1, + 0xfff, 0xfff, 0x3aa, 0xfff, 0x117, 0x04d, 0x341, 0xfff, + 0xfff, 0xfff, 0xfff, 0x518, 0x03e, 0x0f2, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x363, 0xfff, 0x0b9, 0xfff, 0xfff, + 0x241, 0xfff, 0xfff, 0x049, 0xfff, 0xfff, 0xfff, 0xfff, + 0x15f, 0x52d, 0xfff, 0xfff, 0xfff, 0x29e, 0xfff, 0xfff, + 0xfff, 0xfff, 0x4cf, 0x0fc, 0xfff, 0x36f, 0x3d3, 0xfff, + 0x228, 0xfff, 0xfff, 0x45e, 0xfff, 0xfff, 0xfff, 0xfff, + 0x238, 0xfff, 0xfff, 0xfff, 0xfff, 0x47f, 0xfff, 0xfff, + 0x43a, 0x265, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x3e8, + 0xfff, 0xfff, 0x01a, 0xfff, 0xfff, 0xfff, 0xfff, 0x21e, + 0x1fc, 0x40b, 0xfff, 0xfff, 0xfff, 0x2d0, 0x159, 0xfff, + 0xfff, 0x313, 0xfff, 0xfff, 0x05c, 0x4cc, 0xfff, 0xfff, + 0x0f6, 0x3d5, 0xfff, 0xfff, 0xfff, 0x54f, 0xfff, 0xfff, + 0xfff, 0x172, 0x1e4, 0x07c, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x53c, 0x1ad, 0x535, + 0x19b, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x092, 0xfff, 0x2be, 0xfff, 0xfff, 0x482, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x0e6, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x476, 0xfff, 0x51d, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x342, 0x2b5, 0x22e, 0x09a, 0xfff, 0x08d, + 0x44f, 0x3ed, 0xfff, 0xfff, 0xfff, 0xfff, 0x3d1, 0xfff, + 0xfff, 0x543, 0xfff, 0x48f, 0xfff, 0x3d2, 0xfff, 0x0d5, + 0x113, 0x0ec, 0x427, 0xfff, 0xfff, 0xfff, 0x4c4, 0xfff, + 0xfff, 0x50a, 0xfff, 0x144, 0xfff, 0x105, 0x39f, 0x294, + 0x164, 0xfff, 0x31a, 0xfff, 0xfff, 0x49a, 0xfff, 0x130, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x1be, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x49e, 0x371, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x0e8, 0x49c, 0x0f4, 0xfff, + 0x338, 0x1a7, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x36c, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x1ae, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x31b, 0xfff, 0xfff, 0x2dd, 0x522, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x2f4, + 0x3c6, 0x30d, 0xfff, 0xfff, 0xfff, 0xfff, 0x34c, 0x18f, + 0x30a, 0xfff, 0x01f, 0x079, 0xfff, 0xfff, 0x54d, 0x46b, + 0x28c, 0x37f, 0xfff, 0xfff, 0xfff, 0xfff, 0x355, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x14f, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x359, 0x3fe, 0x3c5, 0xfff, 0xfff, + 0xfff, 0xfff, 0x423, 0xfff, 0xfff, 0x34a, 0x22c, 0xfff, + 0x25a, 0xfff, 0xfff, 0x4ad, 0xfff, 0x28d, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x547, 0xfff, 0xfff, 0xfff, 0xfff, + 0x2e2, 0xfff, 0xfff, 0x1d5, 0xfff, 0x2a8, 0xfff, 0xfff, + 0x03f, 0xfff, 0xfff, 0xfff, 0xfff, 0x3eb, 0x0fa, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x55b, 0xfff, + 0x08e, 0xfff, 0x3ae, 0xfff, 0x3a4, 0xfff, 0x282, 0x158, + 0xfff, 0x382, 0xfff, 0xfff, 0x499, 0xfff, 0xfff, 0x08a, + 0xfff, 0xfff, 0xfff, 0x456, 0x3be, 0xfff, 0x1e2, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x559, 0xfff, 0x1a0, 0xfff, + 0xfff, 0x0b4, 0xfff, 0xfff, 0xfff, 0x2df, 0xfff, 0xfff, + 0xfff, 0x07f, 0x4f5, 0xfff, 0xfff, 0x27c, 0x133, 0x017, + 0xfff, 0x3fd, 0xfff, 0xfff, 0xfff, 0x44d, 0x4cd, 0x17a, + 0x0d7, 0x537, 0xfff, 0xfff, 0x353, 0xfff, 0xfff, 0x351, + 0x366, 0xfff, 0x44a, 0xfff, 0x1a6, 0xfff, 0xfff, 0xfff, + 0x291, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1e3, + 0xfff, 0xfff, 0xfff, 0xfff, 0x389, 0xfff, 0x07a, 0xfff, + 0x1b6, 0x2ed, 0xfff, 0xfff, 0xfff, 0xfff, 0x24e, 0x074, + 0xfff, 0xfff, 0x3dc, 0xfff, 0x4e3, 0xfff, 0xfff, 0xfff, + 0xfff, 0x4eb, 0xfff, 0xfff, 0x3b8, 0x4de, 0xfff, 0x19c, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x262, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x076, 0x4e8, 0x3da, + 0xfff, 0x531, 0xfff, 0xfff, 0x14a, 0xfff, 0x0a2, 0x433, + 0x3df, 0x1e9, 0xfff, 0xfff, 0xfff, 0xfff, 0x3e7, 0x285, + 0x2d8, 0xfff, 0xfff, 0xfff, 0x349, 0x18d, 0x098, 0xfff, + 0x0df, 0x4bf, 0xfff, 0xfff, 0x0b2, 0xfff, 0x346, 0x24d, + 0xfff, 0xfff, 0xfff, 0x24f, 0x4fa, 0x2f9, 0xfff, 0xfff, + 0x3c9, 0xfff, 0x2b4, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x056, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x179, 0xfff, 0x0e9, 0x3f0, 0x33d, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x1fd, 0xfff, 0xfff, 0x526, 0xfff, + 0xfff, 0xfff, 0x53d, 0xfff, 0xfff, 0xfff, 0x170, 0x331, + 0xfff, 0x068, 0xfff, 0xfff, 0xfff, 0x3f7, 0xfff, 0x3d8, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x09f, 0x556, 0xfff, 0xfff, 0x02d, 0xfff, 0xfff, + 0x553, 0xfff, 0xfff, 0xfff, 0x1f0, 0xfff, 0xfff, 0x4d6, + 0x41e, 0xfff, 0xfff, 0xfff, 0xfff, 0x4d5, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x248, 0xfff, 0xfff, 0xfff, 0x0a3, + 0xfff, 0x217, 0xfff, 0xfff, 0xfff, 0x4f1, 0x209, 0xfff, + 0xfff, 0x475, 0x234, 0x52b, 0x398, 0xfff, 0x08b, 0xfff, + 0xfff, 0xfff, 0xfff, 0x2c2, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x268, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x4a3, 0xfff, 0x0aa, 0xfff, 0x1d9, 0xfff, 0xfff, + 0xfff, 0xfff, 0x155, 0xfff, 0xfff, 0xfff, 0xfff, 0x0bf, + 0x539, 0xfff, 0xfff, 0x2f1, 0x545, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x2a7, 0x06f, 0xfff, 0x378, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x25e, 0xfff, + 0xfff, 0xfff, 0xfff, 0x15d, 0x02a, 0xfff, 0xfff, 0x0bc, + 0x235, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x150, 0xfff, 0x1a9, 0xfff, 0xfff, 0xfff, 0xfff, 0x381, + 0xfff, 0x04e, 0x270, 0x13f, 0xfff, 0xfff, 0x405, 0xfff, + 0x3cd, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x2ef, 0xfff, 0x06a, 0xfff, 0xfff, 0xfff, 0x34f, + 0x212, 0xfff, 0xfff, 0x0e2, 0xfff, 0x083, 0x298, 0xfff, + 0xfff, 0xfff, 0x0c2, 0xfff, 0xfff, 0x52e, 0xfff, 0x488, + 0xfff, 0xfff, 0xfff, 0x36b, 0xfff, 0xfff, 0xfff, 0x442, + 0x091, 0xfff, 0x41c, 0xfff, 0xfff, 0x3a5, 0xfff, 0x4e6, + 0xfff, 0xfff, 0x40d, 0x31d, 0xfff, 0xfff, 0xfff, 0x4c1, + 0x053, 0xfff, 0x418, 0x13c, 0xfff, 0x350, 0xfff, 0x0ae, + 0xfff, 0xfff, 0x41f, 0xfff, 0x470, 0xfff, 0x4ca, 0xfff, + 0xfff, 0xfff, 0x02b, 0x450, 0xfff, 0x1f8, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x293, 0xfff, + 0xfff, 0xfff, 0xfff, 0x411, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x0b8, 0xfff, 0xfff, 0xfff, + 0x3e1, 0xfff, 0xfff, 0xfff, 0xfff, 0x43c, 0xfff, 0x2b2, + 0x2ab, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1ec, + 0xfff, 0xfff, 0xfff, 0x3f8, 0x034, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x11a, 0xfff, 0x541, 0x45c, 0x134, + 0x1cc, 0xfff, 0xfff, 0xfff, 0x469, 0xfff, 0xfff, 0x44b, + 0x161, 0xfff, 0xfff, 0xfff, 0x055, 0xfff, 0xfff, 0xfff, + 0xfff, 0x307, 0xfff, 0xfff, 0xfff, 0xfff, 0x2d1, 0xfff, + 0xfff, 0xfff, 0x124, 0x37b, 0x26b, 0x336, 0xfff, 0xfff, + 0x2e4, 0x3cb, 0xfff, 0xfff, 0x0f8, 0x3c8, 0xfff, 0xfff, + 0xfff, 0x461, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4b5, + 0x2cf, 0xfff, 0xfff, 0xfff, 0x20f, 0xfff, 0x35a, 0xfff, + 0x490, 0xfff, 0x185, 0xfff, 0xfff, 0xfff, 0xfff, 0x42e, + 0xfff, 0xfff, 0xfff, 0xfff, 0x54b, 0xfff, 0xfff, 0xfff, + 0x146, 0xfff, 0x412, 0xfff, 0xfff, 0xfff, 0x1ff, 0xfff, + 0xfff, 0x3e0, 0xfff, 0xfff, 0xfff, 0xfff, 0x2d5, 0xfff, + 0x4df, 0x505, 0xfff, 0x413, 0xfff, 0x1a5, 0xfff, 0x3b2, + 0xfff, 0xfff, 0xfff, 0x35b, 0xfff, 0x116, 0xfff, 0xfff, + 0x171, 0x4d0, 0xfff, 0x154, 0x12d, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x468, 0x4db, 0xfff, + 0xfff, 0x1df, 0xfff, 0xfff, 0xfff, 0xfff, 0x05a, 0xfff, + 0x0f1, 0x403, 0xfff, 0x22b, 0x2e0, 0xfff, 0xfff, 0xfff, + 0x2b7, 0x373, 0xfff, 0xfff, 0xfff, 0xfff, 0x13e, 0xfff, + 0xfff, 0xfff, 0x0d0, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x329, 0x1d2, 0x3fa, 0x047, 0xfff, 0x2f2, 0xfff, 0xfff, + 0x141, 0x0ac, 0x1d7, 0xfff, 0x07d, 0xfff, 0xfff, 0xfff, + 0x1c1, 0xfff, 0x487, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x045, 0xfff, 0xfff, 0xfff, 0xfff, + 0x288, 0x0cd, 0xfff, 0xfff, 0xfff, 0xfff, 0x226, 0x1d8, + 0xfff, 0x153, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4cb, + 0x528, 0xfff, 0xfff, 0xfff, 0x20a, 0x343, 0x3a1, 0xfff, + 0xfff, 0xfff, 0x2d7, 0x2d3, 0x1aa, 0x4c5, 0xfff, 0xfff, + 0xfff, 0x42b, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x3e9, 0xfff, 0x20b, 0x260, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x37c, 0x2fd, + 0xfff, 0xfff, 0x2c8, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x31e, 0xfff, 0x335, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x135, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x35c, 0x4dd, 0x129, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x1ef, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x34e, 0xfff, 0xfff, 0xfff, 0xfff, 0x407, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x3ad, 0xfff, 0xfff, 0xfff, + 0x379, 0xfff, 0xfff, 0x1d0, 0x38d, 0xfff, 0xfff, 0x1e8, + 0x184, 0x3c1, 0x1c4, 0xfff, 0x1f9, 0xfff, 0xfff, 0x424, + 0xfff, 0xfff, 0xfff, 0xfff, 0x1d3, 0x0d4, 0xfff, 0x4e9, + 0xfff, 0xfff, 0xfff, 0x530, 0x107, 0xfff, 0x106, 0x04f, + 0xfff, 0xfff, 0x4c7, 0x503, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x15c, 0xfff, 0x23f, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x4f3, 0xfff, 0xfff, 0x3c7, + 0xfff, 0x278, 0xfff, 0xfff, 0x0a6, 0xfff, 0xfff, 0xfff, + 0x122, 0x1cf, 0xfff, 0x327, 0xfff, 0x2e5, 0xfff, 0x29d, + 0xfff, 0xfff, 0x3f1, 0xfff, 0xfff, 0x48d, 0xfff, 0xfff, + 0xfff, 0xfff, 0x054, 0xfff, 0xfff, 0xfff, 0xfff, 0x178, + 0x27e, 0x4e0, 0x352, 0x02f, 0x09c, 0xfff, 0x2a0, 0xfff, + 0xfff, 0x46a, 0x457, 0xfff, 0xfff, 0x501, 0xfff, 0x2ba, + 0xfff, 0xfff, 0xfff, 0x54e, 0x2e7, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x551, 0xfff, 0xfff, 0x1db, 0x2aa, 0xfff, + 0xfff, 0x4bc, 0xfff, 0xfff, 0x395, 0xfff, 0x0de, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x455, 0xfff, 0x17e, + 0xfff, 0x221, 0x4a7, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x388, 0xfff, 0xfff, 0xfff, 0x308, 0xfff, 0xfff, 0xfff, + 0x20e, 0x4b9, 0xfff, 0x273, 0x20c, 0x09e, 0xfff, 0x057, + 0xfff, 0xfff, 0xfff, 0xfff, 0x3f2, 0xfff, 0x1a8, 0x3a6, + 0x14c, 0xfff, 0xfff, 0x071, 0xfff, 0xfff, 0x53a, 0xfff, + 0xfff, 0xfff, 0xfff, 0x109, 0xfff, 0xfff, 0x399, 0xfff, + 0x061, 0x4f0, 0x39e, 0x244, 0xfff, 0x035, 0xfff, 0xfff, + 0x305, 0x47e, 0x297, 0xfff, 0xfff, 0x2b8, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1bc, 0xfff, 0x2fc, + 0xfff, 0xfff, 0x554, 0xfff, 0xfff, 0xfff, 0xfff, 0x3b6, + 0xfff, 0xfff, 0xfff, 0x515, 0x397, 0xfff, 0xfff, 0x12f, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4e5, + 0xfff, 0x4fc, 0xfff, 0xfff, 0x05e, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x0a8, 0x3af, 0x015, 0xfff, 0xfff, 0xfff, + 0xfff, 0x138, 0xfff, 0xfff, 0xfff, 0x540, 0xfff, 0xfff, + 0xfff, 0x027, 0x523, 0x2f0, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x16c, 0xfff, 0x27d, 0xfff, 0xfff, 0xfff, + 0xfff, 0x04c, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4dc, + 0xfff, 0xfff, 0x059, 0x301, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x1a3, 0xfff, 0x15a, 0xfff, 0xfff, + 0x0a5, 0xfff, 0x435, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x051, 0xfff, 0xfff, 0x131, 0xfff, 0x4f4, 0xfff, + 0xfff, 0xfff, 0xfff, 0x441, 0xfff, 0x4fb, 0xfff, 0x03b, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1ed, 0x274, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x0d3, 0x55e, 0x1b3, + 0xfff, 0x0bd, 0xfff, 0xfff, 0xfff, 0xfff, 0x225, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x4b7, 0xfff, 0xfff, 0x2ff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4c3, 0xfff, + 0x383, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x2f6, + 0xfff, 0xfff, 0x1ee, 0xfff, 0x03d, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x26f, 0x1dc, 0xfff, 0x0db, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x0ce, 0xfff, 0xfff, 0x127, 0x03a, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x311, 0xfff, + 0xfff, 0x13d, 0x09d, 0x47b, 0x2a6, 0x50d, 0x510, 0x19a, + 0xfff, 0x354, 0x414, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x44c, 0x3b0, 0xfff, 0x23d, 0x429, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x4c0, 0x416, 0xfff, 0x05b, 0xfff, 0xfff, 0x137, 0xfff, + 0x25f, 0x49f, 0xfff, 0x279, 0x013, 0xfff, 0xfff, 0xfff, + 0x269, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x3d0, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x077, 0xfff, 0xfff, 0x3fb, + 0xfff, 0xfff, 0xfff, 0xfff, 0x271, 0x3a0, 0xfff, 0xfff, + 0x40f, 0xfff, 0xfff, 0x3de, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1ab, 0x26a, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x489, 0xfff, 0xfff, + 0x252, 0xfff, 0xfff, 0xfff, 0xfff, 0x1b7, 0x42f, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x3b7, + 0xfff, 0x2bb, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x0f7, 0x01d, 0xfff, 0x067, 0xfff, + 0xfff, 0xfff, 0xfff, 0x4e2, 0xfff, 0xfff, 0x4bb, 0xfff, + 0xfff, 0xfff, 0x17b, 0xfff, 0x0ee, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x36e, 0xfff, 0xfff, 0xfff, 0x533, 0xfff, + 0xfff, 0xfff, 0x4d4, 0x356, 0xfff, 0xfff, 0x375, 0xfff, + 0xfff, 0xfff, 0xfff, 0x4a4, 0x513, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4ff, 0xfff, 0x2af, + 0xfff, 0xfff, 0x026, 0xfff, 0x0ad, 0xfff, 0xfff, 0xfff, + 0xfff, 0x26e, 0xfff, 0xfff, 0xfff, 0xfff, 0x493, 0xfff, + 0x463, 0x4d2, 0x4be, 0xfff, 0xfff, 0xfff, 0xfff, 0x4f2, + 0x0b6, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x32d, 0x315, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x13a, 0x4a1, 0xfff, 0x27a, 0xfff, 0xfff, 0xfff, + 0x47a, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x334, 0xfff, 0xfff, 0xfff, 0xfff, 0x54c, 0xfff, 0xfff, + 0xfff, 0x0c9, 0x007, 0xfff, 0xfff, 0x12e, 0xfff, 0x0ff, + 0xfff, 0xfff, 0x3f5, 0x509, 0xfff, 0xfff, 0xfff, 0xfff, + 0x1c3, 0x2ad, 0xfff, 0xfff, 0x47c, 0x261, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x152, 0xfff, 0xfff, 0xfff, 0x339, + 0xfff, 0x243, 0x1c0, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x063, 0xfff, 0xfff, 0x254, 0xfff, 0xfff, 0x173, 0xfff, + 0x0c7, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x362, 0x259, 0x485, 0x374, 0x0dc, 0x3ab, 0xfff, + 0x1c5, 0x534, 0x544, 0xfff, 0xfff, 0x508, 0xfff, 0x402, + 0x408, 0xfff, 0x0e7, 0xfff, 0xfff, 0x00a, 0x205, 0xfff, + 0xfff, 0x2b9, 0xfff, 0xfff, 0xfff, 0x465, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x23a, 0xfff, 0xfff, 0xfff, + 0xfff, 0x147, 0x19d, 0x115, 0x214, 0xfff, 0x090, 0x368, + 0xfff, 0x210, 0xfff, 0xfff, 0x280, 0x52a, 0x163, 0x148, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x326, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x2de, 0xfff, 0xfff, 0xfff, 0xfff, + 0x206, 0x2c1, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x189, 0xfff, 0xfff, 0xfff, 0xfff, 0x367, 0xfff, 0x1a4, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x443, 0xfff, 0x27b, + 0xfff, 0xfff, 0x251, 0x549, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x188, 0x04b, 0xfff, 0xfff, 0xfff, 0x31f, + 0x4a6, 0xfff, 0x246, 0x1de, 0x156, 0xfff, 0xfff, 0xfff, + 0x3a9, 0xfff, 0xfff, 0xfff, 0x2fa, 0xfff, 0x128, 0x0d1, + 0x449, 0x255, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x258, 0xfff, 0xfff, 0xfff, + 0x532, 0xfff, 0xfff, 0xfff, 0x303, 0x517, 0xfff, 0xfff, + 0x2a9, 0x24a, 0xfff, 0xfff, 0x231, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x4b6, 0x516, 0xfff, 0xfff, 0x0e4, 0x0eb, + 0xfff, 0x4e4, 0xfff, 0x275, 0xfff, 0xfff, 0x031, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x025, 0x21a, 0xfff, 0x0cc, + 0x45f, 0x3d9, 0x289, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x23e, 0xfff, 0xfff, 0xfff, 0x438, 0x097, + 0x419, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x0a9, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x37e, 0x0e0, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x431, + 0x372, 0xfff, 0xfff, 0xfff, 0x1ba, 0x06e, 0xfff, 0x1b1, + 0xfff, 0xfff, 0x12a, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x193, 0xfff, 0xfff, 0xfff, 0xfff, 0x10a, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x048, 0x1b4, + 0xfff, 0xfff, 0xfff, 0xfff, 0x295, 0x140, 0x108, 0xfff, + 0xfff, 0xfff, 0xfff, 0x16f, 0xfff, 0x0a4, 0x37a, 0xfff, + 0x29a, 0xfff, 0x284, 0xfff, 0xfff, 0xfff, 0xfff, 0x4c6, + 0x2a2, 0x3a3, 0xfff, 0x201, 0xfff, 0xfff, 0xfff, 0x4bd, + 0x005, 0x54a, 0x3b5, 0x204, 0x2ee, 0x11d, 0x436, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x3ec, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x11f, 0x498, 0x21c, 0xfff, + 0xfff, 0xfff, 0x3d6, 0xfff, 0x4ab, 0xfff, 0x432, 0x2eb, + 0x542, 0x4fd, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x4ce, 0xfff, 0xfff, 0x2fb, 0xfff, + 0xfff, 0x2e1, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1b9, 0x037, 0x0dd, + 0xfff, 0xfff, 0xfff, 0x2bf, 0x521, 0x496, 0x095, 0xfff, + 0xfff, 0x328, 0x070, 0x1bf, 0xfff, 0x393, 0xfff, 0xfff, + 0x102, 0xfff, 0xfff, 0x21b, 0xfff, 0x142, 0x263, 0x519, + 0xfff, 0x2a5, 0x177, 0xfff, 0x14d, 0x471, 0x4ae, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x1f6, 0xfff, 0x481, 0xfff, 0xfff, 0xfff, 0x151, 0xfff, + 0xfff, 0xfff, 0x085, 0x33f, 0xfff, 0xfff, 0xfff, 0x084, + 0xfff, 0xfff, 0xfff, 0x345, 0x3a2, 0xfff, 0xfff, 0x0a0, + 0x0da, 0x024, 0xfff, 0xfff, 0xfff, 0x1bd, 0xfff, 0x55c, + 0x467, 0x445, 0xfff, 0xfff, 0xfff, 0x052, 0xfff, 0xfff, + 0xfff, 0xfff, 0x51e, 0xfff, 0xfff, 0x39d, 0xfff, 0x35f, + 0xfff, 0x376, 0x3ee, 0xfff, 0xfff, 0xfff, 0xfff, 0x448, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x16a, + 0xfff, 0x036, 0x38f, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x211, + 0xfff, 0xfff, 0xfff, 0x230, 0xfff, 0xfff, 0x3ba, 0xfff, + 0xfff, 0xfff, 0x3ce, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x229, 0xfff, 0x176, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x00b, 0xfff, 0x162, 0x018, 0xfff, + 0xfff, 0x233, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x400, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x12b, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x3f4, 0xfff, 0x0f0, 0xfff, 0x1ac, 0xfff, 0xfff, + 0x119, 0xfff, 0x2c0, 0xfff, 0xfff, 0xfff, 0x49b, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x23c, 0xfff, + 0x4b3, 0x010, 0x064, 0xfff, 0xfff, 0x4ba, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x3c2, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x006, 0x196, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x100, 0x191, 0xfff, + 0x1ea, 0x29f, 0xfff, 0xfff, 0xfff, 0x276, 0xfff, 0xfff, + 0x2b1, 0x3b9, 0xfff, 0x03c, 0xfff, 0xfff, 0xfff, 0x180, + 0xfff, 0x08f, 0xfff, 0xfff, 0x19e, 0x019, 0xfff, 0x0b0, + 0x0fd, 0x332, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x06b, 0x2e8, 0xfff, 0x446, 0xfff, 0xfff, 0x004, + 0x247, 0x197, 0xfff, 0x112, 0x169, 0x292, 0xfff, 0x302, + 0xfff, 0xfff, 0x33b, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x287, 0x21f, 0xfff, 0x3ea, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4e7, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x3a8, 0xfff, 0xfff, 0x2bc, 0xfff, + 0x484, 0x296, 0xfff, 0x1c9, 0x08c, 0x1e5, 0x48a, 0xfff, + 0x360, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x1ca, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x10d, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x066, 0x2ea, 0x28b, 0x25b, 0xfff, 0x072, + 0xfff, 0xfff, 0xfff, 0xfff, 0x2b6, 0xfff, 0xfff, 0x272, + 0xfff, 0xfff, 0x525, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x2ca, 0xfff, 0xfff, 0xfff, 0x299, 0xfff, 0xfff, 0xfff, + 0x558, 0x41a, 0xfff, 0x4f7, 0x557, 0xfff, 0x4a0, 0x344, + 0x12c, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x125, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x40e, 0xfff, 0xfff, 0x502, 0xfff, 0x103, 0x3e6, 0xfff, + 0x527, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x45d, 0xfff, 0xfff, 0xfff, 0xfff, + 0x44e, 0xfff, 0xfff, 0xfff, 0xfff, 0x0d2, 0x4c9, 0x35e, + 0x459, 0x2d9, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x17d, + 0x0c4, 0xfff, 0xfff, 0xfff, 0x3ac, 0x390, 0x094, 0xfff, + 0x483, 0x0ab, 0xfff, 0x253, 0xfff, 0x391, 0xfff, 0xfff, + 0xfff, 0xfff, 0x123, 0x0ef, 0xfff, 0xfff, 0xfff, 0x330, + 0x38c, 0xfff, 0xfff, 0x2ae, 0xfff, 0xfff, 0xfff, 0x042, + 0x012, 0x06d, 0xfff, 0xfff, 0xfff, 0x32a, 0x3db, 0x364, + 0x2dc, 0xfff, 0x30f, 0x3d7, 0x4a5, 0x050, 0xfff, 0xfff, + 0x029, 0xfff, 0xfff, 0xfff, 0xfff, 0x1d1, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x480, 0xfff, + 0x4ed, 0x081, 0x0a1, 0xfff, 0xfff, 0xfff, 0x30e, 0x52f, + 0x257, 0xfff, 0xfff, 0x447, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x401, 0x3cc, 0xfff, 0xfff, 0x0fb, + 0x2c9, 0x42a, 0x314, 0x33e, 0x3bd, 0x318, 0xfff, 0x10e, + 0x2a1, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x24c, + 0x506, 0xfff, 0x267, 0xfff, 0xfff, 0x219, 0xfff, 0x1eb, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x309, 0x3e2, 0x46c, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x384, 0xfff, 0xfff, 0xfff, 0xfff, 0x50c, 0xfff, 0x24b, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x038, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x194, + 0x143, 0x3e3, 0xfff, 0xfff, 0xfff, 0x4c2, 0xfff, 0xfff, + 0x0e1, 0x25c, 0xfff, 0x237, 0xfff, 0x1fe, 0xfff, 0xfff, + 0xfff, 0x065, 0x2a4, 0xfff, 0x386, 0x55a, 0x11b, 0xfff, + 0xfff, 0x192, 0xfff, 0x183, 0x00e, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x4b2, 0x18e, 0xfff, 0xfff, 0xfff, + 0xfff, 0x486, 0x4ef, 0x0c6, 0x380, 0xfff, 0x4a8, 0xfff, + 0x0c5, 0xfff, 0xfff, 0xfff, 0xfff, 0x093, 0x1b8, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x2e6, + 0xfff, 0x0f3, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x28e, 0xfff, 0x53b, 0x420, 0x22a, 0x33a, 0xfff, 0x387, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x2a3, 0xfff, 0xfff, + 0xfff, 0x428, 0x500, 0xfff, 0xfff, 0x120, 0x2c6, 0x290, + 0x2f5, 0x0e3, 0xfff, 0x0b7, 0xfff, 0x319, 0x474, 0xfff, + 0xfff, 0xfff, 0x529, 0x014, 0xfff, 0x41b, 0x40a, 0x18b, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x0d9, + 0xfff, 0x38a, 0xfff, 0xfff, 0xfff, 0xfff, 0x1ce, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x3b1, 0xfff, 0xfff, 0x05d, + 0x2c4, 0xfff, 0xfff, 0x4af, 0xfff, 0x030, 0xfff, 0xfff, + 0x203, 0xfff, 0x277, 0x256, 0xfff, 0xfff, 0xfff, 0x4f9, + 0xfff, 0x2c7, 0xfff, 0x466, 0x016, 0x1cd, 0xfff, 0x167, + 0xfff, 0xfff, 0x0c8, 0xfff, 0x43d, 0xfff, 0xfff, 0x020, + 0xfff, 0xfff, 0x232, 0x1cb, 0x1e0, 0xfff, 0xfff, 0x347, + 0xfff, 0x478, 0xfff, 0x365, 0xfff, 0xfff, 0xfff, 0xfff, + 0x358, 0xfff, 0x10b, 0xfff, 0x35d, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x452, 0x22d, 0xfff, 0xfff, 0x47d, 0xfff, + 0x2f3, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x460, 0xfff, + 0xfff, 0xfff, 0x50b, 0xfff, 0xfff, 0xfff, 0x2ec, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x4b1, 0x422, 0xfff, 0xfff, + 0xfff, 0x2d4, 0xfff, 0x239, 0xfff, 0xfff, 0xfff, 0x439, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x491, 0x075, 0xfff, 0xfff, 0xfff, 0x06c, 0xfff, + 0xfff, 0x0f9, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x139, 0xfff, 0x4f6, 0xfff, 0xfff, 0x409, 0xfff, + 0xfff, 0x15b, 0xfff, 0xfff, 0x348, 0xfff, 0xfff, 0xfff, + 0xfff, 0x4a2, 0x49d, 0xfff, 0x033, 0x175, 0xfff, 0x039, + 0xfff, 0x312, 0x40c, 0xfff, 0xfff, 0x325, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x4aa, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x165, 0x3bc, 0x48c, 0x310, 0x096, + 0xfff, 0xfff, 0x250, 0x1a2, 0xfff, 0xfff, 0xfff, 0xfff, + 0x20d, 0x2ac, 0xfff, 0xfff, 0x39b, 0xfff, 0x377, 0xfff, + 0x512, 0x495, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x357, 0x4ea, 0xfff, 0xfff, + 0xfff, 0xfff, 0x198, 0xfff, 0xfff, 0xfff, 0x434, 0x04a, + 0xfff, 0xfff, 0xfff, 0xfff, 0x062, 0xfff, 0x1d6, 0x1c8, + 0xfff, 0x1f3, 0x281, 0xfff, 0x462, 0xfff, 0xfff, 0xfff, + 0x4b0, 0xfff, 0x207, 0xfff, 0xfff, 0xfff, 0xfff, 0x3dd, + 0xfff, 0xfff, 0x55d, 0xfff, 0x552, 0x494, 0x1af, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x227, 0xfff, 0xfff, 0x069, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x43e, + 0x0b5, 0xfff, 0x524, 0x2d2, 0xfff, 0xfff, 0xfff, 0x28f, + 0xfff, 0x01b, 0x50e, 0xfff, 0xfff, 0x1bb, 0xfff, 0xfff, + 0x41d, 0xfff, 0x32e, 0x48e, 0xfff, 0x1f7, 0x224, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x394, 0xfff, 0xfff, 0xfff, + 0xfff, 0x52c, 0xfff, 0xfff, 0xfff, 0x392, 0xfff, 0x1e7, + 0xfff, 0xfff, 0x3f9, 0x3a7, 0xfff, 0x51f, 0xfff, 0x0bb, + 0x118, 0x3ca, 0xfff, 0x1dd, 0xfff, 0x48b, 0xfff, 0xfff, + 0xfff, 0xfff, 0x50f, 0xfff, 0x0d6, 0xfff, 0x1fa, 0xfff, + 0x11e, 0xfff, 0xfff, 0xfff, 0xfff, 0x4d7, 0xfff, 0x078, + 0x008, 0xfff, 0x25d, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x032, 0x33c, 0xfff, 0x4d9, 0x160, 0xfff, 0xfff, 0x300, + 0x0b1, 0xfff, 0x322, 0xfff, 0x4ec, 0xfff, 0xfff, 0x200, + 0x00c, 0x369, 0x473, 0xfff, 0xfff, 0x32c, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x53e, 0x3d4, 0x417, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x34b, 0x001, 0x39a, 0x02c, 0xfff, 0xfff, 0x2ce, 0x00f, + 0xfff, 0x0ba, 0xfff, 0xfff, 0xfff, 0xfff, 0x060, 0xfff, + 0x406, 0xfff, 0xfff, 0xfff, 0x4ee, 0x4ac, 0xfff, 0x43f, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x29b, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x216, + 0x190, 0xfff, 0x396, 0x464, 0xfff, 0xfff, 0x323, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x2e9, 0xfff, 0x26d, + 0x2cd, 0x040, 0xfff, 0xfff, 0xfff, 0xfff, 0x38b, 0x3c0, + 0xfff, 0xfff, 0xfff, 0x1f2, 0xfff, 0x0ea, 0xfff, 0xfff, + 0x472, 0xfff, 0x1fb, 0xfff, 0xfff, 0x0af, 0x27f, 0xfff, + 0xfff, 0xfff, 0x479, 0x023, 0xfff, 0x0d8, 0x3b3, 0xfff, + 0xfff, 0xfff, 0x121, 0xfff, 0xfff, 0x3bf, 0xfff, 0xfff, + 0x16b, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x45a, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x0be, 0xfff, 0xfff, 0xfff, 0x111, 0xfff, 0x220, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x09b, 0x218, 0xfff, 0x022, 0x202, 0xfff, + 0x4c8, 0xfff, 0x0ed, 0xfff, 0xfff, 0x182, 0xfff, 0xfff, + 0xfff, 0x17f, 0x213, 0xfff, 0x321, 0x36a, 0xfff, 0x086, + 0xfff, 0xfff, 0xfff, 0x43b, 0x088, 0xfff, 0xfff, 0xfff, + 0xfff, 0x26c, 0xfff, 0x2f8, 0x3b4, 0xfff, 0xfff, 0xfff, + 0x132, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x333, 0x444, + 0x0c1, 0x4d8, 0x46d, 0x264, 0xfff, 0xfff, 0xfff, 0xfff, + 0x426, 0xfff, 0xfff, 0xfff, 0xfff, 0x2fe, 0xfff, 0xfff, + 0xfff, 0xfff, 0x011, 0xfff, 0x05f, 0xfff, 0xfff, 0xfff, + 0xfff, 0x10c, 0x101, 0xfff, 0xfff, 0xfff, 0xfff, 0x110, + 0xfff, 0x044, 0x304, 0x361, 0x404, 0xfff, 0x51b, 0x099, + 0xfff, 0x440, 0xfff, 0xfff, 0xfff, 0x222, 0xfff, 0xfff, + 0xfff, 0xfff, 0x1b5, 0xfff, 0x136, 0x430, 0xfff, 0x1da, + 0xfff, 0xfff, 0xfff, 0x043, 0xfff, 0x17c, 0xfff, 0xfff, + 0xfff, 0x01c, 0xfff, 0xfff, 0xfff, 0x425, 0x236, 0xfff, + 0x317, 0xfff, 0xfff, 0x437, 0x3fc, 0xfff, 0x1f1, 0xfff, + 0x324, 0xfff, 0xfff, 0x0ca, 0x306, 0xfff, 0x548, 0xfff, + 0x46e, 0xfff, 0xfff, 0xfff, 0x4b8, 0x1c2, 0x286, 0xfff, + 0xfff, 0x087, 0x18a, 0x19f, 0xfff, 0xfff, 0xfff, 0xfff, + 0x18c, 0xfff, 0x215, 0xfff, 0xfff, 0xfff, 0xfff, 0x283, + 0xfff, 0xfff, 0xfff, 0x126, 0xfff, 0xfff, 0x370, 0xfff, + 0x53f, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x31c, 0xfff, + 0x4d1, 0xfff, 0xfff, 0xfff, 0x021, 0xfff, 0x157, 0xfff, + 0xfff, 0x028, 0x16e, 0xfff, 0x421, 0xfff, 0x1c6, 0xfff, + 0xfff, 0x511, 0xfff, 0xfff, 0x39c, 0x46f, 0x1b2, 0xfff, + 0xfff, 0x316, 0xfff, 0xfff, 0x009, 0xfff, 0xfff, 0x195, + 0xfff, 0x240, 0x546, 0xfff, 0xfff, 0x520, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x454, 0xfff, 0xfff, 0xfff, + 0x3f3, 0xfff, 0xfff, 0x187, 0xfff, 0x4a9, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x51c, 0x453, 0x1e6, 0xfff, + 0xfff, 0xfff, 0x1b0, 0xfff, 0x477, 0xfff, 0xfff, 0xfff, + 0x4fe, 0xfff, 0x32f, 0xfff, 0xfff, 0x15e, 0x1d4, 0xfff, + 0x0e5, 0xfff, 0xfff, 0xfff, 0x242, 0x14b, 0x046, 0xfff, + 0x3f6, 0x3bb, 0x3e4, 0xfff, 0xfff, 0x2e3, 0xfff, 0x245, + 0xfff, 0x149, 0xfff, 0xfff, 0xfff, 0x2db, 0xfff, 0xfff, + 0x181, 0xfff, 0x089, 0x2c5, 0xfff, 0x1f5, 0xfff, 0x2d6, + 0x507, 0xfff, 0x42d, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x080, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x3c3, 0x320, 0xfff, 0x1e1, + 0xfff, 0x0f5, 0x13b, 0xfff, 0xfff, 0xfff, 0x003, 0x4da, + 0xfff, 0xfff, 0xfff, 0x42c, 0xfff, 0xfff, 0x0cb, 0xfff, + 0x536, 0x2c3, 0xfff, 0xfff, 0xfff, 0xfff, 0x199, 0xfff, + 0xfff, 0x0c0, 0xfff, 0x01e, 0x497, 0xfff, 0xfff, 0x3e5, + 0xfff, 0xfff, 0xfff, 0x0cf, 0xfff, 0x2bd, 0xfff, 0x223, + 0xfff, 0x3ff, 0xfff, 0x058, 0x174, 0x3ef, 0xfff, 0x002 +}; + +static unsigned short err_pos(unsigned short din) +{ + BUG_ON(din > 4096); + BUG_ON(err_pos_lut[din] == 0xfff); + return err_pos_lut[din]; +} +static int chk_no_err_only(unsigned short *chk_syndrome_list, unsigned short *err_info) +{ + if ((chk_syndrome_list[0] | chk_syndrome_list[1] | + chk_syndrome_list[2] | chk_syndrome_list[3] | + chk_syndrome_list[4] | chk_syndrome_list[5] | + chk_syndrome_list[6] | chk_syndrome_list[7]) != 0x0) { + return -EINVAL; + } else { + err_info[0] = 0x0; + return 0; + } +} +static int chk_1_err_only(unsigned short *chk_syndrome_list, unsigned short *err_info) +{ + unsigned short tmp0, tmp1, tmp2, tmp3, tmp4, tmp5, tmp6; + tmp0 = gf4096_mul(chk_syndrome_list[1], gf4096_inv(chk_syndrome_list[0])); + tmp1 = gf4096_mul(chk_syndrome_list[2], gf4096_inv(chk_syndrome_list[1])); + tmp2 = gf4096_mul(chk_syndrome_list[3], gf4096_inv(chk_syndrome_list[2])); + tmp3 = gf4096_mul(chk_syndrome_list[4], gf4096_inv(chk_syndrome_list[3])); + tmp4 = gf4096_mul(chk_syndrome_list[5], gf4096_inv(chk_syndrome_list[4])); + tmp5 = gf4096_mul(chk_syndrome_list[6], gf4096_inv(chk_syndrome_list[5])); + tmp6 = gf4096_mul(chk_syndrome_list[7], gf4096_inv(chk_syndrome_list[6])); + if ((tmp0 == tmp1) & (tmp1 == tmp2) & (tmp2 == tmp3) & (tmp3 == tmp4) & (tmp4 == tmp5) & (tmp5 == tmp6)) { + err_info[0] = 0x1; // encode 1-symbol error as 0x1 + err_info[1] = err_pos(tmp0); + err_info[1] = (unsigned short)(0x55e - err_info[1]); + err_info[5] = chk_syndrome_list[0]; + return 0; + } else + return -EINVAL; +} +static int chk_2_err_only(unsigned short *chk_syndrome_list, unsigned short *err_info) +{ + unsigned short tmp0, tmp1, tmp2, tmp3, tmp4, tmp5, tmp6, tmp7; + unsigned short coefs[4]; + unsigned short err_pats[4]; + int found_num_root = 0; + unsigned short bit2_root0, bit2_root1; + unsigned short bit2_root0_inv, bit2_root1_inv; + unsigned short err_loc_eqn, test_root; + unsigned short bit2_loc0, bit2_loc1; + unsigned short bit2_pat0, bit2_pat1; + + find_2x2_soln(chk_syndrome_list[1], + chk_syndrome_list[0], + chk_syndrome_list[2], chk_syndrome_list[1], chk_syndrome_list[2], chk_syndrome_list[3], coefs); + for (test_root = 0x1; test_root < 0xfff; test_root++) { + err_loc_eqn = + gf4096_mul(coefs[1], gf4096_mul(test_root, test_root)) ^ gf4096_mul(coefs[0], test_root) ^ 0x1; + if (err_loc_eqn == 0x0) { + if (found_num_root == 0) { + bit2_root0 = test_root; + found_num_root = 1; + } else if (found_num_root == 1) { + bit2_root1 = test_root; + found_num_root = 2; + break; + } + } + } + if (found_num_root != 2) + return -EINVAL; + else { + bit2_root0_inv = gf4096_inv(bit2_root0); + bit2_root1_inv = gf4096_inv(bit2_root1); + find_2bit_err_pats(chk_syndrome_list[0], + chk_syndrome_list[1], bit2_root0_inv, bit2_root1_inv, err_pats); + bit2_pat0 = err_pats[0]; + bit2_pat1 = err_pats[1]; + //for(x+1) + tmp0 = gf4096_mul(gf4096_mul(bit2_root0_inv, bit2_root0_inv), gf4096_mul(bit2_root0_inv, bit2_root0_inv)); //rinv0^4 + tmp1 = gf4096_mul(bit2_root0_inv, tmp0); //rinv0^5 + tmp2 = gf4096_mul(bit2_root0_inv, tmp1); //rinv0^6 + tmp3 = gf4096_mul(bit2_root0_inv, tmp2); //rinv0^7 + tmp4 = gf4096_mul(gf4096_mul(bit2_root1_inv, bit2_root1_inv), gf4096_mul(bit2_root1_inv, bit2_root1_inv)); //rinv1^4 + tmp5 = gf4096_mul(bit2_root1_inv, tmp4); //rinv1^5 + tmp6 = gf4096_mul(bit2_root1_inv, tmp5); //rinv1^6 + tmp7 = gf4096_mul(bit2_root1_inv, tmp6); //rinv1^7 + //check if only 2-bit error + if ((chk_syndrome_list[4] == + (gf4096_mul(bit2_pat0, tmp0) ^ + gf4096_mul(bit2_pat1, + tmp4))) & (chk_syndrome_list[5] == + (gf4096_mul(bit2_pat0, tmp1) ^ + gf4096_mul(bit2_pat1, + tmp5))) & + (chk_syndrome_list[6] == + (gf4096_mul(bit2_pat0, tmp2) ^ + gf4096_mul(bit2_pat1, + tmp6))) & (chk_syndrome_list[7] == + (gf4096_mul(bit2_pat0, tmp3) ^ gf4096_mul(bit2_pat1, tmp7)))) { + if ((err_pos(bit2_root0_inv) == 0xfff) | (err_pos(bit2_root1_inv) == 0xfff)) { + return -EINVAL; + } else { + bit2_loc0 = 0x55e - err_pos(bit2_root0_inv); + bit2_loc1 = 0x55e - err_pos(bit2_root1_inv); + err_info[0] = 0x2; // encode 2-symbol error as 0x2 + err_info[1] = bit2_loc0; + err_info[2] = bit2_loc1; + err_info[5] = bit2_pat0; + err_info[6] = bit2_pat1; + return 0; + } + } else + return -EINVAL; + } +} +static int chk_3_err_only(unsigned short *chk_syndrome_list, unsigned short *err_info) +{ + unsigned short tmp0, tmp1, tmp2, tmp3, tmp4, tmp5; + unsigned short coefs[4]; + unsigned short err_pats[4]; + int found_num_root = 0; + unsigned short bit3_root0, bit3_root1, bit3_root2; + unsigned short bit3_root0_inv, bit3_root1_inv, bit3_root2_inv; + unsigned short err_loc_eqn, test_root; + + find_3bit_err_coefs(chk_syndrome_list[0], chk_syndrome_list[1], + chk_syndrome_list[2], chk_syndrome_list[3], + chk_syndrome_list[4], chk_syndrome_list[5], coefs); + + for (test_root = 0x1; test_root < 0xfff; test_root++) { + err_loc_eqn = gf4096_mul(coefs[2], + gf4096_mul(gf4096_mul(test_root, test_root), + test_root)) ^ gf4096_mul(coefs[1], gf4096_mul(test_root, test_root)) + ^ gf4096_mul(coefs[0], test_root) ^ 0x1; + + if (err_loc_eqn == 0x0) { + if (found_num_root == 0) { + bit3_root0 = test_root; + found_num_root = 1; + } else if (found_num_root == 1) { + bit3_root1 = test_root; + found_num_root = 2; + } else if (found_num_root == 2) { + bit3_root2 = test_root; + found_num_root = 3; + break; + } + } + } + if (found_num_root != 3) + return -EINVAL; + else { + bit3_root0_inv = gf4096_inv(bit3_root0); + bit3_root1_inv = gf4096_inv(bit3_root1); + bit3_root2_inv = gf4096_inv(bit3_root2); + + find_3bit_err_pats(chk_syndrome_list[0], chk_syndrome_list[1], + chk_syndrome_list[2], bit3_root0_inv, + bit3_root1_inv, bit3_root2_inv, err_pats); + + //check if only 3-bit error + tmp0 = gf4096_mul(bit3_root0_inv, bit3_root0_inv); + tmp0 = gf4096_mul(tmp0, tmp0); + tmp0 = gf4096_mul(tmp0, bit3_root0_inv); + tmp0 = gf4096_mul(tmp0, bit3_root0_inv); //rinv0^6 + tmp1 = gf4096_mul(tmp0, bit3_root0_inv); //rinv0^7 + tmp2 = gf4096_mul(bit3_root1_inv, bit3_root1_inv); + tmp2 = gf4096_mul(tmp2, tmp2); + tmp2 = gf4096_mul(tmp2, bit3_root1_inv); + tmp2 = gf4096_mul(tmp2, bit3_root1_inv); //rinv1^6 + tmp3 = gf4096_mul(tmp2, bit3_root1_inv); //rinv1^7 + tmp4 = gf4096_mul(bit3_root2_inv, bit3_root2_inv); + tmp4 = gf4096_mul(tmp4, tmp4); + tmp4 = gf4096_mul(tmp4, bit3_root2_inv); + tmp4 = gf4096_mul(tmp4, bit3_root2_inv); //rinv2^6 + tmp5 = gf4096_mul(tmp4, bit3_root2_inv); //rinv2^7 + + //check if only 3 errors + if ((chk_syndrome_list[6] == (gf4096_mul(err_pats[0], tmp0) ^ + gf4096_mul(err_pats[1], tmp2) ^ + gf4096_mul(err_pats[2], tmp4))) & + (chk_syndrome_list[7] == (gf4096_mul(err_pats[0], tmp1) ^ + gf4096_mul(err_pats[1], tmp3) ^ gf4096_mul(err_pats[2], tmp5)))) { + if ((err_pos(bit3_root0_inv) == 0xfff) | + (err_pos(bit3_root1_inv) == 0xfff) | (err_pos(bit3_root2_inv) == 0xfff)) { + return -EINVAL; + } else { + err_info[0] = 0x3; + err_info[1] = (0x55e - err_pos(bit3_root0_inv)); + err_info[2] = (0x55e - err_pos(bit3_root1_inv)); + err_info[3] = (0x55e - err_pos(bit3_root2_inv)); + err_info[5] = err_pats[0]; + err_info[6] = err_pats[1]; + err_info[7] = err_pats[2]; + return 0; + } + } else + return -EINVAL; + } +} +static int chk_4_err_only(unsigned short *chk_syndrome_list, unsigned short *err_info) +{ + unsigned short coefs[4]; + unsigned short err_pats[4]; + int found_num_root = 0; + unsigned short bit4_root0, bit4_root1, bit4_root2, bit4_root3; + unsigned short bit4_root0_inv, bit4_root1_inv, bit4_root2_inv, bit4_root3_inv; + unsigned short err_loc_eqn, test_root; + + find_4bit_err_coefs(chk_syndrome_list[0], + chk_syndrome_list[1], + chk_syndrome_list[2], + chk_syndrome_list[3], + chk_syndrome_list[4], + chk_syndrome_list[5], chk_syndrome_list[6], chk_syndrome_list[7], coefs); + + for (test_root = 0x1; test_root < 0xfff; test_root++) { + err_loc_eqn = + gf4096_mul(coefs[3], + gf4096_mul(gf4096_mul + (gf4096_mul(test_root, test_root), + test_root), + test_root)) ^ gf4096_mul(coefs[2], + gf4096_mul + (gf4096_mul(test_root, test_root), test_root)) + ^ gf4096_mul(coefs[1], gf4096_mul(test_root, test_root)) ^ gf4096_mul(coefs[0], test_root) + ^ 0x1; + if (err_loc_eqn == 0x0) { + if (found_num_root == 0) { + bit4_root0 = test_root; + found_num_root = 1; + } else if (found_num_root == 1) { + bit4_root1 = test_root; + found_num_root = 2; + } else if (found_num_root == 2) { + bit4_root2 = test_root; + found_num_root = 3; + } else { + found_num_root = 4; + bit4_root3 = test_root; + break; + } + } + } + if (found_num_root != 4) { + return -EINVAL; + } else { + bit4_root0_inv = gf4096_inv(bit4_root0); + bit4_root1_inv = gf4096_inv(bit4_root1); + bit4_root2_inv = gf4096_inv(bit4_root2); + bit4_root3_inv = gf4096_inv(bit4_root3); + find_4bit_err_pats(chk_syndrome_list[0], + chk_syndrome_list[1], + chk_syndrome_list[2], + chk_syndrome_list[3], + bit4_root0_inv, bit4_root1_inv, bit4_root2_inv, bit4_root3_inv, err_pats); + err_info[0] = 0x4; + err_info[1] = (0x55e - err_pos(bit4_root0_inv)); + err_info[2] = (0x55e - err_pos(bit4_root1_inv)); + err_info[3] = (0x55e - err_pos(bit4_root2_inv)); + err_info[4] = (0x55e - err_pos(bit4_root3_inv)); + err_info[5] = err_pats[0]; + err_info[6] = err_pats[1]; + err_info[7] = err_pats[2]; + err_info[8] = err_pats[3]; + return 0; + } +} + +void correct_12bit_symbol(unsigned char *buf, unsigned short sym, + unsigned short val) +{ + if (unlikely(sym > 1366)) { + printk(KERN_ERR "Error: symbol %d out of range; cannot correct\n", sym); + } else if (sym == 0) { + buf[0] ^= val; + } else if (sym & 1) { + buf[1+(3*(sym-1))/2] ^= (val >> 4); + buf[2+(3*(sym-1))/2] ^= ((val & 0xf) << 4); + } else { + buf[2+(3*(sym-2))/2] ^= (val >> 8); + buf[3+(3*(sym-2))/2] ^= (val & 0xff); + } + + +} + +int cafe_correct_ecc(unsigned char *buf, + unsigned short *chk_syndrome_list) +{ + unsigned short err_info[9]; + int i; + + if (chk_no_err_only(chk_syndrome_list, err_info) && + chk_1_err_only(chk_syndrome_list, err_info) && + chk_2_err_only(chk_syndrome_list, err_info) && + chk_3_err_only(chk_syndrome_list, err_info) && + chk_4_err_only(chk_syndrome_list, err_info)) { + return -EIO; + } + + for (i=0; i < err_info[0]; i++) + correct_12bit_symbol(buf, err_info[1+i], err_info[5+i]); + + return err_info[0]; +} + diff --git a/drivers/mtd/nand/cafe_nand.c b/drivers/mtd/nand/cafe_nand.c deleted file mode 100644 index 60cb019b140..00000000000 --- a/drivers/mtd/nand/cafe_nand.c +++ /dev/null @@ -1,698 +0,0 @@ -/* - * cafe_nand.c - * - * Copyright © 2006 Red Hat, Inc. - * Copyright © 2006 David Woodhouse - */ - -#define DEBUG - -#include -#undef DEBUG -#include -#include -#include -#include -#include -#include - -#define CAFE_NAND_CTRL1 0x00 -#define CAFE_NAND_CTRL2 0x04 -#define CAFE_NAND_CTRL3 0x08 -#define CAFE_NAND_STATUS 0x0c -#define CAFE_NAND_IRQ 0x10 -#define CAFE_NAND_IRQ_MASK 0x14 -#define CAFE_NAND_DATA_LEN 0x18 -#define CAFE_NAND_ADDR1 0x1c -#define CAFE_NAND_ADDR2 0x20 -#define CAFE_NAND_TIMING1 0x24 -#define CAFE_NAND_TIMING2 0x28 -#define CAFE_NAND_TIMING3 0x2c -#define CAFE_NAND_NONMEM 0x30 -#define CAFE_NAND_DMA_CTRL 0x40 -#define CAFE_NAND_DMA_ADDR0 0x44 -#define CAFE_NAND_DMA_ADDR1 0x48 -#define CAFE_NAND_READ_DATA 0x1000 -#define CAFE_NAND_WRITE_DATA 0x2000 - -struct cafe_priv { - struct nand_chip nand; - struct pci_dev *pdev; - void __iomem *mmio; - uint32_t ctl1; - uint32_t ctl2; - int datalen; - int nr_data; - int data_pos; - int page_addr; - dma_addr_t dmaaddr; - unsigned char *dmabuf; - -}; - -static int usedma = 1; -module_param(usedma, int, 0644); - -static int skipbbt = 0; -module_param(skipbbt, int, 0644); - -static int debug = 0; -module_param(debug, int, 0644); - -#define cafe_dev_dbg(dev, args...) do { if (debug) dev_dbg(dev, ##args); } while(0) - - -static int cafe_device_ready(struct mtd_info *mtd) -{ - struct cafe_priv *cafe = mtd->priv; - int result = !!(readl(cafe->mmio + CAFE_NAND_STATUS) | 0x40000000); - - uint32_t irqs = readl(cafe->mmio + CAFE_NAND_IRQ); - writel(irqs, cafe->mmio+CAFE_NAND_IRQ); - cafe_dev_dbg(&cafe->pdev->dev, "NAND device is%s ready, IRQ %x (%x) (%x,%x)\n", - result?"":" not", irqs, readl(cafe->mmio + CAFE_NAND_IRQ), - readl(cafe->mmio + 0x3008), readl(cafe->mmio + 0x300c)); - return result; -} - - -static void cafe_write_buf(struct mtd_info *mtd, const uint8_t *buf, int len) -{ - struct cafe_priv *cafe = mtd->priv; - - if (usedma) - memcpy(cafe->dmabuf + cafe->datalen, buf, len); - else - memcpy_toio(cafe->mmio + CAFE_NAND_WRITE_DATA + cafe->datalen, buf, len); - cafe->datalen += len; - - cafe_dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes to write buffer. datalen 0x%x\n", - len, cafe->datalen); -} - -static void cafe_read_buf(struct mtd_info *mtd, uint8_t *buf, int len) -{ - struct cafe_priv *cafe = mtd->priv; - - if (usedma) - memcpy(buf, cafe->dmabuf + cafe->datalen, len); - else - memcpy_fromio(buf, cafe->mmio + CAFE_NAND_READ_DATA + cafe->datalen, len); - - cafe_dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes from position 0x%x in read buffer.\n", - len, cafe->datalen); - cafe->datalen += len; -} - -static uint8_t cafe_read_byte(struct mtd_info *mtd) -{ - struct cafe_priv *cafe = mtd->priv; - uint8_t d; - - cafe_read_buf(mtd, &d, 1); - cafe_dev_dbg(&cafe->pdev->dev, "Read %02x\n", d); - - return d; -} - -static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, - int column, int page_addr) -{ - struct cafe_priv *cafe = mtd->priv; - int adrbytes = 0; - uint32_t ctl1; - uint32_t doneint = 0x80000000; - int i; - - cafe_dev_dbg(&cafe->pdev->dev, "cmdfunc %02x, 0x%x, 0x%x\n", - command, column, page_addr); - - if (command == NAND_CMD_ERASE2 || command == NAND_CMD_PAGEPROG) { - /* Second half of a command we already calculated */ - writel(cafe->ctl2 | 0x100 | command, cafe->mmio + 0x04); - ctl1 = cafe->ctl1; - cafe_dev_dbg(&cafe->pdev->dev, "Continue command, ctl1 %08x, #data %d\n", - cafe->ctl1, cafe->nr_data); - goto do_command; - } - /* Reset ECC engine */ - writel(0, cafe->mmio + CAFE_NAND_CTRL2); - - /* Emulate NAND_CMD_READOOB on large-page chips */ - if (mtd->writesize > 512 && - command == NAND_CMD_READOOB) { - column += mtd->writesize; - command = NAND_CMD_READ0; - } - - /* FIXME: Do we need to send read command before sending data - for small-page chips, to position the buffer correctly? */ - - if (column != -1) { - writel(column, cafe->mmio + 0x1c); - adrbytes = 2; - if (page_addr != -1) - goto write_adr2; - } else if (page_addr != -1) { - writel(page_addr & 0xffff, cafe->mmio + 0x1c); - page_addr >>= 16; - write_adr2: - writel(page_addr, cafe->mmio+0x20); - adrbytes += 2; - if (mtd->size > mtd->writesize << 16) - adrbytes++; - } - - cafe->data_pos = cafe->datalen = 0; - - /* Set command valid bit */ - ctl1 = 0x80000000 | command; - - /* Set RD or WR bits as appropriate */ - if (command == NAND_CMD_READID || command == NAND_CMD_STATUS) { - ctl1 |= (1<<26); /* rd */ - /* Always 5 bytes, for now */ - cafe->datalen = 4; - /* And one address cycle -- even for STATUS, since the controller doesn't work without */ - adrbytes = 1; - } else if (command == NAND_CMD_READ0 || command == NAND_CMD_READ1 || - command == NAND_CMD_READOOB || command == NAND_CMD_RNDOUT) { - ctl1 |= 1<<26; /* rd */ - /* For now, assume just read to end of page */ - cafe->datalen = mtd->writesize + mtd->oobsize - column; - } else if (command == NAND_CMD_SEQIN) - ctl1 |= 1<<25; /* wr */ - - /* Set number of address bytes */ - if (adrbytes) - ctl1 |= ((adrbytes-1)|8) << 27; - - if (command == NAND_CMD_SEQIN || command == NAND_CMD_ERASE1) { - /* Ignore the first command of a pair; the hardware - deals with them both at once, later */ - cafe->ctl1 = ctl1; - cafe->ctl2 = 0; - cafe_dev_dbg(&cafe->pdev->dev, "Setup for delayed command, ctl1 %08x, dlen %x\n", - cafe->ctl1, cafe->datalen); - return; - } - /* RNDOUT and READ0 commands need a following byte */ - if (command == NAND_CMD_RNDOUT) - writel(cafe->ctl2 | 0x100 | NAND_CMD_RNDOUTSTART, cafe->mmio + CAFE_NAND_CTRL2); - else if (command == NAND_CMD_READ0 && mtd->writesize > 512) - writel(cafe->ctl2 | 0x100 | NAND_CMD_READSTART, cafe->mmio + CAFE_NAND_CTRL2); - - do_command: - // ECC on read only works if we ... - // if (cafe->datalen == 2112) - // cafe->datalen = 2062; - cafe_dev_dbg(&cafe->pdev->dev, "dlen %x, ctl1 %x, ctl2 %x\n", - cafe->datalen, ctl1, readl(cafe->mmio+CAFE_NAND_CTRL2)); - /* NB: The datasheet lies -- we really should be subtracting 1 here */ - writel(cafe->datalen, cafe->mmio + CAFE_NAND_DATA_LEN); - writel(0x90000000, cafe->mmio + CAFE_NAND_IRQ); - if (usedma && (ctl1 & (3<<25))) { - uint32_t dmactl = 0xc0000000 + cafe->datalen; - /* If WR or RD bits set, set up DMA */ - if (ctl1 & (1<<26)) { - /* It's a read */ - dmactl |= (1<<29); - /* ... so it's done when the DMA is done, not just - the command. */ - doneint = 0x10000000; - } - writel(dmactl, cafe->mmio + 0x40); - } -#if 0 - printk("DMA setup is %x, status %x, ctl1 %x\n", readl(cafe->mmio + 0x40), readl(cafe->mmio + 0x0c), readl(cafe->mmio)); - printk("DMA setup is %x, status %x, ctl1 %x\n", readl(cafe->mmio + 0x40), readl(cafe->mmio + 0x0c), readl(cafe->mmio)); -#endif - cafe->datalen = 0; - -#if 0 - printk("About to write command %08x\n", ctl1); - for (i=0; i< 0x5c; i+=4) - printk("Register %x: %08x\n", i, readl(cafe->mmio + i)); -#endif - writel(ctl1, cafe->mmio + CAFE_NAND_CTRL1); - /* Apply this short delay always to ensure that we do wait tWB in - * any case on any machine. */ - ndelay(100); - - if (1) { - int c = 500000; - uint32_t irqs; - - while (c--) { - irqs = readl(cafe->mmio + CAFE_NAND_IRQ); - if (irqs & doneint) - break; - udelay(1); - if (!(c % 100000)) - cafe_dev_dbg(&cafe->pdev->dev, "Wait for ready, IRQ %x\n", irqs); - cpu_relax(); - } - writel(doneint, cafe->mmio + CAFE_NAND_IRQ); - cafe_dev_dbg(&cafe->pdev->dev, "Command %x completed after %d usec, irqs %x (%x)\n", command, 50000-c, irqs, readl(cafe->mmio + CAFE_NAND_IRQ)); - } - - - cafe->ctl2 &= ~(1<<8); - cafe->ctl2 &= ~(1<<30); - - switch (command) { - - case NAND_CMD_CACHEDPROG: - case NAND_CMD_PAGEPROG: - case NAND_CMD_ERASE1: - case NAND_CMD_ERASE2: - case NAND_CMD_SEQIN: - case NAND_CMD_RNDIN: - case NAND_CMD_STATUS: - case NAND_CMD_DEPLETE1: - case NAND_CMD_RNDOUT: - case NAND_CMD_STATUS_ERROR: - case NAND_CMD_STATUS_ERROR0: - case NAND_CMD_STATUS_ERROR1: - case NAND_CMD_STATUS_ERROR2: - case NAND_CMD_STATUS_ERROR3: - writel(cafe->ctl2, cafe->mmio + CAFE_NAND_CTRL2); - return; - } - nand_wait_ready(mtd); - writel(cafe->ctl2, cafe->mmio + CAFE_NAND_CTRL2); -} - -static void cafe_select_chip(struct mtd_info *mtd, int chipnr) -{ - //struct cafe_priv *cafe = mtd->priv; - // cafe_dev_dbg(&cafe->pdev->dev, "select_chip %d\n", chipnr); -} -static int cafe_nand_interrupt(int irq, void *id, struct pt_regs *regs) -{ - struct mtd_info *mtd = id; - struct cafe_priv *cafe = mtd->priv; - uint32_t irqs = readl(cafe->mmio + CAFE_NAND_IRQ); - writel(irqs & ~0x90000000, cafe->mmio + CAFE_NAND_IRQ); - if (!irqs) - return IRQ_NONE; - - cafe_dev_dbg(&cafe->pdev->dev, "irq, bits %x (%x)\n", irqs, readl(cafe->mmio + CAFE_NAND_IRQ)); - return IRQ_HANDLED; -} - -static void cafe_nand_bug(struct mtd_info *mtd) -{ - BUG(); -} - -static int cafe_nand_write_oob(struct mtd_info *mtd, - struct nand_chip *chip, int page) -{ - int status = 0; - - WARN_ON(chip->oob_poi != chip->buffers->oobwbuf); - - chip->cmdfunc(mtd, NAND_CMD_SEQIN, mtd->writesize, page); - chip->write_buf(mtd, chip->oob_poi, mtd->oobsize); - chip->cmdfunc(mtd, NAND_CMD_PAGEPROG, -1, -1); - status = chip->waitfunc(mtd, chip); - - return status & NAND_STATUS_FAIL ? -EIO : 0; -} - -/* Don't use -- use nand_read_oob_std for now */ -static int cafe_nand_read_oob(struct mtd_info *mtd, struct nand_chip *chip, - int page, int sndcmd) -{ - chip->cmdfunc(mtd, NAND_CMD_READOOB, 0, page); - chip->read_buf(mtd, chip->oob_poi, mtd->oobsize); - return 1; -} -/** - * cafe_nand_read_page_syndrome - {REPLACABLE] hardware ecc syndrom based page read - * @mtd: mtd info structure - * @chip: nand chip info structure - * @buf: buffer to store read data - * - * The hw generator calculates the error syndrome automatically. Therefor - * we need a special oob layout and handling. - */ -static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, - uint8_t *buf) -{ - struct cafe_priv *cafe = mtd->priv; - - WARN_ON(chip->oob_poi != chip->buffers->oobrbuf); - - cafe_dev_dbg(&cafe->pdev->dev, "ECC result %08x SYN1,2 %08x\n", readl(cafe->mmio + 0x3c), readl(cafe->mmio + 0x50)); - - chip->read_buf(mtd, buf, mtd->writesize); - chip->read_buf(mtd, chip->oob_poi, mtd->oobsize); - - return 0; -} - -static struct nand_ecclayout cafe_oobinfo_2048 = { - .eccbytes = 14, - .eccpos = { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13}, - .oobfree = {{14, 50}} -}; - -/* Ick. The BBT code really ought to be able to work this bit out - for itself from the above */ -static uint8_t cafe_bbt_pattern[] = {'B', 'b', 't', '0' }; -static uint8_t cafe_mirror_pattern[] = {'1', 't', 'b', 'B' }; - -static struct nand_bbt_descr cafe_bbt_main_descr_2048 = { - .options = NAND_BBT_LASTBLOCK | NAND_BBT_CREATE | NAND_BBT_WRITE - | NAND_BBT_2BIT | NAND_BBT_VERSION | NAND_BBT_PERCHIP, - .offs = 14, - .len = 4, - .veroffs = 18, - .maxblocks = 4, - .pattern = cafe_bbt_pattern -}; - -static struct nand_bbt_descr cafe_bbt_mirror_descr_2048 = { - .options = NAND_BBT_LASTBLOCK | NAND_BBT_CREATE | NAND_BBT_WRITE - | NAND_BBT_2BIT | NAND_BBT_VERSION | NAND_BBT_PERCHIP, - .offs = 14, - .len = 4, - .veroffs = 18, - .maxblocks = 4, - .pattern = cafe_mirror_pattern -}; - -static struct nand_ecclayout cafe_oobinfo_512 = { - .eccbytes = 14, - .eccpos = { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13}, - .oobfree = {{14, 2}} -}; - - -static void cafe_nand_write_page_lowlevel(struct mtd_info *mtd, - struct nand_chip *chip, const uint8_t *buf) -{ - struct cafe_priv *cafe = mtd->priv; - - WARN_ON(chip->oob_poi != chip->buffers->oobwbuf); - - chip->write_buf(mtd, buf, mtd->writesize); - chip->write_buf(mtd, chip->oob_poi, mtd->oobsize); - - /* Set up ECC autogeneration */ - cafe->ctl2 |= (1<<27) | (1<<30); - if (mtd->writesize == 2048) - cafe->ctl2 |= (1<<29); -} - -static int cafe_nand_write_page(struct mtd_info *mtd, struct nand_chip *chip, - const uint8_t *buf, int page, int cached, int raw) -{ - int status; - - WARN_ON(chip->oob_poi != chip->buffers->oobwbuf); - - chip->cmdfunc(mtd, NAND_CMD_SEQIN, 0x00, page); - - if (unlikely(raw)) - chip->ecc.write_page_raw(mtd, chip, buf); - else - chip->ecc.write_page(mtd, chip, buf); - - /* - * Cached progamming disabled for now, Not sure if its worth the - * trouble. The speed gain is not very impressive. (2.3->2.6Mib/s) - */ - cached = 0; - - if (!cached || !(chip->options & NAND_CACHEPRG)) { - - chip->cmdfunc(mtd, NAND_CMD_PAGEPROG, -1, -1); - status = chip->waitfunc(mtd, chip); - /* - * See if operation failed and additional status checks are - * available - */ - if ((status & NAND_STATUS_FAIL) && (chip->errstat)) - status = chip->errstat(mtd, chip, FL_WRITING, status, - page); - - if (status & NAND_STATUS_FAIL) - return -EIO; - } else { - chip->cmdfunc(mtd, NAND_CMD_CACHEDPROG, -1, -1); - status = chip->waitfunc(mtd, chip); - } - -#ifdef CONFIG_MTD_NAND_VERIFY_WRITE - /* Send command to read back the data */ - chip->cmdfunc(mtd, NAND_CMD_READ0, 0, page); - - if (chip->verify_buf(mtd, buf, mtd->writesize)) - return -EIO; -#endif - return 0; -} - -static int cafe_nand_block_bad(struct mtd_info *mtd, loff_t ofs, int getchip) -{ - return 0; -} - -static int __devinit cafe_nand_probe(struct pci_dev *pdev, - const struct pci_device_id *ent) -{ - struct mtd_info *mtd; - struct cafe_priv *cafe; - uint32_t ctrl; - int err = 0; - - err = pci_enable_device(pdev); - if (err) - return err; - - pci_set_master(pdev); - - mtd = kzalloc(sizeof(*mtd) + sizeof(struct cafe_priv), GFP_KERNEL); - if (!mtd) { - dev_warn(&pdev->dev, "failed to alloc mtd_info\n"); - return -ENOMEM; - } - cafe = (void *)(&mtd[1]); - - mtd->priv = cafe; - mtd->owner = THIS_MODULE; - - cafe->pdev = pdev; - cafe->mmio = pci_iomap(pdev, 0, 0); - if (!cafe->mmio) { - dev_warn(&pdev->dev, "failed to iomap\n"); - err = -ENOMEM; - goto out_free_mtd; - } - cafe->dmabuf = dma_alloc_coherent(&cafe->pdev->dev, 2112 + sizeof(struct nand_buffers), - &cafe->dmaaddr, GFP_KERNEL); - if (!cafe->dmabuf) { - err = -ENOMEM; - goto out_ior; - } - cafe->nand.buffers = (void *)cafe->dmabuf + 2112; - - cafe->nand.cmdfunc = cafe_nand_cmdfunc; - cafe->nand.dev_ready = cafe_device_ready; - cafe->nand.read_byte = cafe_read_byte; - cafe->nand.read_buf = cafe_read_buf; - cafe->nand.write_buf = cafe_write_buf; - cafe->nand.select_chip = cafe_select_chip; - - cafe->nand.chip_delay = 0; - - /* Enable the following for a flash based bad block table */ - cafe->nand.options = NAND_USE_FLASH_BBT | NAND_NO_AUTOINCR | NAND_OWN_BUFFERS; - - if (skipbbt) { - cafe->nand.options |= NAND_SKIP_BBTSCAN; - cafe->nand.block_bad = cafe_nand_block_bad; - } - - /* Timings from Marvell's test code (not verified or calculated by us) */ - writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); -#if 1 - writel(0x01010a0a, cafe->mmio + CAFE_NAND_TIMING1); - writel(0x24121212, cafe->mmio + CAFE_NAND_TIMING2); - writel(0x11000000, cafe->mmio + CAFE_NAND_TIMING3); -#else - writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING1); - writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING2); - writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING3); -#endif - writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); - err = request_irq(pdev->irq, &cafe_nand_interrupt, SA_SHIRQ, "CAFE NAND", mtd); - if (err) { - dev_warn(&pdev->dev, "Could not register IRQ %d\n", pdev->irq); - - goto out_free_dma; - } -#if 1 - /* Disable master reset, enable NAND clock */ - ctrl = readl(cafe->mmio + 0x3004); - ctrl &= 0xffffeff0; - ctrl |= 0x00007000; - writel(ctrl | 0x05, cafe->mmio + 0x3004); - writel(ctrl | 0x0a, cafe->mmio + 0x3004); - writel(0, cafe->mmio + 0x40); - - writel(0x7006, cafe->mmio + 0x3004); - writel(0x700a, cafe->mmio + 0x3004); - - /* Set up DMA address */ - writel(cafe->dmaaddr & 0xffffffff, cafe->mmio + 0x44); - if (sizeof(cafe->dmaaddr) > 4) - writel((cafe->dmaaddr >> 16) >> 16, cafe->mmio + 0x48); - else - writel(0, cafe->mmio + 0x48); - cafe_dev_dbg(&cafe->pdev->dev, "Set DMA address to %x (virt %p)\n", - readl(cafe->mmio+0x44), cafe->dmabuf); - - /* Enable NAND IRQ in global IRQ mask register */ - writel(0x80000007, cafe->mmio + 0x300c); - cafe_dev_dbg(&cafe->pdev->dev, "Control %x, IRQ mask %x\n", - readl(cafe->mmio + 0x3004), readl(cafe->mmio + 0x300c)); -#endif -#if 1 - mtd->writesize=2048; - mtd->oobsize = 0x40; - memset(cafe->dmabuf, 0x5a, 2112); - cafe->nand.cmdfunc(mtd, NAND_CMD_READID, 0, -1); - cafe->nand.read_byte(mtd); - cafe->nand.read_byte(mtd); - cafe->nand.read_byte(mtd); - cafe->nand.read_byte(mtd); - cafe->nand.read_byte(mtd); -#endif -#if 0 - cafe->nand.cmdfunc(mtd, NAND_CMD_READ0, 0, 0); - // nand_wait_ready(mtd); - cafe->nand.read_byte(mtd); - cafe->nand.read_byte(mtd); - cafe->nand.read_byte(mtd); - cafe->nand.read_byte(mtd); -#endif -#if 0 - writel(0x84600070, cafe->mmio); - udelay(10); - cafe_dev_dbg(&cafe->pdev->dev, "Status %x\n", readl(cafe->mmio + 0x30)); -#endif - /* Scan to find existance of the device */ - if (nand_scan_ident(mtd, 1)) { - err = -ENXIO; - goto out_irq; - } - - cafe->ctl2 = 1<<27; /* Reed-Solomon ECC */ - if (mtd->writesize == 2048) - cafe->ctl2 |= 1<<29; /* 2KiB page size */ - - /* Set up ECC according to the type of chip we found */ - if (mtd->writesize == 512 || mtd->writesize == 2048) { - cafe->nand.ecc.mode = NAND_ECC_HW_SYNDROME; - cafe->nand.ecc.size = mtd->writesize; - cafe->nand.ecc.bytes = 14; - cafe->nand.ecc.layout = &cafe_oobinfo_2048; - cafe->nand.bbt_td = &cafe_bbt_main_descr_2048; - cafe->nand.bbt_md = &cafe_bbt_mirror_descr_2048; - cafe->nand.ecc.hwctl = (void *)cafe_nand_bug; - cafe->nand.ecc.calculate = (void *)cafe_nand_bug; - cafe->nand.ecc.correct = (void *)cafe_nand_bug; - cafe->nand.write_page = cafe_nand_write_page; - cafe->nand.ecc.write_page = cafe_nand_write_page_lowlevel; - cafe->nand.ecc.write_oob = cafe_nand_write_oob; - cafe->nand.ecc.read_page = cafe_nand_read_page; - cafe->nand.ecc.read_oob = cafe_nand_read_oob; - - } else { - printk(KERN_WARNING "Unexpected NAND flash writesize %d. Using software ECC\n", - mtd->writesize); - cafe->nand.ecc.mode = NAND_ECC_NONE; - } - - err = nand_scan_tail(mtd); - if (err) - goto out_irq; - - pci_set_drvdata(pdev, mtd); - add_mtd_device(mtd); - goto out; - - out_irq: - /* Disable NAND IRQ in global IRQ mask register */ - writel(~1 & readl(cafe->mmio + 0x300c), cafe->mmio + 0x300c); - free_irq(pdev->irq, mtd); - out_free_dma: - dma_free_coherent(&cafe->pdev->dev, 2112, cafe->dmabuf, cafe->dmaaddr); - out_ior: - pci_iounmap(pdev, cafe->mmio); - out_free_mtd: - kfree(mtd); - out: - return err; -} - -static void __devexit cafe_nand_remove(struct pci_dev *pdev) -{ - struct mtd_info *mtd = pci_get_drvdata(pdev); - struct cafe_priv *cafe = mtd->priv; - - del_mtd_device(mtd); - /* Disable NAND IRQ in global IRQ mask register */ - writel(~1 & readl(cafe->mmio + 0x300c), cafe->mmio + 0x300c); - free_irq(pdev->irq, mtd); - nand_release(mtd); - pci_iounmap(pdev, cafe->mmio); - dma_free_coherent(&cafe->pdev->dev, 2112, cafe->dmabuf, cafe->dmaaddr); - kfree(mtd); -} - -static struct pci_device_id cafe_nand_tbl[] = { - { 0x11ab, 0x4100, PCI_ANY_ID, PCI_ANY_ID, PCI_CLASS_MEMORY_FLASH << 8, 0xFFFF0 } -}; - -MODULE_DEVICE_TABLE(pci, cafe_nand_tbl); - -static struct pci_driver cafe_nand_pci_driver = { - .name = "CAFÉ NAND", - .id_table = cafe_nand_tbl, - .probe = cafe_nand_probe, - .remove = __devexit_p(cafe_nand_remove), -#ifdef CONFIG_PMx - .suspend = cafe_nand_suspend, - .resume = cafe_nand_resume, -#endif -}; - -static int cafe_nand_init(void) -{ - return pci_register_driver(&cafe_nand_pci_driver); -} - -static void cafe_nand_exit(void) -{ - pci_unregister_driver(&cafe_nand_pci_driver); -} -module_init(cafe_nand_init); -module_exit(cafe_nand_exit); - -MODULE_LICENSE("GPL"); -MODULE_AUTHOR("David Woodhouse "); -MODULE_DESCRIPTION("NAND flash driver for OLPC CAFE chip"); - -/* Correct ECC for 2048 bytes of 0xff: - 41 a0 71 65 54 27 f3 93 ec a9 be ed 0b a1 */ - -/* dwmw2's B-test board, in case of completely screwing it: -Bad eraseblock 2394 at 0x12b40000 -Bad eraseblock 2627 at 0x14860000 -Bad eraseblock 3349 at 0x1a2a0000 -*/ -- cgit v1.2.3 From fbad5696c5c45982d02e05b85922bad6eb6e6349 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Sun, 22 Oct 2006 15:09:33 +0100 Subject: =?UTF-8?q?[MTD]=20NAND:=20CAF=C3=89=20NAND=20driver=20cleanup,=20?= =?UTF-8?q?fix=20ECC=20on=20reading=20empty=20flash?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Signed-off-by: David Woodhouse --- drivers/mtd/nand/Makefile | 3 +- drivers/mtd/nand/cafe.c | 149 +++++++++++++++++++++++++++++++------------- drivers/mtd/nand/cafe_ecc.c | 5 +- 3 files changed, 109 insertions(+), 48 deletions(-) (limited to 'drivers/mtd') diff --git a/drivers/mtd/nand/Makefile b/drivers/mtd/nand/Makefile index 7cebc10c474..f7a53f0b701 100644 --- a/drivers/mtd/nand/Makefile +++ b/drivers/mtd/nand/Makefile @@ -25,4 +25,5 @@ obj-$(CONFIG_MTD_NAND_CS553X) += cs553x_nand.o obj-$(CONFIG_MTD_NAND_NDFC) += ndfc.o obj-$(CONFIG_MTD_NAND_AT91) += at91_nand.o -nand-objs = nand_base.o nand_bbt.o +nand-objs := nand_base.o nand_bbt.o +cafe_nand-objs := cafe.o cafe_ecc.o diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c index 1fe110836cc..10132efd058 100644 --- a/drivers/mtd/nand/cafe.c +++ b/drivers/mtd/nand/cafe.c @@ -1,5 +1,5 @@ /* - * cafe_nand.c + * Driver for One Laptop Per Child ‘CAFÉ’ controller, aka Marvell 88ALP01 * * Copyright © 2006 Red Hat, Inc. * Copyright © 2006 David Woodhouse @@ -30,13 +30,13 @@ #define CAFE_NAND_TIMING3 0x2c #define CAFE_NAND_NONMEM 0x30 #define CAFE_NAND_ECC_RESULT 0x3C +#define CAFE_NAND_DMA_CTRL 0x40 +#define CAFE_NAND_DMA_ADDR0 0x44 +#define CAFE_NAND_DMA_ADDR1 0x48 #define CAFE_NAND_ECC_SYN01 0x50 #define CAFE_NAND_ECC_SYN23 0x54 #define CAFE_NAND_ECC_SYN45 0x58 #define CAFE_NAND_ECC_SYN67 0x5c -#define CAFE_NAND_DMA_CTRL 0x40 -#define CAFE_NAND_DMA_ADDR0 0x44 -#define CAFE_NAND_DMA_ADDR1 0x48 #define CAFE_NAND_READ_DATA 0x1000 #define CAFE_NAND_WRITE_DATA 0x2000 @@ -75,12 +75,14 @@ static int cafe_device_ready(struct mtd_info *mtd) { struct cafe_priv *cafe = mtd->priv; int result = !!(readl(cafe->mmio + CAFE_NAND_STATUS) | 0x40000000); - uint32_t irqs = readl(cafe->mmio + CAFE_NAND_IRQ); + writel(irqs, cafe->mmio+CAFE_NAND_IRQ); + cafe_dev_dbg(&cafe->pdev->dev, "NAND device is%s ready, IRQ %x (%x) (%x,%x)\n", result?"":" not", irqs, readl(cafe->mmio + CAFE_NAND_IRQ), readl(cafe->mmio + 0x3008), readl(cafe->mmio + 0x300c)); + return result; } @@ -93,6 +95,7 @@ static void cafe_write_buf(struct mtd_info *mtd, const uint8_t *buf, int len) memcpy(cafe->dmabuf + cafe->datalen, buf, len); else memcpy_toio(cafe->mmio + CAFE_NAND_WRITE_DATA + cafe->datalen, buf, len); + cafe->datalen += len; cafe_dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes to write buffer. datalen 0x%x\n", @@ -131,14 +134,13 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, int adrbytes = 0; uint32_t ctl1; uint32_t doneint = 0x80000000; - int i; cafe_dev_dbg(&cafe->pdev->dev, "cmdfunc %02x, 0x%x, 0x%x\n", command, column, page_addr); if (command == NAND_CMD_ERASE2 || command == NAND_CMD_PAGEPROG) { /* Second half of a command we already calculated */ - writel(cafe->ctl2 | 0x100 | command, cafe->mmio + 0x04); + writel(cafe->ctl2 | 0x100 | command, cafe->mmio + CAFE_NAND_CTRL2); ctl1 = cafe->ctl1; cafe_dev_dbg(&cafe->pdev->dev, "Continue command, ctl1 %08x, #data %d\n", cafe->ctl1, cafe->nr_data); @@ -158,12 +160,12 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, for small-page chips, to position the buffer correctly? */ if (column != -1) { - writel(column, cafe->mmio + 0x1c); + writel(column, cafe->mmio + CAFE_NAND_ADDR1); adrbytes = 2; if (page_addr != -1) goto write_adr2; } else if (page_addr != -1) { - writel(page_addr & 0xffff, cafe->mmio + 0x1c); + writel(page_addr & 0xffff, cafe->mmio + CAFE_NAND_ADDR1); page_addr >>= 16; write_adr2: writel(page_addr, cafe->mmio+0x20); @@ -212,13 +214,15 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, writel(cafe->ctl2 | 0x100 | NAND_CMD_READSTART, cafe->mmio + CAFE_NAND_CTRL2); do_command: -#if 0 - // ECC on read only works if we ... +#if 1 + /* http://dev.laptop.org/ticket/200 + ECC on read only works if we read precisely 0x80e bytes */ if (cafe->datalen == 2112) cafe->datalen = 2062; #endif cafe_dev_dbg(&cafe->pdev->dev, "dlen %x, ctl1 %x, ctl2 %x\n", cafe->datalen, ctl1, readl(cafe->mmio+CAFE_NAND_CTRL2)); + /* NB: The datasheet lies -- we really should be subtracting 1 here */ writel(cafe->datalen, cafe->mmio + CAFE_NAND_DATA_LEN); writel(0x90000000, cafe->mmio + CAFE_NAND_IRQ); @@ -232,18 +236,16 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, the command. */ doneint = 0x10000000; } - writel(dmactl, cafe->mmio + 0x40); + writel(dmactl, cafe->mmio + CAFE_NAND_DMA_CTRL); } -#if 0 - printk("DMA setup is %x, status %x, ctl1 %x\n", readl(cafe->mmio + 0x40), readl(cafe->mmio + 0x0c), readl(cafe->mmio)); - printk("DMA setup is %x, status %x, ctl1 %x\n", readl(cafe->mmio + 0x40), readl(cafe->mmio + 0x0c), readl(cafe->mmio)); -#endif cafe->datalen = 0; #if 0 + { int i; printk("About to write command %08x\n", ctl1); for (i=0; i< 0x5c; i+=4) printk("Register %x: %08x\n", i, readl(cafe->mmio + i)); + } #endif writel(ctl1, cafe->mmio + CAFE_NAND_CTRL1); /* Apply this short delay always to ensure that we do wait tWB in @@ -299,6 +301,7 @@ static void cafe_select_chip(struct mtd_info *mtd, int chipnr) //struct cafe_priv *cafe = mtd->priv; // cafe_dev_dbg(&cafe->pdev->dev, "select_chip %d\n", chipnr); } + static int cafe_nand_interrupt(int irq, void *id, struct pt_regs *regs) { struct mtd_info *mtd = id; @@ -347,14 +350,34 @@ static int cafe_nand_read_oob(struct mtd_info *mtd, struct nand_chip *chip, * The hw generator calculates the error syndrome automatically. Therefor * we need a special oob layout and handling. */ + +static unsigned short cafe_empty_syndromes[8] = { 4095, 748, 2629, 2920, 875, 1454, 51, 1456 }; + +static int is_all_ff(unsigned char *buf, int len) +{ + unsigned long *lbuf = (void *)buf; + int i; + + for (i=0; i < (len/sizeof(long)); i++) { + if (lbuf[i] != ~0UL) + return 0; + } + i *= sizeof(long); + for (; i< len; i++) { + if (buf[i] != 0xff) + return 0; + } + return 1; +} + static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, uint8_t *buf) { struct cafe_priv *cafe = mtd->priv; - dev_dbg(&cafe->pdev->dev, "ECC result %08x SYN1,2 %08x\n", - readl(cafe->mmio + CAFE_NAND_ECC_RESULT), - readl(cafe->mmio + CAFE_NAND_ECC_SYN01)); + cafe_dev_dbg(&cafe->pdev->dev, "ECC result %08x SYN1,2 %08x\n", + readl(cafe->mmio + CAFE_NAND_ECC_RESULT), + readl(cafe->mmio + CAFE_NAND_ECC_SYN01)); chip->read_buf(mtd, buf, mtd->writesize); chip->read_buf(mtd, chip->oob_poi, mtd->oobsize); @@ -369,7 +392,13 @@ static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, syn[i+1] = (tmp >> 16) & 0xfff; } - if ((i = cafe_correct_ecc(buf, syn)) < 0) { + /* FIXME: http://dev.laptop.org/ticket/215 */ + if (!memcmp(syn, cafe_empty_syndromes, sizeof(syn)) + && is_all_ff(chip->oob_poi, 14) + && is_all_ff(buf, mtd->writesize)) { + dev_dbg(&cafe->pdev->dev, "ECC error reported on empty block\n"); + /* It was an empty block. Nothing to fix here except the hardware */ + } else if ((i = cafe_correct_ecc(buf, syn)) < 0) { dev_dbg(&cafe->pdev->dev, "Failed to correct ECC\n"); mtd->ecc_stats.failed++; } else { @@ -389,9 +418,13 @@ static struct nand_ecclayout cafe_oobinfo_2048 = { }; /* Ick. The BBT code really ought to be able to work this bit out - for itself from the above */ -static uint8_t cafe_bbt_pattern[] = {'B', 'b', 't', '0' }; -static uint8_t cafe_mirror_pattern[] = {'1', 't', 'b', 'B' }; + for itself from the above, at least for the 2KiB case */ +static uint8_t cafe_bbt_pattern_2048[] = { 'B', 'b', 't', '0' }; +static uint8_t cafe_mirror_pattern_2048[] = { '1', 't', 'b', 'B' }; + +static uint8_t cafe_bbt_pattern_512[] = { 0xBB }; +static uint8_t cafe_mirror_pattern_512[] = { 0xBC }; + static struct nand_bbt_descr cafe_bbt_main_descr_2048 = { .options = NAND_BBT_LASTBLOCK | NAND_BBT_CREATE | NAND_BBT_WRITE @@ -400,7 +433,7 @@ static struct nand_bbt_descr cafe_bbt_main_descr_2048 = { .len = 4, .veroffs = 18, .maxblocks = 4, - .pattern = cafe_bbt_pattern + .pattern = cafe_bbt_pattern_2048 }; static struct nand_bbt_descr cafe_bbt_mirror_descr_2048 = { @@ -410,7 +443,7 @@ static struct nand_bbt_descr cafe_bbt_mirror_descr_2048 = { .len = 4, .veroffs = 18, .maxblocks = 4, - .pattern = cafe_mirror_pattern + .pattern = cafe_mirror_pattern_2048 }; static struct nand_ecclayout cafe_oobinfo_512 = { @@ -419,6 +452,27 @@ static struct nand_ecclayout cafe_oobinfo_512 = { .oobfree = {{14, 2}} }; +static struct nand_bbt_descr cafe_bbt_main_descr_512 = { + .options = NAND_BBT_LASTBLOCK | NAND_BBT_CREATE | NAND_BBT_WRITE + | NAND_BBT_2BIT | NAND_BBT_VERSION | NAND_BBT_PERCHIP, + .offs = 14, + .len = 1, + .veroffs = 15, + .maxblocks = 4, + .pattern = cafe_bbt_pattern_512 +}; + +static struct nand_bbt_descr cafe_bbt_mirror_descr_512 = { + .options = NAND_BBT_LASTBLOCK | NAND_BBT_CREATE | NAND_BBT_WRITE + | NAND_BBT_2BIT | NAND_BBT_VERSION | NAND_BBT_PERCHIP, + .offs = 14, + .len = 1, + .veroffs = 15, + .maxblocks = 4, + .pattern = cafe_mirror_pattern_512 +}; + + static void cafe_nand_write_page_lowlevel(struct mtd_info *mtd, struct nand_chip *chip, const uint8_t *buf) { @@ -566,19 +620,21 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, ctrl |= 0x00007000; writel(ctrl | 0x05, cafe->mmio + 0x3004); writel(ctrl | 0x0a, cafe->mmio + 0x3004); - writel(0, cafe->mmio + 0x40); + writel(0, cafe->mmio + CAFE_NAND_DMA_CTRL); writel(0x7006, cafe->mmio + 0x3004); writel(0x700a, cafe->mmio + 0x3004); /* Set up DMA address */ - writel(cafe->dmaaddr & 0xffffffff, cafe->mmio + 0x44); + writel(cafe->dmaaddr & 0xffffffff, cafe->mmio + CAFE_NAND_DMA_ADDR0); if (sizeof(cafe->dmaaddr) > 4) - writel((cafe->dmaaddr >> 16) >> 16, cafe->mmio + 0x48); + /* Shift in two parts to shut the compiler up */ + writel((cafe->dmaaddr >> 16) >> 16, cafe->mmio + CAFE_NAND_DMA_ADDR1); else - writel(0, cafe->mmio + 0x48); + writel(0, cafe->mmio + CAFE_NAND_DMA_ADDR1); + cafe_dev_dbg(&cafe->pdev->dev, "Set DMA address to %x (virt %p)\n", - readl(cafe->mmio+0x44), cafe->dmabuf); + readl(cafe->mmio + CAFE_NAND_DMA_ADDR0), cafe->dmabuf); /* Enable NAND IRQ in global IRQ mask register */ writel(0x80000007, cafe->mmio + 0x300c); @@ -620,27 +676,30 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, cafe->ctl2 |= 1<<29; /* 2KiB page size */ /* Set up ECC according to the type of chip we found */ - if (mtd->writesize == 512 || mtd->writesize == 2048) { - cafe->nand.ecc.mode = NAND_ECC_HW_SYNDROME; - cafe->nand.ecc.size = mtd->writesize; - cafe->nand.ecc.bytes = 14; + if (mtd->writesize == 2048) { cafe->nand.ecc.layout = &cafe_oobinfo_2048; cafe->nand.bbt_td = &cafe_bbt_main_descr_2048; cafe->nand.bbt_md = &cafe_bbt_mirror_descr_2048; - cafe->nand.ecc.hwctl = (void *)cafe_nand_bug; - cafe->nand.ecc.calculate = (void *)cafe_nand_bug; - cafe->nand.ecc.correct = (void *)cafe_nand_bug; - cafe->nand.write_page = cafe_nand_write_page; - cafe->nand.ecc.write_page = cafe_nand_write_page_lowlevel; - cafe->nand.ecc.write_oob = cafe_nand_write_oob; - cafe->nand.ecc.read_page = cafe_nand_read_page; - cafe->nand.ecc.read_oob = cafe_nand_read_oob; - + } else if (mtd->writesize == 512) { + cafe->nand.ecc.layout = &cafe_oobinfo_512; + cafe->nand.bbt_td = &cafe_bbt_main_descr_512; + cafe->nand.bbt_md = &cafe_bbt_mirror_descr_512; } else { - printk(KERN_WARNING "Unexpected NAND flash writesize %d. Using software ECC\n", + printk(KERN_WARNING "Unexpected NAND flash writesize %d. Aborting\n", mtd->writesize); - cafe->nand.ecc.mode = NAND_ECC_NONE; + goto out_irq; } + cafe->nand.ecc.mode = NAND_ECC_HW_SYNDROME; + cafe->nand.ecc.size = mtd->writesize; + cafe->nand.ecc.bytes = 14; + cafe->nand.ecc.hwctl = (void *)cafe_nand_bug; + cafe->nand.ecc.calculate = (void *)cafe_nand_bug; + cafe->nand.ecc.correct = (void *)cafe_nand_bug; + cafe->nand.write_page = cafe_nand_write_page; + cafe->nand.ecc.write_page = cafe_nand_write_page_lowlevel; + cafe->nand.ecc.write_oob = cafe_nand_write_oob; + cafe->nand.ecc.read_page = cafe_nand_read_page; + cafe->nand.ecc.read_oob = cafe_nand_read_oob; err = nand_scan_tail(mtd); if (err) diff --git a/drivers/mtd/nand/cafe_ecc.c b/drivers/mtd/nand/cafe_ecc.c index 4df28a846fb..c4bec37e73e 100644 --- a/drivers/mtd/nand/cafe_ecc.c +++ b/drivers/mtd/nand/cafe_ecc.c @@ -499,10 +499,11 @@ static void solve_2x3(unsigned short m[2][3], unsigned short *coefs) } static unsigned char gf64_inv[64] = { - 0, 1, 33, 62, 49, 43, 31, 44, 57, 37, 52, 28, 46, 40, 22, 25, + 0, 1, 33, 62, 49, 43, 31, 44, 57, 37, 52, 28, 46, 40, 22, 25, 61, 54, 51, 39, 26, 35, 14, 24, 23, 15, 20, 34, 11, 53, 45, 6, 63, 2, 27, 21, 56, 9, 50, 19, 13, 47, 48, 5, 7, 30, 12, 41, - 42, 4, 38, 18, 10, 29, 17, 60, 36, 8, 59, 58, 55, 16, 3, 32}; + 42, 4, 38, 18, 10, 29, 17, 60, 36, 8, 59, 58, 55, 16, 3, 32 +}; static unsigned short gf4096_inv(unsigned short din) { -- cgit v1.2.3 From 470b0a90d6a21cb72b671215f12ec7ec8a0db2c0 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Mon, 23 Oct 2006 14:29:04 +0100 Subject: =?UTF-8?q?[MTD]=20NAND:=20Disable=20ECC=20checking=20on=20CAF?= =?UTF-8?q?=C3=89=20since=20it's=20broken=20for=20now?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe.c | 7 +++++-- 1 file changed, 5 insertions(+), 2 deletions(-) (limited to 'drivers/mtd') diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c index 10132efd058..6bcb430b951 100644 --- a/drivers/mtd/nand/cafe.c +++ b/drivers/mtd/nand/cafe.c @@ -67,6 +67,9 @@ module_param(skipbbt, int, 0644); static int debug = 0; module_param(debug, int, 0644); +static int checkecc = 0; +module_param(checkecc, int, 0644); + /* Hrm. Why isn't this already conditional on something in the struct device? */ #define cafe_dev_dbg(dev, args...) do { if (debug) dev_dbg(dev, ##args); } while(0) @@ -214,7 +217,7 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, writel(cafe->ctl2 | 0x100 | NAND_CMD_READSTART, cafe->mmio + CAFE_NAND_CTRL2); do_command: -#if 1 +#if 0 /* http://dev.laptop.org/ticket/200 ECC on read only works if we read precisely 0x80e bytes */ if (cafe->datalen == 2112) @@ -382,7 +385,7 @@ static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, chip->read_buf(mtd, buf, mtd->writesize); chip->read_buf(mtd, chip->oob_poi, mtd->oobsize); - if (readl(cafe->mmio + CAFE_NAND_ECC_RESULT) & (1<<18)) { + if (checkecc && readl(cafe->mmio + CAFE_NAND_ECC_RESULT) & (1<<18)) { unsigned short syn[8]; int i; -- cgit v1.2.3 From 2c8cfdcbeb1ab0ec7bbd5af1be311b55281154c4 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Fri, 27 Oct 2006 09:53:08 +0300 Subject: =?UTF-8?q?[MTD]=20NAND:=20Caf=C3=A9=20ECC=20--=20remove=20spuriou?= =?UTF-8?q?s=20BUG=5FON()=20in=20err=5Fpos()?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Being a value which isn't in the table is a case we explicitly check for in the caller. Don't BUG_ON() because it does actually happen in practice. Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe_ecc.c | 1 - 1 file changed, 1 deletion(-) (limited to 'drivers/mtd') diff --git a/drivers/mtd/nand/cafe_ecc.c b/drivers/mtd/nand/cafe_ecc.c index c4bec37e73e..46214602d20 100644 --- a/drivers/mtd/nand/cafe_ecc.c +++ b/drivers/mtd/nand/cafe_ecc.c @@ -1045,7 +1045,6 @@ static unsigned short err_pos_lut[4096] = { static unsigned short err_pos(unsigned short din) { BUG_ON(din > 4096); - BUG_ON(err_pos_lut[din] == 0xfff); return err_pos_lut[din]; } static int chk_no_err_only(unsigned short *chk_syndrome_list, unsigned short *err_info) -- cgit v1.2.3 From dcc41bc81c872862652d68af8993b9fa32ce56a4 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Fri, 27 Oct 2006 09:55:34 +0300 Subject: =?UTF-8?q?[MTD]=20NAND:=20Reset=20Caf=C3=A9=20controller=20before?= =?UTF-8?q?=20initialising.?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Fixes http://dev.laptop.org/ticket/237 Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe.c | 4 ++++ 1 file changed, 4 insertions(+) (limited to 'drivers/mtd') diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c index 6bcb430b951..dd274c877b5 100644 --- a/drivers/mtd/nand/cafe.c +++ b/drivers/mtd/nand/cafe.c @@ -598,6 +598,10 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, cafe->nand.block_bad = cafe_nand_block_bad; } + /* Start off by resetting the NAND controller completely */ + writel(1, cafe->mmio + 0x3034); + writel(0, cafe->mmio + 0x3034); + /* Timings from Marvell's test code (not verified or calculated by us) */ writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); #if 1 -- cgit v1.2.3 From b478c775a0c306c84215a1138e49fab540b94a5d Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Fri, 27 Oct 2006 14:50:04 +0300 Subject: =?UTF-8?q?[MTD]=20CAF=C3=89=20NAND:=20Add=20'slowtiming'=20parame?= =?UTF-8?q?ter,=20default=20usedma=20and=20checkecc=20on?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe.c | 26 +++++++++++++++----------- 1 file changed, 15 insertions(+), 11 deletions(-) (limited to 'drivers/mtd') diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c index dd274c877b5..d894c7286aa 100644 --- a/drivers/mtd/nand/cafe.c +++ b/drivers/mtd/nand/cafe.c @@ -58,7 +58,7 @@ struct cafe_priv { }; -static int usedma = 0; +static int usedma = 1; module_param(usedma, int, 0644); static int skipbbt = 0; @@ -67,9 +67,12 @@ module_param(skipbbt, int, 0644); static int debug = 0; module_param(debug, int, 0644); -static int checkecc = 0; +static int checkecc = 1; module_param(checkecc, int, 0644); +static int slowtiming = 0; +module_param(slowtiming, int, 0644); + /* Hrm. Why isn't this already conditional on something in the struct device? */ #define cafe_dev_dbg(dev, args...) do { if (debug) dev_dbg(dev, ##args); } while(0) @@ -604,15 +607,16 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, /* Timings from Marvell's test code (not verified or calculated by us) */ writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); -#if 1 - writel(0x01010a0a, cafe->mmio + CAFE_NAND_TIMING1); - writel(0x24121212, cafe->mmio + CAFE_NAND_TIMING2); - writel(0x11000000, cafe->mmio + CAFE_NAND_TIMING3); -#else - writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING1); - writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING2); - writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING3); -#endif + + if (!slowtiming) { + writel(0x01010a0a, cafe->mmio + CAFE_NAND_TIMING1); + writel(0x24121212, cafe->mmio + CAFE_NAND_TIMING2); + writel(0x11000000, cafe->mmio + CAFE_NAND_TIMING3); + } else { + writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING1); + writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING2); + writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING3); + } writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); err = request_irq(pdev->irq, &cafe_nand_interrupt, SA_SHIRQ, "CAFE NAND", mtd); if (err) { -- cgit v1.2.3 From 7608194c4ae454fab23b8d940986eeb9c58c3478 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Fri, 27 Oct 2006 15:40:51 +0300 Subject: =?UTF-8?q?[MTD]=20NAND:=20Add=20ECC=20debugging=20for=20CAF=C3=89?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe_ecc.c | 39 ++++++++++++++++++++++++++++++++++++--- 1 file changed, 36 insertions(+), 3 deletions(-) (limited to 'drivers/mtd') diff --git a/drivers/mtd/nand/cafe_ecc.c b/drivers/mtd/nand/cafe_ecc.c index 46214602d20..2d29265cc90 100644 --- a/drivers/mtd/nand/cafe_ecc.c +++ b/drivers/mtd/nand/cafe_ecc.c @@ -19,6 +19,7 @@ */ #include +#include #include static unsigned short gf4096_mul(unsigned short, unsigned short); @@ -1322,16 +1323,43 @@ void correct_12bit_symbol(unsigned char *buf, unsigned short sym, buf[2+(3*(sym-2))/2] ^= (val >> 8); buf[3+(3*(sym-2))/2] ^= (val & 0xff); } - - } +static int debugecc = 0; +module_param(debugecc, int, 0644); + int cafe_correct_ecc(unsigned char *buf, unsigned short *chk_syndrome_list) { unsigned short err_info[9]; int i; + if (debugecc) { + printk(KERN_WARNING "cafe_correct_ecc invoked. Syndromes %x %x %x %x %x %x %x %x\n", + chk_syndrome_list[0], chk_syndrome_list[1], + chk_syndrome_list[2], chk_syndrome_list[3], + chk_syndrome_list[4], chk_syndrome_list[5], + chk_syndrome_list[6], chk_syndrome_list[7]); + for (i=0; i < 2048; i+=16) { + printk(KERN_WARNING "D %04x: %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x\n", + i, + buf[i], buf[i+1], buf[i+2], buf[i+3], + buf[i+4], buf[i+5], buf[i+6], buf[i+7], + buf[i+8], buf[i+9], buf[i+10], buf[i+11], + buf[i+12], buf[i+13], buf[i+14], buf[i+15]); + } + for ( ; i < 2112; i+=16) { + printk(KERN_WARNING "O %02x: %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x\n", + i - 2048, + buf[i], buf[i+1], buf[i+2], buf[i+3], + buf[i+4], buf[i+5], buf[i+6], buf[i+7], + buf[i+8], buf[i+9], buf[i+10], buf[i+11], + buf[i+12], buf[i+13], buf[i+14], buf[i+15]); + } + } + + + if (chk_no_err_only(chk_syndrome_list, err_info) && chk_1_err_only(chk_syndrome_list, err_info) && chk_2_err_only(chk_syndrome_list, err_info) && @@ -1340,8 +1368,13 @@ int cafe_correct_ecc(unsigned char *buf, return -EIO; } - for (i=0; i < err_info[0]; i++) + for (i=0; i < err_info[0]; i++) { + if (debugecc) + printk(KERN_WARNING "Correct symbol %d with 0x%03x\n", + err_info[1+i], err_info[5+i]); + correct_12bit_symbol(buf, err_info[1+i], err_info[5+i]); + } return err_info[0]; } -- cgit v1.2.3 From 63a1423763c6c38eeeaf6dc8cee986514ab67aed Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Fri, 27 Oct 2006 22:12:02 +0300 Subject: [MTD] NAND: Remove empty block ECC workaround They fixed the hardware so that ECC doesn't fail on reading an empty block. Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe.c | 28 +--------------------------- 1 file changed, 1 insertion(+), 27 deletions(-) (limited to 'drivers/mtd') diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c index d894c7286aa..887040c6c2d 100644 --- a/drivers/mtd/nand/cafe.c +++ b/drivers/mtd/nand/cafe.c @@ -356,26 +356,6 @@ static int cafe_nand_read_oob(struct mtd_info *mtd, struct nand_chip *chip, * The hw generator calculates the error syndrome automatically. Therefor * we need a special oob layout and handling. */ - -static unsigned short cafe_empty_syndromes[8] = { 4095, 748, 2629, 2920, 875, 1454, 51, 1456 }; - -static int is_all_ff(unsigned char *buf, int len) -{ - unsigned long *lbuf = (void *)buf; - int i; - - for (i=0; i < (len/sizeof(long)); i++) { - if (lbuf[i] != ~0UL) - return 0; - } - i *= sizeof(long); - for (; i< len; i++) { - if (buf[i] != 0xff) - return 0; - } - return 1; -} - static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, uint8_t *buf) { @@ -398,13 +378,7 @@ static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, syn[i+1] = (tmp >> 16) & 0xfff; } - /* FIXME: http://dev.laptop.org/ticket/215 */ - if (!memcmp(syn, cafe_empty_syndromes, sizeof(syn)) - && is_all_ff(chip->oob_poi, 14) - && is_all_ff(buf, mtd->writesize)) { - dev_dbg(&cafe->pdev->dev, "ECC error reported on empty block\n"); - /* It was an empty block. Nothing to fix here except the hardware */ - } else if ((i = cafe_correct_ecc(buf, syn)) < 0) { + if ((i = cafe_correct_ecc(buf, syn)) < 0) { dev_dbg(&cafe->pdev->dev, "Failed to correct ECC\n"); mtd->ecc_stats.failed++; } else { -- cgit v1.2.3 From a020727b1628cb4d7b70733222253c7fa3ec6113 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Sat, 28 Oct 2006 17:08:38 +0300 Subject: =?UTF-8?q?[MTD]=20NAND:=20Fix=20timing=20calculation=20in=20CAF?= =?UTF-8?q?=C3=89=20debugging=20message?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe.c | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) (limited to 'drivers/mtd') diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c index 887040c6c2d..35a868708e0 100644 --- a/drivers/mtd/nand/cafe.c +++ b/drivers/mtd/nand/cafe.c @@ -272,7 +272,8 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, cpu_relax(); } writel(doneint, cafe->mmio + CAFE_NAND_IRQ); - cafe_dev_dbg(&cafe->pdev->dev, "Command %x completed after %d usec, irqs %x (%x)\n", command, 50000-c, irqs, readl(cafe->mmio + CAFE_NAND_IRQ)); + cafe_dev_dbg(&cafe->pdev->dev, "Command %x completed after %d usec, irqs %x (%x)\n", + command, 500000-c, irqs, readl(cafe->mmio + CAFE_NAND_IRQ)); } -- cgit v1.2.3 From 195a253b6632e2b7e6319f2f67120e708646554e Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Tue, 31 Oct 2006 12:30:11 +0800 Subject: =?UTF-8?q?[MTD]=20NAND:=20Use=20register=20#defines=20throughout?= =?UTF-8?q?=20CAF=C3=89=20driver,=20not=20numbers?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Also use cafe_readl() and cafe_writel() abstraction to make code slightly cleaner -- especially if we want to use it in PIO mode. Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe.c | 118 ++++++++++++++++++++++++++---------------------- 1 file changed, 63 insertions(+), 55 deletions(-) (limited to 'drivers/mtd') diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c index 35a868708e0..175cf82393e 100644 --- a/drivers/mtd/nand/cafe.c +++ b/drivers/mtd/nand/cafe.c @@ -40,6 +40,11 @@ #define CAFE_NAND_READ_DATA 0x1000 #define CAFE_NAND_WRITE_DATA 0x2000 +#define CAFE_GLOBAL_CTRL 0x3004 +#define CAFE_GLOBAL_IRQ 0x3008 +#define CAFE_GLOBAL_IRQ_MASK 0x300c +#define CAFE_NAND_RESET 0x3034 + int cafe_correct_ecc(unsigned char *buf, unsigned short *chk_syndrome_list); @@ -76,18 +81,21 @@ module_param(slowtiming, int, 0644); /* Hrm. Why isn't this already conditional on something in the struct device? */ #define cafe_dev_dbg(dev, args...) do { if (debug) dev_dbg(dev, ##args); } while(0) +/* Make it easier to switch to PIO if we need to */ +#define cafe_readl(cafe, addr) readl((cafe)->mmio + CAFE_##addr) +#define cafe_writel(cafe, datum, addr) writel(datum, (cafe)->mmio + CAFE_##addr) static int cafe_device_ready(struct mtd_info *mtd) { struct cafe_priv *cafe = mtd->priv; - int result = !!(readl(cafe->mmio + CAFE_NAND_STATUS) | 0x40000000); - uint32_t irqs = readl(cafe->mmio + CAFE_NAND_IRQ); + int result = !!(cafe_readl(cafe, NAND_STATUS) | 0x40000000); + uint32_t irqs = cafe_readl(cafe, NAND_IRQ); - writel(irqs, cafe->mmio+CAFE_NAND_IRQ); + cafe_writel(cafe, irqs, NAND_IRQ); cafe_dev_dbg(&cafe->pdev->dev, "NAND device is%s ready, IRQ %x (%x) (%x,%x)\n", - result?"":" not", irqs, readl(cafe->mmio + CAFE_NAND_IRQ), - readl(cafe->mmio + 0x3008), readl(cafe->mmio + 0x300c)); + result?"":" not", irqs, cafe_readl(cafe, NAND_IRQ), + cafe_readl(cafe, GLOBAL_IRQ), cafe_readl(cafe, GLOBAL_IRQ_MASK)); return result; } @@ -146,14 +154,14 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, if (command == NAND_CMD_ERASE2 || command == NAND_CMD_PAGEPROG) { /* Second half of a command we already calculated */ - writel(cafe->ctl2 | 0x100 | command, cafe->mmio + CAFE_NAND_CTRL2); + cafe_writel(cafe, cafe->ctl2 | 0x100 | command, NAND_CTRL2); ctl1 = cafe->ctl1; cafe_dev_dbg(&cafe->pdev->dev, "Continue command, ctl1 %08x, #data %d\n", cafe->ctl1, cafe->nr_data); goto do_command; } /* Reset ECC engine */ - writel(0, cafe->mmio + CAFE_NAND_CTRL2); + cafe_writel(cafe, 0, NAND_CTRL2); /* Emulate NAND_CMD_READOOB on large-page chips */ if (mtd->writesize > 512 && @@ -166,15 +174,15 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, for small-page chips, to position the buffer correctly? */ if (column != -1) { - writel(column, cafe->mmio + CAFE_NAND_ADDR1); + cafe_writel(cafe, column, NAND_ADDR1); adrbytes = 2; if (page_addr != -1) goto write_adr2; } else if (page_addr != -1) { - writel(page_addr & 0xffff, cafe->mmio + CAFE_NAND_ADDR1); + cafe_writel(cafe, page_addr & 0xffff, NAND_ADDR1); page_addr >>= 16; write_adr2: - writel(page_addr, cafe->mmio+0x20); + cafe_writel(cafe, page_addr, NAND_ADDR2); adrbytes += 2; if (mtd->size > mtd->writesize << 16) adrbytes++; @@ -215,9 +223,9 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, } /* RNDOUT and READ0 commands need a following byte */ if (command == NAND_CMD_RNDOUT) - writel(cafe->ctl2 | 0x100 | NAND_CMD_RNDOUTSTART, cafe->mmio + CAFE_NAND_CTRL2); + cafe_writel(cafe, cafe->ctl2 | 0x100 | NAND_CMD_RNDOUTSTART, NAND_CTRL2); else if (command == NAND_CMD_READ0 && mtd->writesize > 512) - writel(cafe->ctl2 | 0x100 | NAND_CMD_READSTART, cafe->mmio + CAFE_NAND_CTRL2); + cafe_writel(cafe, cafe->ctl2 | 0x100 | NAND_CMD_READSTART, NAND_CTRL2); do_command: #if 0 @@ -227,11 +235,11 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, cafe->datalen = 2062; #endif cafe_dev_dbg(&cafe->pdev->dev, "dlen %x, ctl1 %x, ctl2 %x\n", - cafe->datalen, ctl1, readl(cafe->mmio+CAFE_NAND_CTRL2)); + cafe->datalen, ctl1, cafe_readl(cafe, NAND_CTRL2)); /* NB: The datasheet lies -- we really should be subtracting 1 here */ - writel(cafe->datalen, cafe->mmio + CAFE_NAND_DATA_LEN); - writel(0x90000000, cafe->mmio + CAFE_NAND_IRQ); + cafe_writel(cafe, cafe->datalen, NAND_DATA_LEN); + cafe_writel(cafe, 0x90000000, NAND_IRQ); if (usedma && (ctl1 & (3<<25))) { uint32_t dmactl = 0xc0000000 + cafe->datalen; /* If WR or RD bits set, set up DMA */ @@ -242,7 +250,7 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, the command. */ doneint = 0x10000000; } - writel(dmactl, cafe->mmio + CAFE_NAND_DMA_CTRL); + cafe_writel(cafe, dmactl, NAND_DMA_CTRL); } cafe->datalen = 0; @@ -253,7 +261,7 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, printk("Register %x: %08x\n", i, readl(cafe->mmio + i)); } #endif - writel(ctl1, cafe->mmio + CAFE_NAND_CTRL1); + cafe_writel(cafe, ctl1, NAND_CTRL1); /* Apply this short delay always to ensure that we do wait tWB in * any case on any machine. */ ndelay(100); @@ -263,7 +271,7 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, uint32_t irqs; while (c--) { - irqs = readl(cafe->mmio + CAFE_NAND_IRQ); + irqs = cafe_readl(cafe, NAND_IRQ); if (irqs & doneint) break; udelay(1); @@ -271,9 +279,9 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, cafe_dev_dbg(&cafe->pdev->dev, "Wait for ready, IRQ %x\n", irqs); cpu_relax(); } - writel(doneint, cafe->mmio + CAFE_NAND_IRQ); + cafe_writel(cafe, doneint, NAND_IRQ); cafe_dev_dbg(&cafe->pdev->dev, "Command %x completed after %d usec, irqs %x (%x)\n", - command, 500000-c, irqs, readl(cafe->mmio + CAFE_NAND_IRQ)); + command, 500000-c, irqs, cafe_readl(cafe, NAND_IRQ)); } @@ -296,11 +304,11 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, case NAND_CMD_STATUS_ERROR1: case NAND_CMD_STATUS_ERROR2: case NAND_CMD_STATUS_ERROR3: - writel(cafe->ctl2, cafe->mmio + CAFE_NAND_CTRL2); + cafe_writel(cafe, cafe->ctl2, NAND_CTRL2); return; } nand_wait_ready(mtd); - writel(cafe->ctl2, cafe->mmio + CAFE_NAND_CTRL2); + cafe_writel(cafe, cafe->ctl2, NAND_CTRL2); } static void cafe_select_chip(struct mtd_info *mtd, int chipnr) @@ -313,12 +321,12 @@ static int cafe_nand_interrupt(int irq, void *id, struct pt_regs *regs) { struct mtd_info *mtd = id; struct cafe_priv *cafe = mtd->priv; - uint32_t irqs = readl(cafe->mmio + CAFE_NAND_IRQ); - writel(irqs & ~0x90000000, cafe->mmio + CAFE_NAND_IRQ); + uint32_t irqs = cafe_readl(cafe, NAND_IRQ); + cafe_writel(cafe, irqs & ~0x90000000, NAND_IRQ); if (!irqs) return IRQ_NONE; - cafe_dev_dbg(&cafe->pdev->dev, "irq, bits %x (%x)\n", irqs, readl(cafe->mmio + CAFE_NAND_IRQ)); + cafe_dev_dbg(&cafe->pdev->dev, "irq, bits %x (%x)\n", irqs, cafe_readl(cafe, NAND_IRQ)); return IRQ_HANDLED; } @@ -363,18 +371,18 @@ static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, struct cafe_priv *cafe = mtd->priv; cafe_dev_dbg(&cafe->pdev->dev, "ECC result %08x SYN1,2 %08x\n", - readl(cafe->mmio + CAFE_NAND_ECC_RESULT), - readl(cafe->mmio + CAFE_NAND_ECC_SYN01)); + cafe_readl(cafe, NAND_ECC_RESULT), + cafe_readl(cafe, NAND_ECC_SYN01)); chip->read_buf(mtd, buf, mtd->writesize); chip->read_buf(mtd, chip->oob_poi, mtd->oobsize); - if (checkecc && readl(cafe->mmio + CAFE_NAND_ECC_RESULT) & (1<<18)) { + if (checkecc && cafe_readl(cafe, NAND_ECC_RESULT) & (1<<18)) { unsigned short syn[8]; int i; for (i=0; i<8; i+=2) { - uint32_t tmp = readl(cafe->mmio + CAFE_NAND_ECC_SYN01 + (i*2)); + uint32_t tmp = cafe_readl(cafe, NAND_ECC_SYN01 + (i*2)); syn[i] = tmp & 0xfff; syn[i+1] = (tmp >> 16) & 0xfff; } @@ -577,22 +585,22 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, } /* Start off by resetting the NAND controller completely */ - writel(1, cafe->mmio + 0x3034); - writel(0, cafe->mmio + 0x3034); + cafe_writel(cafe, 1, NAND_RESET); + cafe_writel(cafe, 0, NAND_RESET); - /* Timings from Marvell's test code (not verified or calculated by us) */ - writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); + cafe_writel(cafe, 0xffffffff, NAND_IRQ_MASK); + /* Timings from Marvell's test code (not verified or calculated by us) */ if (!slowtiming) { - writel(0x01010a0a, cafe->mmio + CAFE_NAND_TIMING1); - writel(0x24121212, cafe->mmio + CAFE_NAND_TIMING2); - writel(0x11000000, cafe->mmio + CAFE_NAND_TIMING3); + cafe_writel(cafe, 0x01010a0a, NAND_TIMING1); + cafe_writel(cafe, 0x24121212, NAND_TIMING2); + cafe_writel(cafe, 0x11000000, NAND_TIMING3); } else { - writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING1); - writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING2); - writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING3); + cafe_writel(cafe, 0xffffffff, NAND_TIMING1); + cafe_writel(cafe, 0xffffffff, NAND_TIMING2); + cafe_writel(cafe, 0xffffffff, NAND_TIMING3); } - writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); + cafe_writel(cafe, 0xffffffff, NAND_IRQ_MASK); err = request_irq(pdev->irq, &cafe_nand_interrupt, SA_SHIRQ, "CAFE NAND", mtd); if (err) { dev_warn(&pdev->dev, "Could not register IRQ %d\n", pdev->irq); @@ -601,31 +609,31 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, } #if 1 /* Disable master reset, enable NAND clock */ - ctrl = readl(cafe->mmio + 0x3004); + ctrl = cafe_readl(cafe, GLOBAL_CTRL); ctrl &= 0xffffeff0; ctrl |= 0x00007000; - writel(ctrl | 0x05, cafe->mmio + 0x3004); - writel(ctrl | 0x0a, cafe->mmio + 0x3004); - writel(0, cafe->mmio + CAFE_NAND_DMA_CTRL); + cafe_writel(cafe, ctrl | 0x05, GLOBAL_CTRL); + cafe_writel(cafe, ctrl | 0x0a, GLOBAL_CTRL); + cafe_writel(cafe, 0, NAND_DMA_CTRL); - writel(0x7006, cafe->mmio + 0x3004); - writel(0x700a, cafe->mmio + 0x3004); + cafe_writel(cafe, 0x7006, GLOBAL_CTRL); + cafe_writel(cafe, 0x700a, GLOBAL_CTRL); /* Set up DMA address */ - writel(cafe->dmaaddr & 0xffffffff, cafe->mmio + CAFE_NAND_DMA_ADDR0); + cafe_writel(cafe, cafe->dmaaddr & 0xffffffff, NAND_DMA_ADDR0); if (sizeof(cafe->dmaaddr) > 4) /* Shift in two parts to shut the compiler up */ - writel((cafe->dmaaddr >> 16) >> 16, cafe->mmio + CAFE_NAND_DMA_ADDR1); + cafe_writel(cafe, (cafe->dmaaddr >> 16) >> 16, NAND_DMA_ADDR1); else - writel(0, cafe->mmio + CAFE_NAND_DMA_ADDR1); + cafe_writel(cafe, 0, NAND_DMA_ADDR1); cafe_dev_dbg(&cafe->pdev->dev, "Set DMA address to %x (virt %p)\n", - readl(cafe->mmio + CAFE_NAND_DMA_ADDR0), cafe->dmabuf); + cafe_readl(cafe, NAND_DMA_ADDR0), cafe->dmabuf); /* Enable NAND IRQ in global IRQ mask register */ - writel(0x80000007, cafe->mmio + 0x300c); + cafe_writel(cafe, 0x80000007, GLOBAL_IRQ_MASK); cafe_dev_dbg(&cafe->pdev->dev, "Control %x, IRQ mask %x\n", - readl(cafe->mmio + 0x3004), readl(cafe->mmio + 0x300c)); + cafe_readl(cafe, GLOBAL_CTRL), cafe_readl(cafe, GLOBAL_IRQ_MASK)); #endif #if 1 mtd->writesize=2048; @@ -649,7 +657,7 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, #if 0 writel(0x84600070, cafe->mmio); udelay(10); - cafe_dev_dbg(&cafe->pdev->dev, "Status %x\n", readl(cafe->mmio + 0x30)); + cafe_dev_dbg(&cafe->pdev->dev, "Status %x\n", cafe_readl(cafe, NAND_NONMEM)); #endif /* Scan to find existance of the device */ if (nand_scan_ident(mtd, 1)) { @@ -697,7 +705,7 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, out_irq: /* Disable NAND IRQ in global IRQ mask register */ - writel(~1 & readl(cafe->mmio + 0x300c), cafe->mmio + 0x300c); + cafe_writel(cafe, ~1 & cafe_readl(cafe, GLOBAL_IRQ_MASK), GLOBAL_IRQ_MASK); free_irq(pdev->irq, mtd); out_free_dma: dma_free_coherent(&cafe->pdev->dev, 2112, cafe->dmabuf, cafe->dmaaddr); @@ -716,7 +724,7 @@ static void __devexit cafe_nand_remove(struct pci_dev *pdev) del_mtd_device(mtd); /* Disable NAND IRQ in global IRQ mask register */ - writel(~1 & readl(cafe->mmio + 0x300c), cafe->mmio + 0x300c); + cafe_writel(cafe, ~1 & cafe_readl(cafe, GLOBAL_IRQ_MASK), GLOBAL_IRQ_MASK); free_irq(pdev->irq, mtd); nand_release(mtd); pci_iounmap(pdev, cafe->mmio); -- cgit v1.2.3 From be8444bdf34f7ba21e2364ca296c68e81033e3b2 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Tue, 31 Oct 2006 12:36:04 +0800 Subject: =?UTF-8?q?[MTD]=20NAND:=20Add=20register=20debugging=20spew=20opt?= =?UTF-8?q?ion=20to=20CAF=C3=89=20driver?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe.c | 26 +++++++++++++------------- 1 file changed, 13 insertions(+), 13 deletions(-) (limited to 'drivers/mtd') diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c index 175cf82393e..c5d03b07f7a 100644 --- a/drivers/mtd/nand/cafe.c +++ b/drivers/mtd/nand/cafe.c @@ -72,6 +72,9 @@ module_param(skipbbt, int, 0644); static int debug = 0; module_param(debug, int, 0644); +static int regdebug = 0; +module_param(regdebug, int, 0644); + static int checkecc = 1; module_param(checkecc, int, 0644); @@ -228,12 +231,6 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, cafe_writel(cafe, cafe->ctl2 | 0x100 | NAND_CMD_READSTART, NAND_CTRL2); do_command: -#if 0 - /* http://dev.laptop.org/ticket/200 - ECC on read only works if we read precisely 0x80e bytes */ - if (cafe->datalen == 2112) - cafe->datalen = 2062; -#endif cafe_dev_dbg(&cafe->pdev->dev, "dlen %x, ctl1 %x, ctl2 %x\n", cafe->datalen, ctl1, cafe_readl(cafe, NAND_CTRL2)); @@ -254,13 +251,13 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, } cafe->datalen = 0; -#if 0 - { int i; - printk("About to write command %08x\n", ctl1); - for (i=0; i< 0x5c; i+=4) - printk("Register %x: %08x\n", i, readl(cafe->mmio + i)); + if (unlikely(regdebug)) { + int i; + printk("About to write command %08x to register 0\n", ctl1); + for (i=4; i< 0x5c; i+=4) + printk("Register %x: %08x\n", i, readl(cafe->mmio + i)); } -#endif + cafe_writel(cafe, ctl1, NAND_CTRL1); /* Apply this short delay always to ensure that we do wait tWB in * any case on any machine. */ @@ -388,7 +385,10 @@ static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, } if ((i = cafe_correct_ecc(buf, syn)) < 0) { - dev_dbg(&cafe->pdev->dev, "Failed to correct ECC\n"); + dev_dbg(&cafe->pdev->dev, "Failed to correct ECC at %08x\n", + cafe_readl(cafe, NAND_ADDR2) * 2048); + for (i=0; i< 0x5c; i+=4) + printk("Register %x: %08x\n", i, readl(cafe->mmio + i)); mtd->ecc_stats.failed++; } else { dev_dbg(&cafe->pdev->dev, "Corrected %d symbol errors\n", i); -- cgit v1.2.3 From cad40654c312fc51bdb520e9be91e29a9742bbcb Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Wed, 1 Nov 2006 08:19:20 +0800 Subject: =?UTF-8?q?[MTD]=20NAND:=20Fix=20ECC=20settings=20in=20CAF=C3=89?= =?UTF-8?q?=20controller=20driver.?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit We were resetting cafe->ctl2 to zero after an erase (and also during a write, but it was correctly reset after that). This meant that ECC reads after an erase were failing. Doh. Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe.c | 10 +++------- 1 file changed, 3 insertions(+), 7 deletions(-) (limited to 'drivers/mtd') diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c index c5d03b07f7a..fad304bf7b7 100644 --- a/drivers/mtd/nand/cafe.c +++ b/drivers/mtd/nand/cafe.c @@ -159,6 +159,7 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, /* Second half of a command we already calculated */ cafe_writel(cafe, cafe->ctl2 | 0x100 | command, NAND_CTRL2); ctl1 = cafe->ctl1; + cafe->ctl2 &= ~(1<<30); cafe_dev_dbg(&cafe->pdev->dev, "Continue command, ctl1 %08x, #data %d\n", cafe->ctl1, cafe->nr_data); goto do_command; @@ -219,7 +220,6 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, /* Ignore the first command of a pair; the hardware deals with them both at once, later */ cafe->ctl1 = ctl1; - cafe->ctl2 = 0; cafe_dev_dbg(&cafe->pdev->dev, "Setup for delayed command, ctl1 %08x, dlen %x\n", cafe->ctl1, cafe->datalen); return; @@ -281,9 +281,7 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, command, 500000-c, irqs, cafe_readl(cafe, NAND_IRQ)); } - - cafe->ctl2 &= ~(1<<8); - cafe->ctl2 &= ~(1<<30); + WARN_ON(cafe->ctl2 & (1<<30)); switch (command) { @@ -471,9 +469,7 @@ static void cafe_nand_write_page_lowlevel(struct mtd_info *mtd, chip->write_buf(mtd, chip->oob_poi, mtd->oobsize); /* Set up ECC autogeneration */ - cafe->ctl2 |= (1<<27) | (1<<30); - if (mtd->writesize == 2048) - cafe->ctl2 |= (1<<29); + cafe->ctl2 |= (1<<30); } static int cafe_nand_write_page(struct mtd_info *mtd, struct nand_chip *chip, -- cgit v1.2.3